# v3.0-devel import numpy import math from scipy import optimize, interpolate, signal, stats, ndimage from scipy.fftpack import fft import scipy from scipy.optimize import least_squares import re import datetime import copy import sys import importlib import itertools from multiprocessing import Pool, TimeoutError from multiprocessing.pool import ThreadPool import time import matplotlib.pyplot as plt from scipy.optimize import fmin_l_bfgs_b #optimize with bounds on state papameters from .jroproc_base import ProcessingUnit, Operation, MPDecorator from schainpy.model.data.jrodata import Parameters, hildebrand_sekhon from scipy import asarray as ar,exp from scipy.optimize import fmin, curve_fit from schainpy.utils import log import warnings from numpy import NaN from scipy.optimize.optimize import OptimizeWarning warnings.filterwarnings('ignore') SPEED_OF_LIGHT = 299792458 '''solving pickling issue''' def _pickle_method(method): func_name = method.__func__.__name__ obj = method.__self__ cls = method.__self__.__class__ return _unpickle_method, (func_name, obj, cls) def _unpickle_method(func_name, obj, cls): for cls in cls.mro(): try: func = cls.__dict__[func_name] except KeyError: pass else: break return func.__get__(obj, cls) # @MPDecorator class ParametersProc(ProcessingUnit): METHODS = {} nSeconds = None def __init__(self): ProcessingUnit.__init__(self) self.buffer = None self.firstdatatime = None self.profIndex = 0 self.dataOut = Parameters() self.setupReq = False #Agregar a todas las unidades de proc def __updateObjFromInput(self): self.dataOut.inputUnit = self.dataIn.type self.dataOut.timeZone = self.dataIn.timeZone self.dataOut.dstFlag = self.dataIn.dstFlag self.dataOut.errorCount = self.dataIn.errorCount self.dataOut.useLocalTime = self.dataIn.useLocalTime self.dataOut.radarControllerHeaderObj = self.dataIn.radarControllerHeaderObj.copy() self.dataOut.systemHeaderObj = self.dataIn.systemHeaderObj.copy() self.dataOut.channelList = self.dataIn.channelList self.dataOut.heightList = self.dataIn.heightList self.dataOut.dtype = numpy.dtype([('real','0)) j2index = numpy.squeeze(numpy.where(numpy.diff(junk)<0)) if ((numpy.size(j1index)<=1) | (numpy.size(j2index)<=1)) : continue junk3 = numpy.squeeze(numpy.diff(j1index)) junk4 = numpy.squeeze(numpy.diff(j2index)) valleyindex = j2index[numpy.where(junk4>1)] peakindex = j1index[numpy.where(junk3>1)] isvalid = numpy.squeeze(numpy.where(numpy.abs(VelRange[gc_values[peakindex]]) <= 2.5*dv)) if numpy.size(isvalid) == 0 : continue if numpy.size(isvalid) >1 : vindex = numpy.argmax(self.spc[ich,gc_values[peakindex[isvalid]],ir]) isvalid = isvalid[vindex] # clutter peak gcpeak = peakindex[isvalid] vl = numpy.where(valleyindex < gcpeak) if numpy.size(vl) == 0: continue gcvl = valleyindex[vl[0][-1]] vr = numpy.where(valleyindex > gcpeak) if numpy.size(vr) == 0: continue gcvr = valleyindex[vr[0][0]] # Removing the clutter interpindex = numpy.array([gc_values[gcvl], gc_values[gcvr]]) gcindex = gc_values[gcvl+1:gcvr-1] self.spc_out[ich,gcindex,ir] = numpy.interp(VelRange[gcindex],VelRange[interpindex],self.spc[ich,interpindex,ir]) dataOut.data_pre[0] = self.spc_out return dataOut class SpectralFilters(Operation): ''' This class allows to replace the novalid values with noise for each channel This applies to CLAIRE RADAR PositiveLimit : RightLimit of novalid data NegativeLimit : LeftLimit of novalid data Input: self.dataOut.data_pre : SPC and CSPC self.dataOut.spc_range : To select wind and rainfall velocities Affected: self.dataOut.data_pre : It is used for the new SPC and CSPC ranges of wind Written by D. Scipión 29.01.2021 ''' def __init__(self): Operation.__init__(self) self.i = 0 def run(self, dataOut, ): self.spc = dataOut.data_pre[0].copy() self.Num_Chn = self.spc.shape[0] VelRange = dataOut.spc_range[2] # novalid corresponds to data within the Negative and PositiveLimit # Removing novalid data from the spectra for i in range(self.Num_Chn): self.spc[i,novalid,:] = dataOut.noise[i] dataOut.data_pre[0] = self.spc return dataOut class GaussianFit(Operation): ''' Function that fit of one and two generalized gaussians (gg) based on the PSD shape across an "power band" identified from a cumsum of the measured spectrum - noise. Input: self.dataOut.data_pre : SelfSpectra Output: self.dataOut.SPCparam : SPC_ch1, SPC_ch2 ''' def __init__(self): Operation.__init__(self) self.i=0 # def run(self, dataOut, num_intg=7, pnoise=1., SNRlimit=-9): #num_intg: Incoherent integrations, pnoise: Noise, vel_arr: range of velocities, similar to the ftt points def run(self, dataOut, SNRdBlimit=-9, method='generalized'): """This routine will find a couple of generalized Gaussians to a power spectrum methods: generalized, squared input: spc output: noise, amplitude0,shift0,width0,p0,Amplitude1,shift1,width1,p1 """ print ('Entering ',method,' double Gaussian fit') self.spc = dataOut.data_pre[0].copy() self.Num_Hei = self.spc.shape[2] self.Num_Bin = self.spc.shape[1] self.Num_Chn = self.spc.shape[0] start_time = time.time() pool = Pool(processes=self.Num_Chn) args = [(dataOut.spc_range[2], ich, dataOut.spc_noise[ich], dataOut.nIncohInt, SNRdBlimit) for ich in range(self.Num_Chn)] objs = [self for __ in range(self.Num_Chn)] attrs = list(zip(objs, args)) DGauFitParam = pool.map(target, attrs) # Parameters: # 0. Noise, 1. Amplitude, 2. Shift, 3. Width 4. Power dataOut.DGauFitParams = numpy.asarray(DGauFitParam) # Double Gaussian Curves gau0 = numpy.zeros([self.Num_Chn,self.Num_Bin,self.Num_Hei]) gau0[:] = numpy.NaN gau1 = numpy.zeros([self.Num_Chn,self.Num_Bin,self.Num_Hei]) gau1[:] = numpy.NaN x_mtr = numpy.transpose(numpy.tile(dataOut.getVelRange(1)[:-1], (self.Num_Hei,1))) for iCh in range(self.Num_Chn): N0 = numpy.transpose(numpy.transpose([dataOut.DGauFitParams[iCh][0,:,0]] * self.Num_Bin)) N1 = numpy.transpose(numpy.transpose([dataOut.DGauFitParams[iCh][0,:,1]] * self.Num_Bin)) A0 = numpy.transpose(numpy.transpose([dataOut.DGauFitParams[iCh][1,:,0]] * self.Num_Bin)) A1 = numpy.transpose(numpy.transpose([dataOut.DGauFitParams[iCh][1,:,1]] * self.Num_Bin)) v0 = numpy.transpose(numpy.transpose([dataOut.DGauFitParams[iCh][2,:,0]] * self.Num_Bin)) v1 = numpy.transpose(numpy.transpose([dataOut.DGauFitParams[iCh][2,:,1]] * self.Num_Bin)) s0 = numpy.transpose(numpy.transpose([dataOut.DGauFitParams[iCh][3,:,0]] * self.Num_Bin)) s1 = numpy.transpose(numpy.transpose([dataOut.DGauFitParams[iCh][3,:,1]] * self.Num_Bin)) if method == 'generalized': p0 = numpy.transpose(numpy.transpose([dataOut.DGauFitParams[iCh][4,:,0]] * self.Num_Bin)) p1 = numpy.transpose(numpy.transpose([dataOut.DGauFitParams[iCh][4,:,1]] * self.Num_Bin)) elif method == 'squared': p0 = 2. p1 = 2. gau0[iCh] = A0*numpy.exp(-0.5*numpy.abs((x_mtr-v0)/s0)**p0)+N0 gau1[iCh] = A1*numpy.exp(-0.5*numpy.abs((x_mtr-v1)/s1)**p1)+N1 dataOut.GaussFit0 = gau0 dataOut.GaussFit1 = gau1 print('Leaving ',method ,' double Gaussian fit') return dataOut def FitGau(self, X): # print('Entering FitGau') # Assigning the variables Vrange, ch, wnoise, num_intg, SNRlimit = X # Noise Limits noisebl = wnoise * 0.9 noisebh = wnoise * 1.1 # Radar Velocity Va = max(Vrange) deltav = Vrange[1] - Vrange[0] x = numpy.arange(self.Num_Bin) # print ('stop 0') # 5 parameters, 2 Gaussians DGauFitParam = numpy.zeros([5, self.Num_Hei,2]) DGauFitParam[:] = numpy.NaN # SPCparam = [] # SPC_ch1 = numpy.zeros([self.Num_Bin,self.Num_Hei]) # SPC_ch2 = numpy.zeros([self.Num_Bin,self.Num_Hei]) # SPC_ch1[:] = 0 #numpy.NaN # SPC_ch2[:] = 0 #numpy.NaN # print ('stop 1') for ht in range(self.Num_Hei): # print (ht) # print ('stop 2') # Spectra at each range spc = numpy.asarray(self.spc)[ch,:,ht] snr = ( spc.mean() - wnoise ) / wnoise snrdB = 10.*numpy.log10(snr) #print ('stop 3') if snrdB < SNRlimit : # snr = numpy.NaN # SPC_ch1[:,ht] = 0#numpy.NaN # SPC_ch1[:,ht] = 0#numpy.NaN # SPCparam = (SPC_ch1,SPC_ch2) # print ('SNR less than SNRth') continue # wnoise = hildebrand_sekhon(spc,num_intg) # print ('stop 2.01') ############################################# # normalizing spc and noise # This part differs from gg1 # spc_norm_max = max(spc) #commented by D. Scipión 19.03.2021 #spc = spc / spc_norm_max # pnoise = pnoise #/ spc_norm_max #commented by D. Scipión 19.03.2021 ############################################# # print ('stop 2.1') fatspectra=1.0 # noise per channel.... we might want to use the noise at each range # wnoise = noise_ #/ spc_norm_max #commented by D. Scipión 19.03.2021 #wnoise,stdv,i_max,index =enoise(spc,num_intg) #noise estimate using Hildebrand Sekhon, only wnoise is used #if wnoise>1.1*pnoise: # to be tested later # wnoise=pnoise # noisebl = wnoise*0.9 # noisebh = wnoise*1.1 spc = spc - wnoise # signal # print ('stop 2.2') minx = numpy.argmin(spc) #spcs=spc.copy() spcs = numpy.roll(spc,-minx) cum = numpy.cumsum(spcs) # tot_noise = wnoise * self.Num_Bin #64; # print ('stop 2.3') # snr = sum(spcs) / tot_noise # snrdB = 10.*numpy.log10(snr) #print ('stop 3') # if snrdB < SNRlimit : # snr = numpy.NaN # SPC_ch1[:,ht] = 0#numpy.NaN # SPC_ch1[:,ht] = 0#numpy.NaN # SPCparam = (SPC_ch1,SPC_ch2) # print ('SNR less than SNRth') # continue #if snrdB<-18 or numpy.isnan(snrdB) or num_intg<4: # return [None,]*4,[None,]*4,None,snrdB,None,None,[None,]*5,[None,]*9,None # print ('stop 4') cummax = max(cum) epsi = 0.08 * fatspectra # cumsum to narrow down the energy region cumlo = cummax * epsi cumhi = cummax * (1-epsi) powerindex = numpy.array(numpy.where(numpy.logical_and(cum>cumlo, cum-12: # when SNR is strong pick the peak with least shift (LOS velocity) error if oneG: choice = 0 else: w1 = lsq2[0][1]; w2 = lsq2[0][5] a1 = lsq2[0][2]; a2 = lsq2[0][6] p1 = lsq2[0][3]; p2 = lsq2[0][7] s1 = (2**(1+1./p1))*scipy.special.gamma(1./p1)/p1 s2 = (2**(1+1./p2))*scipy.special.gamma(1./p2)/p2 gp1 = a1*w1*s1; gp2 = a2*w2*s2 # power content of each ggaussian with proper p scaling if gp1>gp2: if a1>0.7*a2: choice = 1 else: choice = 2 elif gp2>gp1: if a2>0.7*a1: choice = 2 else: choice = 1 else: choice = numpy.argmax([a1,a2])+1 #else: #choice=argmin([std2a,std2b])+1 else: # with low SNR go to the most energetic peak choice = numpy.argmax([lsq1[0][2]*lsq1[0][1],lsq2[0][2]*lsq2[0][1],lsq2[0][6]*lsq2[0][5]]) # print ('stop 14') shift0 = lsq2[0][0] vel0 = Vrange[0] + shift0 * deltav shift1 = lsq2[0][4] # vel1=Vrange[0] + shift1 * deltav # max_vel = 1.0 # Va = max(Vrange) # deltav = Vrange[1]-Vrange[0] # print ('stop 15') #first peak will be 0, second peak will be 1 # if vel0 > -1.0 and vel0 < max_vel : #first peak is in the correct range # Commented by D.Scipión 19.03.2021 if vel0 > -Va and vel0 < Va : #first peak is in the correct range shift0 = lsq2[0][0] width0 = lsq2[0][1] Amplitude0 = lsq2[0][2] p0 = lsq2[0][3] shift1 = lsq2[0][4] width1 = lsq2[0][5] Amplitude1 = lsq2[0][6] p1 = lsq2[0][7] noise = lsq2[0][8] else: shift1 = lsq2[0][0] width1 = lsq2[0][1] Amplitude1 = lsq2[0][2] p1 = lsq2[0][3] shift0 = lsq2[0][4] width0 = lsq2[0][5] Amplitude0 = lsq2[0][6] p0 = lsq2[0][7] noise = lsq2[0][8] if Amplitude0<0.05: # in case the peak is noise shift0,width0,Amplitude0,p0 = 4*[numpy.NaN] if Amplitude1<0.05: shift1,width1,Amplitude1,p1 = 4*[numpy.NaN] # print ('stop 16 ') # SPC_ch1[:,ht] = noise + Amplitude0*numpy.exp(-0.5*(abs(x-shift0)/width0)**p0) # SPC_ch2[:,ht] = noise + Amplitude1*numpy.exp(-0.5*(abs(x-shift1)/width1)**p1) # SPCparam = (SPC_ch1,SPC_ch2) DGauFitParam[0,ht,0] = noise DGauFitParam[0,ht,1] = noise DGauFitParam[1,ht,0] = Amplitude0 DGauFitParam[1,ht,1] = Amplitude1 DGauFitParam[2,ht,0] = Vrange[0] + shift0 * deltav DGauFitParam[2,ht,1] = Vrange[0] + shift1 * deltav DGauFitParam[3,ht,0] = width0 * deltav DGauFitParam[3,ht,1] = width1 * deltav DGauFitParam[4,ht,0] = p0 DGauFitParam[4,ht,1] = p1 return DGauFitParam def y_model1(self,x,state): shift0, width0, amplitude0, power0, noise = state model0 = amplitude0*numpy.exp(-0.5*abs((x - shift0)/width0)**power0) model0u = amplitude0*numpy.exp(-0.5*abs((x - shift0 - self.Num_Bin)/width0)**power0) model0d = amplitude0*numpy.exp(-0.5*abs((x - shift0 + self.Num_Bin)/width0)**power0) return model0 + model0u + model0d + noise def y_model2(self,x,state): #Equation for two generalized Gaussians with Nyquist shift0, width0, amplitude0, power0, shift1, width1, amplitude1, power1, noise = state model0 = amplitude0*numpy.exp(-0.5*abs((x-shift0)/width0)**power0) model0u = amplitude0*numpy.exp(-0.5*abs((x - shift0 - self.Num_Bin)/width0)**power0) model0d = amplitude0*numpy.exp(-0.5*abs((x - shift0 + self.Num_Bin)/width0)**power0) model1 = amplitude1*numpy.exp(-0.5*abs((x - shift1)/width1)**power1) model1u = amplitude1*numpy.exp(-0.5*abs((x - shift1 - self.Num_Bin)/width1)**power1) model1d = amplitude1*numpy.exp(-0.5*abs((x - shift1 + self.Num_Bin)/width1)**power1) return model0 + model0u + model0d + model1 + model1u + model1d + noise def misfit1(self,state,y_data,x,num_intg): # This function compares how close real data is with the model data, the close it is, the better it is. return num_intg*sum((numpy.log(y_data)-numpy.log(self.y_model1(x,state)))**2)#/(64-5.) # /(64-5.) can be commented def misfit2(self,state,y_data,x,num_intg): return num_intg*sum((numpy.log(y_data)-numpy.log(self.y_model2(x,state)))**2)#/(64-9.) class Oblique_Gauss_Fit(Operation): ''' Written by R. Flores ''' def __init__(self): Operation.__init__(self) def Gauss_fit(self,spc,x,nGauss): def gaussian(x, a, b, c, d): val = a * numpy.exp(-(x - b)**2 / (2*c**2)) + d return val if nGauss == 'first': spc_1_aux = numpy.copy(spc[:numpy.argmax(spc)+1]) spc_2_aux = numpy.flip(spc_1_aux) spc_3_aux = numpy.concatenate((spc_1_aux,spc_2_aux[1:])) len_dif = len(x)-len(spc_3_aux) spc_zeros = numpy.ones(len_dif)*spc_1_aux[0] spc_new = numpy.concatenate((spc_3_aux,spc_zeros)) y = spc_new elif nGauss == 'second': y = spc # estimate starting values from the data a = y.max() b = x[numpy.argmax(y)] if nGauss == 'first': c = 1.#b#b#numpy.std(spc) elif nGauss == 'second': c = b else: print("ERROR") d = numpy.mean(y[-100:]) # define a least squares function to optimize def minfunc(params): return sum((y-gaussian(x,params[0],params[1],params[2],params[3]))**2) # fit popt = fmin(minfunc,[a,b,c,d],disp=False) #popt,fopt,niter,funcalls = fmin(minfunc,[a,b,c,d]) return gaussian(x, popt[0], popt[1], popt[2], popt[3]), popt[0], popt[1], popt[2], popt[3] def Gauss_fit_2(self,spc,x,nGauss): def gaussian(x, a, b, c, d): val = a * numpy.exp(-(x - b)**2 / (2*c**2)) + d return val if nGauss == 'first': spc_1_aux = numpy.copy(spc[:numpy.argmax(spc)+1]) spc_2_aux = numpy.flip(spc_1_aux) spc_3_aux = numpy.concatenate((spc_1_aux,spc_2_aux[1:])) len_dif = len(x)-len(spc_3_aux) spc_zeros = numpy.ones(len_dif)*spc_1_aux[0] spc_new = numpy.concatenate((spc_3_aux,spc_zeros)) y = spc_new elif nGauss == 'second': y = spc # estimate starting values from the data a = y.max() b = x[numpy.argmax(y)] if nGauss == 'first': c = 1.#b#b#numpy.std(spc) elif nGauss == 'second': c = b else: print("ERROR") d = numpy.mean(y[-100:]) # define a least squares function to optimize popt,pcov = curve_fit(gaussian,x,y,p0=[a,b,c,d]) #popt,fopt,niter,funcalls = fmin(minfunc,[a,b,c,d]) #return gaussian(x, popt[0], popt[1], popt[2], popt[3]), popt[0], popt[1], popt[2], popt[3] return gaussian(x, popt[0], popt[1], popt[2], popt[3]),popt[0], popt[1], popt[2], popt[3] def Double_Gauss_fit(self,spc,x,A1,B1,C1,A2,B2,C2,D): def double_gaussian(x, a1, b1, c1, a2, b2, c2, d): val = a1 * numpy.exp(-(x - b1)**2 / (2*c1**2)) + a2 * numpy.exp(-(x - b2)**2 / (2*c2**2)) + d return val y = spc # estimate starting values from the data a1 = A1 b1 = B1 c1 = C1#numpy.std(spc) a2 = A2#y.max() b2 = B2#x[numpy.argmax(y)] c2 = C2#numpy.std(spc) d = D # define a least squares function to optimize def minfunc(params): return sum((y-double_gaussian(x,params[0],params[1],params[2],params[3],params[4],params[5],params[6]))**2) # fit popt = fmin(minfunc,[a1,b1,c1,a2,b2,c2,d],disp=False) return double_gaussian(x, popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6]), popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6] def Double_Gauss_fit_2(self,spc,x,A1,B1,C1,A2,B2,C2,D): def double_gaussian(x, a1, b1, c1, a2, b2, c2, d): val = a1 * numpy.exp(-(x - b1)**2 / (2*c1**2)) + a2 * numpy.exp(-(x - b2)**2 / (2*c2**2)) + d return val y = spc # estimate starting values from the data a1 = A1 b1 = B1 c1 = C1#numpy.std(spc) a2 = A2#y.max() b2 = B2#x[numpy.argmax(y)] c2 = C2#numpy.std(spc) d = D # fit popt,pcov = curve_fit(double_gaussian,x,y,p0=[a1,b1,c1,a2,b2,c2,d]) error = numpy.sqrt(numpy.diag(pcov)) return popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6], error[0], error[1], error[2], error[3], error[4], error[5], error[6] def windowing_double(self,spc,x,A1,B1,C1,A2,B2,C2,D): from scipy.optimize import curve_fit,fmin def R_gaussian(x, a, b, c): N = int(numpy.shape(x)[0]) val = a * numpy.exp(-((x)*c*2*2*numpy.pi)**2 / (2))* numpy.exp(1.j*b*x*4*numpy.pi) return val def T(x,N): T = 1-abs(x)/N return T def R_T_spc_fun(x, a1, b1, c1, a2, b2, c2, d): N = int(numpy.shape(x)[0]) x_max = x[-1] x_pos = x[1600:] x_neg = x[:1600] R_T_neg_1 = R_gaussian(x, a1, b1, c1)[:1600]*T(x_neg,-x[0]) R_T_pos_1 = R_gaussian(x, a1, b1, c1)[1600:]*T(x_pos,x[-1]) R_T_sum_1 = R_T_pos_1 + R_T_neg_1 R_T_spc_1 = numpy.fft.fft(R_T_sum_1).real R_T_spc_1 = numpy.fft.fftshift(R_T_spc_1) max_val_1 = numpy.max(R_T_spc_1) R_T_spc_1 = R_T_spc_1*a1/max_val_1 R_T_neg_2 = R_gaussian(x, a2, b2, c2)[:1600]*T(x_neg,-x[0]) R_T_pos_2 = R_gaussian(x, a2, b2, c2)[1600:]*T(x_pos,x[-1]) R_T_sum_2 = R_T_pos_2 + R_T_neg_2 R_T_spc_2 = numpy.fft.fft(R_T_sum_2).real R_T_spc_2 = numpy.fft.fftshift(R_T_spc_2) max_val_2 = numpy.max(R_T_spc_2) R_T_spc_2 = R_T_spc_2*a2/max_val_2 R_T_d = d*numpy.fft.fftshift(signal.unit_impulse(N)) R_T_d_neg = R_T_d[:1600]*T(x_neg,-x[0]) R_T_d_pos = R_T_d[1600:]*T(x_pos,x[-1]) R_T_d_sum = R_T_d_pos + R_T_d_neg R_T_spc_3 = numpy.fft.fft(R_T_d_sum).real R_T_spc_3 = numpy.fft.fftshift(R_T_spc_3) R_T_final = R_T_spc_1 + R_T_spc_2 + R_T_spc_3 return R_T_final y = spc#gaussian(x, a, meanY, sigmaY) + a*0.1*numpy.random.normal(0, 1, size=len(x)) from scipy.stats import norm mean,std=norm.fit(spc) # estimate starting values from the data a1 = A1 b1 = B1 c1 = C1#numpy.std(spc) a2 = A2#y.max() b2 = B2#x[numpy.argmax(y)] c2 = C2#numpy.std(spc) d = D ippSeconds = 250*20*1.e-6/3 x_t = ippSeconds * (numpy.arange(1600) -1600 / 2.) x_t = numpy.linspace(x_t[0],x_t[-1],3200) x_freq = numpy.fft.fftfreq(1600,d=ippSeconds) x_freq = numpy.fft.fftshift(x_freq) # define a least squares function to optimize def minfunc(params): #print(params[2]) #print(numpy.shape(params[2])) return sum((y-R_T_spc_fun(x_t,params[0],params[1],params[2],params[3],params[4],params[5],params[6]))**2/1)#y**2) # fit popt_full = fmin(minfunc,[a1,b1,c1,a2,b2,c2,d],full_output=True) #print("nIter", popt_full[2]) popt = popt_full[0] #return R_T_spc_fun(x_t,popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6]), popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6] return popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6] def Double_Gauss_fit_weight(self,spc,x,A1,B1,C1,A2,B2,C2,D): from scipy.optimize import curve_fit,fmin def double_gaussian(x, a1, b1, c1, a2, b2, c2, d): val = a1 * numpy.exp(-(x - b1)**2 / (2*c1**2)) + a2 * numpy.exp(-(x - b2)**2 / (2*c2**2)) + d return val y = spc from scipy.stats import norm mean,std=norm.fit(spc) # estimate starting values from the data a1 = A1 b1 = B1 c1 = C1#numpy.std(spc) a2 = A2#y.max() b2 = B2#x[numpy.argmax(y)] c2 = C2#numpy.std(spc) d = D y_clean = signal.medfilt(y) # define a least squares function to optimize def minfunc(params): return sum((y-double_gaussian(x,params[0],params[1],params[2],params[3],params[4],params[5],params[6]))**2/(y_clean**2/1)) # fit popt_full = fmin(minfunc,[a1,b1,c1,a2,b2,c2,d], disp =False, full_output=True) #print("nIter", popt_full[2]) popt = popt_full[0] #popt,pcov = curve_fit(double_gaussian,x,y,p0=[a1,b1,c1,a2,b2,c2,d]) #return double_gaussian(x, popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6]), popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6] return popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6] def DH_mode(self,spectra,VelRange): from scipy.optimize import curve_fit def double_gauss(x, a1,b1,c1, a2,b2,c2, d): val = a1 * numpy.exp(-(x - b1)**2 / (2*c1**2)) + a2 * numpy.exp(-(x - b2)**2 / (2*c2**2)) + d return val spec = (spectra.copy()).flatten() amp=spec.max() params=numpy.array([amp,-400,30,amp/4,-200,150,1.0e7]) #try: popt,pcov=curve_fit(double_gauss, VelRange, spec, p0=params,bounds=([0,-460,0,0,-400,120,0],[numpy.inf,-340,50,numpy.inf,0,250,numpy.inf])) error = numpy.sqrt(numpy.diag(pcov)) #doppler_2=popt[4] #err_2 = numpy.sqrt(pcov[4][4]) #except: #pass #doppler_2=numpy.NAN #err_2 = numpy.NAN #return doppler_2, err_2 return popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6], error[0], error[1], error[2], error[3], error[4], error[5], error[6] def Tri_Marco(self,spc,freq,a1,b1,c1,a2,b2,c2,d): from scipy.optimize import least_squares freq_max = numpy.max(numpy.abs(freq)) spc_max = numpy.max(spc) def tri_gaussian(x, a1, b1, c1, a2, b2, c2, a3, b3, c3, d): z1 = (x-b1)/c1 z2 = (x-b2)/c2 z3 = (x-b3)/c3 val = a1 * numpy.exp(-z1**2/2) + a2 * numpy.exp(-z2**2/2) + a3 * numpy.exp(-z3**2/2) + d return val from scipy.signal import medfilt Nincoh = 20 spcm = medfilt(spc,11)/numpy.sqrt(Nincoh) c1 = abs(c1) c2 = abs(c2) # define a least squares function to optimize def lsq_func(params): return (spc-tri_gaussian(freq,params[0],params[1],params[2],params[3],params[4],params[5],params[6],params[7],params[8],params[9]))/spcm # fit #bounds=([0,-460,0,0,-400,120,0],[numpy.inf,-340,50,numpy.inf,0,250,numpy.inf]) bounds=([0,-numpy.inf,0,0,-numpy.inf,0,0,0,0,0],[numpy.inf,-100,numpy.inf,numpy.inf,0,numpy.inf,numpy.inf,600,numpy.inf,numpy.inf]) #bounds=([0,-180,0,0,-100,30,0,110,0,0],[numpy.inf,-110,20,numpy.inf,33,80,numpy.inf,150,16,numpy.inf]) #bounds=([0,-540,0,0,-300,100,0,330,0,0],[numpy.inf,-330,60,numpy.inf,100,240,numpy.inf,450,80,numpy.inf]) params_scale = [spc_max,freq_max,freq_max,spc_max,freq_max,freq_max,spc_max,freq_max,freq_max,spc_max] #print(a1,b1,c1,a2,b2,c2,d) popt = least_squares(lsq_func,[a1,b1,c1,a2,b2,c2,a2/4,-b1,c1,d],x_scale=params_scale,bounds=bounds) A1f = popt.x[0]; B1f = popt.x[1]; C1f = popt.x[2] A2f = popt.x[3]; B2f = popt.x[4]; C2f = popt.x[5] A3f = popt.x[6]; B3f = popt.x[7]; C3f = popt.x[8] Df = popt.x[9] return A1f, B1f, C1f, A2f, B2f, C2f, Df def Tri_Marco(self,spc,freq,a1,b1,c1,a2,b2,c2,d): from scipy.optimize import least_squares freq_max = numpy.max(numpy.abs(freq)) spc_max = numpy.max(spc) def duo_gaussian(x, a1, b1, c1, a2, b2, c2, d): z1 = (x-b1)/c1 z2 = (x-b2)/c2 #z3 = (x-b3)/c3 val = a1 * numpy.exp(-z1**2/2) + a2 * numpy.exp(-z2**2/2) + d return val from scipy.signal import medfilt Nincoh = 20 spcm = medfilt(spc,11)/numpy.sqrt(Nincoh) c1 = abs(c1) c2 = abs(c2) # define a least squares function to optimize def lsq_func(params): return (spc-tri_gaussian(freq,params[0],params[1],params[2],params[3],params[4],params[5],params[6]))/spcm # fit #bounds=([0,-460,0,0,-400,120,0],[numpy.inf,-340,50,numpy.inf,0,250,numpy.inf]) bounds=([0,-numpy.inf,0,0,-numpy.inf,0,0],[numpy.inf,-100,numpy.inf,numpy.inf,0,numpy.inf,numpy.inf]) #bounds=([0,-180,0,0,-100,30,0,110,0,0],[numpy.inf,-110,20,numpy.inf,33,80,numpy.inf,150,16,numpy.inf]) #bounds=([0,-540,0,0,-300,100,0,330,0,0],[numpy.inf,-330,60,numpy.inf,100,240,numpy.inf,450,80,numpy.inf]) params_scale = [spc_max,freq_max,freq_max,spc_max,freq_max,freq_max,spc_max] #print(a1,b1,c1,a2,b2,c2,d) popt = least_squares(lsq_func,[a1,b1,c1,a2,b2,c2,d],x_scale=params_scale,bounds=bounds) A1f = popt.x[0]; B1f = popt.x[1]; C1f = popt.x[2] A2f = popt.x[3]; B2f = popt.x[4]; C2f = popt.x[5] #A3f = popt.x[6]; B3f = popt.x[7]; C3f = popt.x[8] Df = popt.x[9] return A1f, B1f, C1f, A2f, B2f, C2f, Df def double_gaussian_skew(self,x, a1, b1, c1, a2, b2, c2, k2, d): #from scipy import special z1 = (x-b1)/c1 z2 = (x-b2)/c2 h2 = 1-k2*z2 h2[h2<0] = 0 y2 = -1/k2*numpy.log(h2) val = a1 * numpy.exp(-z1**2/2) + a2 * numpy.exp(-y2**2/2)/(1-k2*z2) + d return val def gaussian(self, x, a, b, c, d): z = (x-b)/c val = a * numpy.exp(-z**2/2) + d return val def double_gaussian(self, x, a1, b1, c1, a2, b2, c2, d): z1 = (x-b1)/c1 z2 = (x-b2)/c2 val = a1 * numpy.exp(-z1**2/2) + a2 * numpy.exp(-z2**2/2) + d return val def double_gaussian_double_skew(self,x, a1, b1, c1, k1, a2, b2, c2, k2, d): z1 = (x-b1)/c1 h1 = 1-k1*z1 h1[h1<0] = 0 y1 = -1/k1*numpy.log(h1) z2 = (x-b2)/c2 h2 = 1-k2*z2 h2[h2<0] = 0 y2 = -1/k2*numpy.log(h2) val = a1 * numpy.exp(-y1**2/2)/(1-k1*z1) + a2 * numpy.exp(-y2**2/2)/(1-k2*z2) + d return val def gaussian_skew(self,x, a2, b2, c2, k2, d): #from scipy import special z2 = (x-b2)/c2 h2 = 1-k2*z2 h2[h2<0] = 0 y2 = -1/k2*numpy.log(h2) val = a2 * numpy.exp(-y2**2/2)/(1-k2*z2) + d return val def triple_gaussian_skew(self,x, a1, b1, c1, a2, b2, c2, k2, a3, b3, c3, k3, d): #from scipy import special z1 = (x-b1)/c1 z2 = (x-b2)/c2 z3 = (x-b3)/c3 h2 = 1-k2*z2 h2[h2<0] = 0 y2 = -1/k2*numpy.log(h2) h3 = 1-k3*z3 h3[h3<0] = 0 y3 = -1/k3*numpy.log(h3) val = a1 * numpy.exp(-z1**2/2) + a2 * numpy.exp(-y2**2/2)/(1-k2*z2) + a3 * numpy.exp(-y3**2/2)/(1-k3*z3) + d return val def Double_Gauss_Skew_fit_weight_bound_no_inputs(self,spc,freq): from scipy.optimize import least_squares freq_max = numpy.max(numpy.abs(freq)) spc_max = numpy.max(spc) from scipy.signal import medfilt Nincoh = 20 spcm = medfilt(spc,11)/numpy.sqrt(Nincoh) # define a least squares function to optimize def lsq_func(params): return (spc-self.double_gaussian_skew(freq,params[0],params[1],params[2],params[3],params[4],params[5],params[6],params[7]))/spcm # fit # bounds=([0,-460,0,0,-400,120,0],[numpy.inf,-340,50,numpy.inf,0,250,numpy.inf]) # bounds=([0,-numpy.inf,0,0,-numpy.inf,0,-numpy.inf,0],[numpy.inf,-200,numpy.inf,numpy.inf,0,numpy.inf,0,numpy.inf]) #print(a1,b1,c1,a2,b2,c2,k2,d) bounds=([0,-numpy.inf,0,0,-400,0,0,0],[numpy.inf,-340,numpy.inf,numpy.inf,0,numpy.inf,numpy.inf,numpy.inf]) #print(bounds) #bounds=([0,-numpy.inf,0,0,-numpy.inf,0,0,0],[numpy.inf,-200,numpy.inf,numpy.inf,0,numpy.inf,numpy.inf,numpy.inf]) params_scale = [spc_max,freq_max,freq_max,spc_max,freq_max,freq_max,1,spc_max] x0_value = numpy.array([spc_max,-400,30,spc_max/4,-200,150,1,1.0e7]) #popt = least_squares(lsq_func,[a1,b1,c1,a2,b2,c2,k2,d],x0=x0_value,x_scale=params_scale,bounds=bounds,verbose=1) popt = least_squares(lsq_func,x0=x0_value,x_scale=params_scale,bounds=bounds,verbose=0) # popt = least_squares(lsq_func,[a1,b1,c1,a2,b2,c2,k2,d],x_scale=params_scale,verbose=1) A1f = popt.x[0]; B1f = popt.x[1]; C1f = popt.x[2] A2f = popt.x[3]; B2f = popt.x[4]; C2f = popt.x[5]; K2f = popt.x[6] Df = popt.x[7] aux = self.gaussian_skew(freq, A2f, B2f, C2f, K2f, Df) doppler = freq[numpy.argmax(aux)] #return A1f, B1f, C1f, A2f, B2f, C2f, K2f, Df, doppler return A1f, B1f, C1f, A2f, B2f, C2f, K2f, Df, doppler def Double_Gauss_Double_Skew_fit_weight_bound_no_inputs(self,spc,freq,Nincoh,hei): from scipy.optimize import least_squares freq_max = numpy.max(numpy.abs(freq)) spc_max = numpy.max(spc) #from scipy.signal import medfilt #Nincoh = 20 #Nincoh = 80 Nincoh = Nincoh #spcm = medfilt(spc,11)/numpy.sqrt(Nincoh) spcm = spc/numpy.sqrt(Nincoh) # define a least squares function to optimize def lsq_func(params): return (spc-self.double_gaussian_double_skew(freq,params[0],params[1],params[2],params[3],params[4],params[5],params[6],params[7],params[8]))/spcm # fit # bounds=([0,-460,0,0,-400,120,0],[numpy.inf,-340,50,numpy.inf,0,250,numpy.inf]) # bounds=([0,-numpy.inf,0,0,-numpy.inf,0,-numpy.inf,0],[numpy.inf,-200,numpy.inf,numpy.inf,0,numpy.inf,0,numpy.inf]) #print(a1,b1,c1,a2,b2,c2,k2,d) #bounds=([0,-numpy.inf,0,-numpy.inf,0,-400,0,0,0],[numpy.inf,-340,numpy.inf,0,numpy.inf,0,numpy.inf,numpy.inf,numpy.inf]) #bounds=([0,-numpy.inf,0,-numpy.inf,0,-400,0,0,0],[numpy.inf,-140,numpy.inf,0,numpy.inf,0,numpy.inf,numpy.inf,numpy.inf]) bounds=([0,-numpy.inf,0,-5,0,-400,0,0,0],[numpy.inf,-200,numpy.inf,5,numpy.inf,0,numpy.inf,numpy.inf,numpy.inf]) #print(bounds) #bounds=([0,-numpy.inf,0,0,-numpy.inf,0,0,0],[numpy.inf,-200,numpy.inf,numpy.inf,0,numpy.inf,numpy.inf,numpy.inf]) params_scale = [spc_max,freq_max,freq_max,1,spc_max,freq_max,freq_max,1,spc_max] ####################x0_value = numpy.array([spc_max,-400,30,-.1,spc_max/4,-200,150,1,1.0e7]) dop1_x0 = freq[numpy.argmax(spc)] ####dop1_x0 = freq[numpy.argmax(spcm)] if dop1_x0 < 0: dop2_x0 = dop1_x0 + 100 if dop1_x0 > 0: dop2_x0 = dop1_x0 - 100 ###########x0_value = numpy.array([spc_max,-200.5,30,-.1,spc_max/4,-100.5,150,1,1.0e7]) x0_value = numpy.array([spc_max,dop1_x0,30,-.1,spc_max/4, dop2_x0,150,1,1.0e7]) #x0_value = numpy.array([spc_max,-400.5,30,-.1,spc_max/4,-200.5,150,1,1.0e7]) #popt = least_squares(lsq_func,[a1,b1,c1,a2,b2,c2,k2,d],x0=x0_value,x_scale=params_scale,bounds=bounds,verbose=1) ''' print("INSIDE 1") print("x0_value: ", x0_value) print("boundaries: ", bounds) import matplotlib.pyplot as plt plt.plot(freq,spc) plt.plot(freq,self.double_gaussian_double_skew(freq,x0_value[0],x0_value[1],x0_value[2],x0_value[3],x0_value[4],x0_value[5],x0_value[6],x0_value[7],x0_value[8])) plt.title(hei) plt.show() ''' popt = least_squares(lsq_func,x0=x0_value,x_scale=params_scale,bounds=bounds,verbose=0) # popt = least_squares(lsq_func,[a1,b1,c1,a2,b2,c2,k2,d],x_scale=params_scale,verbose=1) #print(popt) #########print("INSIDE 2") J = popt.jac try: cov = numpy.linalg.inv(J.T.dot(J)) error = numpy.sqrt(numpy.diagonal(cov)) except: error = numpy.ones((9))*numpy.NAN #print("error_inside",error) #exit(1) A1f = popt.x[0]; B1f = popt.x[1]; C1f = popt.x[2]; K1f = popt.x[3] A2f = popt.x[4]; B2f = popt.x[5]; C2f = popt.x[6]; K2f = popt.x[7] Df = popt.x[8] ''' A1f_err = error.x[0]; B1f_err= error.x[1]; C1f_err = error.x[2]; K1f_err = error.x[3] A2f_err = error.x[4]; B2f_err = error.x[5]; C2f_err = error.x[6]; K2f_err = error.x[7] Df_err = error.x[8] ''' aux1 = self.gaussian_skew(freq, A1f, B1f, C1f, K1f, Df) doppler1 = freq[numpy.argmax(aux1)] aux2 = self.gaussian_skew(freq, A2f, B2f, C2f, K2f, Df) doppler2 = freq[numpy.argmax(aux2)] #print("error",error) #exit(1) return A1f, B1f, C1f, K1f, A2f, B2f, C2f, K2f, Df, doppler1, doppler2, error def Double_Gauss_fit_weight_bound_no_inputs(self,spc,freq,Nincoh): from scipy.optimize import least_squares freq_max = numpy.max(numpy.abs(freq)) spc_max = numpy.max(spc) from scipy.signal import medfilt Nincoh = 20 Nincoh = 80 Nincoh = Nincoh spcm = medfilt(spc,11)/numpy.sqrt(Nincoh) # define a least squares function to optimize def lsq_func(params): return (spc-self.double_gaussian(freq,params[0],params[1],params[2],params[3],params[4],params[5],params[6]))/spcm # fit # bounds=([0,-460,0,0,-400,120,0],[numpy.inf,-340,50,numpy.inf,0,250,numpy.inf]) # bounds=([0,-numpy.inf,0,0,-numpy.inf,0,-numpy.inf,0],[numpy.inf,-200,numpy.inf,numpy.inf,0,numpy.inf,0,numpy.inf]) #print(a1,b1,c1,a2,b2,c2,k2,d) dop1_x0 = freq[numpy.argmax(spcm)] #####bounds=([0,-numpy.inf,0,0,-400,0,0],[numpy.inf,-340,numpy.inf,numpy.inf,0,numpy.inf,numpy.inf]) #####bounds=([0,-numpy.inf,0,0,dop1_x0-50,0,0],[numpy.inf,-340,numpy.inf,numpy.inf,0,numpy.inf,numpy.inf]) bounds=([0,-numpy.inf,0,0,dop1_x0-50,0,0],[numpy.inf,-300,numpy.inf,numpy.inf,0,numpy.inf,numpy.inf]) #####bounds=([0,-numpy.inf,0,0,-500,0,0],[numpy.inf,-340,numpy.inf,numpy.inf,0,numpy.inf,numpy.inf]) #bounds=([0,-numpy.inf,0,-numpy.inf,0,-500,0,0,0],[numpy.inf,-240,numpy.inf,0,numpy.inf,0,numpy.inf,numpy.inf,numpy.inf]) #print(bounds) #bounds=([0,-numpy.inf,0,0,-numpy.inf,0,0,0],[numpy.inf,-200,numpy.inf,numpy.inf,0,numpy.inf,numpy.inf,numpy.inf]) params_scale = [spc_max,freq_max,freq_max,spc_max,freq_max,freq_max,spc_max] #x0_value = numpy.array([spc_max,-400.5,30,spc_max/4,-200.5,150,1.0e7]) x0_value = numpy.array([spc_max,-400.5,30,spc_max/4,dop1_x0,150,1.0e7]) #x0_value = numpy.array([spc_max,-420.5,30,-.1,spc_max/4,-50,150,.1,numpy.mean(spc[-50:])]) #print("before popt") #print(x0_value) #print("freq: ",freq) #popt = least_squares(lsq_func,[a1,b1,c1,a2,b2,c2,k2,d],x0=x0_value,x_scale=params_scale,bounds=bounds,verbose=1) popt = least_squares(lsq_func,x0=x0_value,x_scale=params_scale,bounds=bounds,verbose=0) # popt = least_squares(lsq_func,[a1,b1,c1,a2,b2,c2,k2,d],x_scale=params_scale,verbose=1) #print("after popt") J = popt.jac try: cov = numpy.linalg.inv(J.T.dot(J)) error = numpy.sqrt(numpy.diagonal(cov)) except: error = numpy.ones((7))*numpy.NAN A1f = popt.x[0]; B1f = popt.x[1]; C1f = popt.x[2] A2f = popt.x[3]; B2f = popt.x[4]; C2f = popt.x[5] Df = popt.x[6] #print("before return") return A1f, B1f, C1f, A2f, B2f, C2f, Df, error def Double_Gauss_Double_Skew_fit_weight_bound_with_inputs(self, spc, freq, a1, b1, c1, a2, b2, c2, k2, d): from scipy.optimize import least_squares freq_max = numpy.max(numpy.abs(freq)) spc_max = numpy.max(spc) from scipy.signal import medfilt Nincoh = dataOut.nIncohInt spcm = medfilt(spc,11)/numpy.sqrt(Nincoh) # define a least squares function to optimize def lsq_func(params): return (spc-self.double_gaussian_double_skew(freq,params[0],params[1],params[2],params[3],params[4],params[5],params[6],params[7],params[8]))/spcm bounds=([0,-numpy.inf,0,-numpy.inf,0,-400,0,0,0],[numpy.inf,-340,numpy.inf,0,numpy.inf,0,numpy.inf,numpy.inf,numpy.inf]) params_scale = [spc_max,freq_max,freq_max,1,spc_max,freq_max,freq_max,1,spc_max] x0_value = numpy.array([a1,b1,c1,-.1,a2,b2,c2,k2,d]) popt = least_squares(lsq_func,x0=x0_value,x_scale=params_scale,bounds=bounds,verbose=0) A1f = popt.x[0]; B1f = popt.x[1]; C1f = popt.x[2]; K1f = popt.x[3] A2f = popt.x[4]; B2f = popt.x[5]; C2f = popt.x[6]; K2f = popt.x[7] Df = popt.x[8] aux = self.gaussian_skew(freq, A2f, B2f, C2f, K2f, Df) doppler = x[numpy.argmax(aux)] return A1f, B1f, C1f, K1f, A2f, B2f, C2f, K2f, Df, doppler def Triple_Gauss_Skew_fit_weight_bound_no_inputs(self,spc,freq): from scipy.optimize import least_squares freq_max = numpy.max(numpy.abs(freq)) spc_max = numpy.max(spc) from scipy.signal import medfilt Nincoh = 20 spcm = medfilt(spc,11)/numpy.sqrt(Nincoh) # define a least squares function to optimize def lsq_func(params): return (spc-self.triple_gaussian_skew(freq,params[0],params[1],params[2],params[3],params[4],params[5],params[6],params[7],params[8],params[9],params[10],params[11]))/spcm # fit # bounds=([0,-460,0,0,-400,120,0],[numpy.inf,-340,50,numpy.inf,0,250,numpy.inf]) # bounds=([0,-numpy.inf,0,0,-numpy.inf,0,-numpy.inf,0],[numpy.inf,-200,numpy.inf,numpy.inf,0,numpy.inf,0,numpy.inf]) #print(a1,b1,c1,a2,b2,c2,k2,d) bounds=([0,-numpy.inf,0,0,-400,0,0,0,0,0,0,0],[numpy.inf,-340,numpy.inf,numpy.inf,0,numpy.inf,numpy.inf,numpy.inf,numpy.inf,numpy.inf,numpy.inf,numpy.inf]) #print(bounds) #bounds=([0,-numpy.inf,0,0,-numpy.inf,0,0,0],[numpy.inf,-200,numpy.inf,numpy.inf,0,numpy.inf,numpy.inf,numpy.inf]) params_scale = [spc_max,freq_max,freq_max,spc_max,freq_max,freq_max,1,spc_max,freq_max,freq_max,1,spc_max] x0_value = numpy.array([spc_max,-400,30,spc_max/4,-200,150,1,spc_max/4,400,150,1,1.0e7]) #popt = least_squares(lsq_func,[a1,b1,c1,a2,b2,c2,k2,d],x0=x0_value,x_scale=params_scale,bounds=bounds,verbose=1) popt = least_squares(lsq_func,x0=x0_value,x_scale=params_scale,bounds=bounds,verbose=0) # popt = least_squares(lsq_func,[a1,b1,c1,a2,b2,c2,k2,d],x_scale=params_scale,verbose=1) A1f = popt.x[0]; B1f = popt.x[1]; C1f = popt.x[2] A2f = popt.x[3]; B2f = popt.x[4]; C2f = popt.x[5]; K2f = popt.x[6] A3f = popt.x[7]; B3f = popt.x[8]; C3f = popt.x[9]; K3f = popt.x[10] Df = popt.x[11] aux = self.gaussian_skew(freq, A2f, B2f, C2f, K2f, Df) doppler = freq[numpy.argmax(aux)] return A1f, B1f, C1f, A2f, B2f, C2f, K2f, A3f, B3f, C3f, K3f, Df, doppler def CEEJ_Skew_fit_weight_bound_no_inputs(self,spc,freq,Nincoh): from scipy.optimize import least_squares freq_max = numpy.max(numpy.abs(freq)) spc_max = numpy.max(spc) from scipy.signal import medfilt Nincoh = 20 Nincoh = 80 Nincoh = Nincoh spcm = medfilt(spc,11)/numpy.sqrt(Nincoh) # define a least squares function to optimize def lsq_func(params): return (spc-self.gaussian_skew(freq,params[0],params[1],params[2],params[3],params[4]))#/spcm bounds=([0,0,0,-numpy.inf,0],[numpy.inf,numpy.inf,numpy.inf,0,numpy.inf]) params_scale = [spc_max,freq_max,freq_max,1,spc_max] x0_value = numpy.array([spc_max,freq[numpy.argmax(spc)],30,-.1,numpy.mean(spc[:50])]) popt = least_squares(lsq_func,x0=x0_value,x_scale=params_scale,bounds=bounds,verbose=0) J = popt.jac try: error = numpy.ones((9))*numpy.NAN cov = numpy.linalg.inv(J.T.dot(J)) error[:4] = numpy.sqrt(numpy.diagonal(cov))[:4] error[-1] = numpy.sqrt(numpy.diagonal(cov))[-1] except: error = numpy.ones((9))*numpy.NAN A1f = popt.x[0]; B1f = popt.x[1]; C1f = popt.x[2]; K1f = popt.x[3] Df = popt.x[4] aux1 = self.gaussian_skew(freq, A1f, B1f, C1f, K1f, Df) doppler1 = freq[numpy.argmax(aux1)] #print("CEEJ ERROR:",error) return A1f, B1f, C1f, K1f, numpy.NAN, numpy.NAN, numpy.NAN, numpy.NAN, Df, doppler1, numpy.NAN, error def CEEJ_fit_weight_bound_no_inputs(self,spc,freq,Nincoh): from scipy.optimize import least_squares freq_max = numpy.max(numpy.abs(freq)) spc_max = numpy.max(spc) from scipy.signal import medfilt Nincoh = 20 Nincoh = 80 Nincoh = Nincoh spcm = medfilt(spc,11)/numpy.sqrt(Nincoh) # define a least squares function to optimize def lsq_func(params): return (spc-self.gaussian(freq,params[0],params[1],params[2],params[3]))#/spcm bounds=([0,0,0,0],[numpy.inf,numpy.inf,numpy.inf,numpy.inf]) params_scale = [spc_max,freq_max,freq_max,spc_max] x0_value = numpy.array([spc_max,freq[numpy.argmax(spcm)],30,numpy.mean(spc[:50])]) popt = least_squares(lsq_func,x0=x0_value,x_scale=params_scale,bounds=bounds,verbose=0) J = popt.jac try: error = numpy.ones((4))*numpy.NAN cov = numpy.linalg.inv(J.T.dot(J)) error = numpy.sqrt(numpy.diagonal(cov)) except: error = numpy.ones((4))*numpy.NAN A1f = popt.x[0]; B1f = popt.x[1]; C1f = popt.x[2] Df = popt.x[3] return A1f, B1f, C1f, Df, error def Simple_fit_bound(self,spc,freq,Nincoh): freq_max = numpy.max(numpy.abs(freq)) spc_max = numpy.max(spc) Nincoh = Nincoh def lsq_func(params): return (spc-self.gaussian(freq,params[0],params[1],params[2],params[3])) bounds=([0,-50,0,0],[numpy.inf,+50,numpy.inf,numpy.inf]) params_scale = [spc_max,freq_max,freq_max,spc_max] x0_value = numpy.array([spc_max,-20.5,5,1.0e7]) popt = least_squares(lsq_func,x0=x0_value,x_scale=params_scale,bounds=bounds,verbose=0) J = popt.jac try: cov = numpy.linalg.inv(J.T.dot(J)) error = numpy.sqrt(numpy.diagonal(cov)) except: error = numpy.ones((4))*numpy.NAN A1f = popt.x[0]; B1f = popt.x[1]; C1f = popt.x[2] Df = popt.x[3] return A1f, B1f, C1f, Df, error def clean_outliers(self,param): threshold = 700 param = numpy.where(param < -threshold, numpy.nan, param) param = numpy.where(param > +threshold, numpy.nan, param) return param def windowing_single(self,spc,x,A,B,C,D,nFFTPoints): from scipy.optimize import curve_fit,fmin def R_gaussian(x, a, b, c): N = int(numpy.shape(x)[0]) val = a * numpy.exp(-((x)*c*2*2*numpy.pi)**2 / (2))* numpy.exp(1.j*b*x*4*numpy.pi) return val def T(x,N): T = 1-abs(x)/N return T def R_T_spc_fun(x, a, b, c, d, nFFTPoints): N = int(numpy.shape(x)[0]) x_max = x[-1] x_pos = x[int(nFFTPoints/2):] x_neg = x[:int(nFFTPoints/2)] R_T_neg_1 = R_gaussian(x, a, b, c)[:int(nFFTPoints/2)]*T(x_neg,-x[0]) R_T_pos_1 = R_gaussian(x, a, b, c)[int(nFFTPoints/2):]*T(x_pos,x[-1]) R_T_sum_1 = R_T_pos_1 + R_T_neg_1 R_T_spc_1 = numpy.fft.fft(R_T_sum_1).real R_T_spc_1 = numpy.fft.fftshift(R_T_spc_1) max_val_1 = numpy.max(R_T_spc_1) R_T_spc_1 = R_T_spc_1*a/max_val_1 R_T_d = d*numpy.fft.fftshift(signal.unit_impulse(N)) R_T_d_neg = R_T_d[:int(nFFTPoints/2)]*T(x_neg,-x[0]) R_T_d_pos = R_T_d[int(nFFTPoints/2):]*T(x_pos,x[-1]) R_T_d_sum = R_T_d_pos + R_T_d_neg R_T_spc_3 = numpy.fft.fft(R_T_d_sum).real R_T_spc_3 = numpy.fft.fftshift(R_T_spc_3) R_T_final = R_T_spc_1 + R_T_spc_3 return R_T_final y = spc#gaussian(x, a, meanY, sigmaY) + a*0.1*numpy.random.normal(0, 1, size=len(x)) from scipy.stats import norm mean,std=norm.fit(spc) # estimate starting values from the data a = A b = B c = C#numpy.std(spc) d = D ''' ippSeconds = 250*20*1.e-6/3 x_t = ippSeconds * (numpy.arange(1600) -1600 / 2.) x_t = numpy.linspace(x_t[0],x_t[-1],3200) x_freq = numpy.fft.fftfreq(1600,d=ippSeconds) x_freq = numpy.fft.fftshift(x_freq) ''' # define a least squares function to optimize def minfunc(params): return sum((y-R_T_spc_fun(x,params[0],params[1],params[2],params[3],params[4],params[5],params[6]))**2/1)#y**2) # fit popt_full = fmin(minfunc,[a,b,c,d],full_output=True) #print("nIter", popt_full[2]) popt = popt_full[0] #return R_T_spc_fun(x_t,popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6]), popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6] return popt[0], popt[1], popt[2], popt[3] def run(self, dataOut, mode = 0, Hmin1 = None, Hmax1 = None, Hmin2 = None, Hmax2 = None, Dop = 'Shift'): pwcode = 1 if dataOut.flagDecodeData: pwcode = numpy.sum(dataOut.code[0]**2) #normFactor = min(self.nFFTPoints,self.nProfiles)*self.nIncohInt*self.nCohInt*pwcode*self.windowOfFilter normFactor = dataOut.nProfiles * dataOut.nIncohInt * dataOut.nCohInt * pwcode * dataOut.windowOfFilter factor = normFactor z = dataOut.data_spc / factor z = numpy.where(numpy.isfinite(z), z, numpy.NAN) dataOut.power = numpy.average(z, axis=1) dataOut.powerdB = 10 * numpy.log10(dataOut.power) x = dataOut.getVelRange(0) dataOut.Oblique_params = numpy.ones((1,7,dataOut.nHeights))*numpy.NAN dataOut.Oblique_param_errors = numpy.ones((1,7,dataOut.nHeights))*numpy.NAN dataOut.dplr_2_u = numpy.ones((1,1,dataOut.nHeights))*numpy.NAN if mode == 6: dataOut.Oblique_params = numpy.ones((1,9,dataOut.nHeights))*numpy.NAN elif mode == 7: dataOut.Oblique_params = numpy.ones((1,13,dataOut.nHeights))*numpy.NAN elif mode == 8: dataOut.Oblique_params = numpy.ones((1,10,dataOut.nHeights))*numpy.NAN elif mode == 9: dataOut.Oblique_params = numpy.ones((1,11,dataOut.nHeights))*numpy.NAN dataOut.Oblique_param_errors = numpy.ones((1,9,dataOut.nHeights))*numpy.NAN elif mode == 11: dataOut.Oblique_params = numpy.ones((1,7,dataOut.nHeights))*numpy.NAN dataOut.Oblique_param_errors = numpy.ones((1,7,dataOut.nHeights))*numpy.NAN elif mode == 10: #150 km dataOut.Oblique_params = numpy.ones((1,4,dataOut.nHeights))*numpy.NAN dataOut.Oblique_param_errors = numpy.ones((1,4,dataOut.nHeights))*numpy.NAN dataOut.snr_log10 = numpy.ones((1,dataOut.nHeights))*numpy.NAN dataOut.VelRange = x #l1=range(22,36) #+62 #l1=range(32,36) #l2=range(58,99) #+62 #if Hmin1 == None or Hmax1 == None or Hmin2 == None or Hmax2 == None: minHei1 = 105. maxHei1 = 122.5 maxHei1 = 130.5 if mode == 10: #150 km minHei1 = 100 maxHei1 = 100 inda1 = numpy.where(dataOut.heightList >= minHei1) indb1 = numpy.where(dataOut.heightList <= maxHei1) minIndex1 = inda1[0][0] maxIndex1 = indb1[0][-1] minHei2 = 150. maxHei2 = 201.25 maxHei2 = 225.3 if mode == 10: #150 km minHei2 = 110 maxHei2 = 165 inda2 = numpy.where(dataOut.heightList >= minHei2) indb2 = numpy.where(dataOut.heightList <= maxHei2) minIndex2 = inda2[0][0] maxIndex2 = indb2[0][-1] l1=range(minIndex1,maxIndex1) l2=range(minIndex2,maxIndex2) if mode == 4: ''' for ind in range(dataOut.nHeights): if(dataOut.heightList[ind]>=168 and dataOut.heightList[ind]<188): try: dataOut.Oblique_params[0,0,ind],dataOut.Oblique_params[0,1,ind],dataOut.Oblique_params[0,2,ind],dataOut.Oblique_params[0,3,ind],dataOut.Oblique_params[0,4,ind],dataOut.Oblique_params[0,5,ind],dataOut.Oblique_params[0,6,ind],dataOut.Oblique_param_errors[0,0,ind],dataOut.Oblique_param_errors[0,1,ind],dataOut.Oblique_param_errors[0,2,ind],dataOut.Oblique_param_errors[0,3,ind],dataOut.Oblique_param_errors[0,4,ind],dataOut.Oblique_param_errors[0,5,ind],dataOut.Oblique_param_errors[0,6,ind] = self.DH_mode(dataOut.data_spc[0,:,ind],dataOut.VelRange) except: pass ''' for ind in itertools.chain(l1, l2): try: dataOut.Oblique_params[0,0,ind],dataOut.Oblique_params[0,1,ind],dataOut.Oblique_params[0,2,ind],dataOut.Oblique_params[0,3,ind],dataOut.Oblique_params[0,4,ind],dataOut.Oblique_params[0,5,ind],dataOut.Oblique_params[0,6,ind],dataOut.Oblique_param_errors[0,0,ind],dataOut.Oblique_param_errors[0,1,ind],dataOut.Oblique_param_errors[0,2,ind],dataOut.Oblique_param_errors[0,3,ind],dataOut.Oblique_param_errors[0,4,ind],dataOut.Oblique_param_errors[0,5,ind],dataOut.Oblique_param_errors[0,6,ind] = self.DH_mode(dataOut.data_spc[0,:,ind],dataOut.VelRange) dataOut.dplr_2_u[0,0,ind] = dataOut.Oblique_params[0,4,ind]/numpy.sin(numpy.arccos(102/dataOut.heightList[ind])) except: pass else: #print("After: ", dataOut.data_snr[0]) #######import matplotlib.pyplot as plt #######plt.plot(dataOut.data_snr[0],dataOut.heightList,marker='*',linestyle='--') #######plt.show() #print("l1: ", dataOut.heightList[l1]) #print("l2: ", dataOut.heightList[l2]) for hei in itertools.chain(l1, l2): #for hei in range(79,81): #if numpy.isnan(dataOut.data_snr[0,hei]) or numpy.isnan(numpy.log10(dataOut.data_snr[0,hei])): if numpy.isnan(dataOut.snl[0,hei]):# or dataOut.snl[0,hei]<.0: continue #Avoids the analysis when there is only noise try: spc = dataOut.data_spc[0,:,hei] if mode == 6: #Skew Weighted Bounded dataOut.Oblique_params[0,0,hei],dataOut.Oblique_params[0,1,hei],dataOut.Oblique_params[0,2,hei],dataOut.Oblique_params[0,3,hei],dataOut.Oblique_params[0,4,hei],dataOut.Oblique_params[0,5,hei],dataOut.Oblique_params[0,6,hei],dataOut.Oblique_params[0,7,hei],dataOut.Oblique_params[0,8,hei] = self.Double_Gauss_Skew_fit_weight_bound_no_inputs(spc,x) dataOut.dplr_2_u[0,0,hei] = dataOut.Oblique_params[0,8,hei]/numpy.sin(numpy.arccos(100./dataOut.heightList[hei])) elif mode == 7: #Triple Skew Weighted Bounded dataOut.Oblique_params[0,0,hei],dataOut.Oblique_params[0,1,hei],dataOut.Oblique_params[0,2,hei],dataOut.Oblique_params[0,3,hei],dataOut.Oblique_params[0,4,hei],dataOut.Oblique_params[0,5,hei],dataOut.Oblique_params[0,6,hei],dataOut.Oblique_params[0,7,hei],dataOut.Oblique_params[0,8,hei],dataOut.Oblique_params[0,9,hei],dataOut.Oblique_params[0,10,hei],dataOut.Oblique_params[0,11,hei],dataOut.Oblique_params[0,12,hei] = self.Triple_Gauss_Skew_fit_weight_bound_no_inputs(spc,x) dataOut.dplr_2_u[0,0,hei] = dataOut.Oblique_params[0,12,hei]/numpy.sin(numpy.arccos(100./dataOut.heightList[hei])) elif mode == 8: #Double Skewed Weighted Bounded with inputs a1, b1, c1, a2, b2, c2, k2, d, dopp = self.Double_Gauss_Skew_fit_weight_bound_no_inputs(spc,x) dataOut.Oblique_params[0,0,hei],dataOut.Oblique_params[0,1,hei],dataOut.Oblique_params[0,2,hei],dataOut.Oblique_params[0,3,hei],dataOut.Oblique_params[0,4,hei],dataOut.Oblique_params[0,5,hei],dataOut.Oblique_params[0,6,hei],dataOut.Oblique_params[0,7,hei],dataOut.Oblique_params[0,8,hei],dataOut.Oblique_params[0,9,hei] = self.Double_Gauss_Skew_fit_weight_bound_no_inputs(spc,x, a1, b1, c1, a2, b2, c2, k2, d) dataOut.dplr_2_u[0,0,hei] = dataOut.Oblique_params[0,9,hei]/numpy.sin(numpy.arccos(100./dataOut.heightList[hei])) elif mode == 9: #Double Skewed Weighted Bounded no inputs #if numpy.max(spc) <= 0: from scipy.signal import medfilt spcm = medfilt(spc,11) if x[numpy.argmax(spcm)] <= 0: #print("EEJ", dataOut.heightList[hei], hei) #if hei != 70: #continue #else: dataOut.Oblique_params[0,0,hei],dataOut.Oblique_params[0,1,hei],dataOut.Oblique_params[0,2,hei],dataOut.Oblique_params[0,3,hei],dataOut.Oblique_params[0,4,hei],dataOut.Oblique_params[0,5,hei],dataOut.Oblique_params[0,6,hei],dataOut.Oblique_params[0,7,hei],dataOut.Oblique_params[0,8,hei],dataOut.Oblique_params[0,9,hei],dataOut.Oblique_params[0,10,hei],dataOut.Oblique_param_errors[0,:,hei] = self.Double_Gauss_Double_Skew_fit_weight_bound_no_inputs(spcm,x,dataOut.nIncohInt,dataOut.heightList[hei]) #if dataOut.Oblique_params[0,-2,hei] < -500 or dataOut.Oblique_params[0,-2,hei] > 500 or dataOut.Oblique_params[0,-1,hei] < -500 or dataOut.Oblique_params[0,-1,hei] > 500: # dataOut.Oblique_params[0,:,hei] *= numpy.NAN dataOut.dplr_2_u[0,0,hei] = dataOut.Oblique_params[0,10,hei]/numpy.sin(numpy.arccos(100./dataOut.heightList[hei])) else: #print("CEEJ") dataOut.Oblique_params[0,0,hei],dataOut.Oblique_params[0,1,hei],dataOut.Oblique_params[0,2,hei],dataOut.Oblique_params[0,3,hei],dataOut.Oblique_params[0,4,hei],dataOut.Oblique_params[0,5,hei],dataOut.Oblique_params[0,6,hei],dataOut.Oblique_params[0,7,hei],dataOut.Oblique_params[0,8,hei],dataOut.Oblique_params[0,9,hei],dataOut.Oblique_params[0,10,hei],dataOut.Oblique_param_errors[0,:,hei] = self.CEEJ_Skew_fit_weight_bound_no_inputs(spcm,x,dataOut.nIncohInt) #if dataOut.Oblique_params[0,-2,hei] < -500 or dataOut.Oblique_params[0,-2,hei] > 500 or dataOut.Oblique_params[0,-1,hei] < -500 or dataOut.Oblique_params[0,-1,hei] > 500: # dataOut.Oblique_params[0,:,hei] *= numpy.NAN dataOut.dplr_2_u[0,0,hei] = dataOut.Oblique_params[0,10,hei]/numpy.sin(numpy.arccos(100./dataOut.heightList[hei])) elif mode == 11: #Double Weighted Bounded no inputs #if numpy.max(spc) <= 0: from scipy.signal import medfilt spcm = medfilt(spc,11) if x[numpy.argmax(spcm)] <= 0: #print("EEJ") #print("EEJ",dataOut.heightList[hei]) dataOut.Oblique_params[0,0,hei],dataOut.Oblique_params[0,1,hei],dataOut.Oblique_params[0,2,hei],dataOut.Oblique_params[0,3,hei],dataOut.Oblique_params[0,4,hei],dataOut.Oblique_params[0,5,hei],dataOut.Oblique_params[0,6,hei],dataOut.Oblique_param_errors[0,:,hei] = self.Double_Gauss_fit_weight_bound_no_inputs(spc,x,dataOut.nIncohInt) #if dataOut.Oblique_params[0,-2,hei] < -500 or dataOut.Oblique_params[0,-2,hei] > 500 or dataOut.Oblique_params[0,-1,hei] < -500 or dataOut.Oblique_params[0,-1,hei] > 500: # dataOut.Oblique_params[0,:,hei] *= numpy.NAN else: #print("CEEJ",dataOut.heightList[hei]) dataOut.Oblique_params[0,0,hei],dataOut.Oblique_params[0,1,hei],dataOut.Oblique_params[0,2,hei],dataOut.Oblique_params[0,3,hei],dataOut.Oblique_param_errors[0,:,hei] = self.CEEJ_fit_weight_bound_no_inputs(spc,x,dataOut.nIncohInt) elif mode == 10: #150km dataOut.Oblique_params[0,0,hei],dataOut.Oblique_params[0,1,hei],dataOut.Oblique_params[0,2,hei],dataOut.Oblique_params[0,3,hei],dataOut.Oblique_param_errors[0,:,hei] = self.Simple_fit_bound(spc,x,dataOut.nIncohInt) snr = (dataOut.power[0,hei]*factor - dataOut.Oblique_params[0,3,hei])/dataOut.Oblique_params[0,3,hei] dataOut.snr_log10[0,hei] = numpy.log10(snr) else: spc_fit, A1, B1, C1, D1 = self.Gauss_fit_2(spc,x,'first') spc_diff = spc - spc_fit spc_diff[spc_diff < 0] = 0 spc_fit_diff, A2, B2, C2, D2 = self.Gauss_fit_2(spc_diff,x,'second') D = (D1+D2) if mode == 0: #Double Fit dataOut.Oblique_params[0,0,hei],dataOut.Oblique_params[0,1,hei],dataOut.Oblique_params[0,2,hei],dataOut.Oblique_params[0,3,hei],dataOut.Oblique_params[0,4,hei],dataOut.Oblique_params[0,5,hei],dataOut.Oblique_params[0,6,hei],dataOut.Oblique_param_errors[0,0,hei],dataOut.Oblique_param_errors[0,1,hei],dataOut.Oblique_param_errors[0,2,hei],dataOut.Oblique_param_errors[0,3,hei],dataOut.Oblique_param_errors[0,4,hei],dataOut.Oblique_param_errors[0,5,hei],dataOut.Oblique_param_errors[0,6,hei] = self.Double_Gauss_fit_2(spc,x,A1,B1,C1,A2,B2,C2,D) #spc_double_fit,dataOut.Oblique_params = self.Double_Gauss_fit(spc,x,A1,B1,C1,A2,B2,C2,D) elif mode == 1: #Double Fit Windowed dataOut.Oblique_params[0,0,hei],dataOut.Oblique_params[0,1,hei],dataOut.Oblique_params[0,2,hei],dataOut.Oblique_params[0,3,hei],dataOut.Oblique_params[0,4,hei],dataOut.Oblique_params[0,5,hei],dataOut.Oblique_params[0,6,hei] = self.windowing_double(spc,dataOut.getFreqRange(0),A1,B1,C1,A2,B2,C2,D) elif mode == 2: #Double Fit Weight dataOut.Oblique_params[0,0,hei],dataOut.Oblique_params[0,1,hei],dataOut.Oblique_params[0,2,hei],dataOut.Oblique_params[0,3,hei],dataOut.Oblique_params[0,4,hei],dataOut.Oblique_params[0,5,hei],dataOut.Oblique_params[0,6,hei] = self.Double_Gauss_fit_weight(spc,x,A1,B1,C1,A2,B2,C2,D) elif mode == 3: #Simple Fit dataOut.Oblique_params[0,0,hei] = A1 dataOut.Oblique_params[0,1,hei] = B1 dataOut.Oblique_params[0,2,hei] = C1 dataOut.Oblique_params[0,3,hei] = A2 dataOut.Oblique_params[0,4,hei] = B2 dataOut.Oblique_params[0,5,hei] = C2 dataOut.Oblique_params[0,6,hei] = D elif mode == 5: #Triple Fit Weight if hei in l1: dataOut.Oblique_params[0,0,hei],dataOut.Oblique_params[0,1,hei],dataOut.Oblique_params[0,2,hei],dataOut.Oblique_params[0,3,hei],dataOut.Oblique_params[0,4,hei],dataOut.Oblique_params[0,5,hei],dataOut.Oblique_params[0,6,hei] = self.duo_Marco(spc,x,A1,B1,C1,A2,B2,C2,D) dataOut.dplr_2_u[0,0,hei] = dataOut.Oblique_params[0,4,hei]/numpy.sin(numpy.arccos(102/dataOut.heightList[hei])) #print(dataOut.Oblique_params[0,0,hei]) #print(dataOut.dplr_2_u[0,0,hei]) else: dataOut.Oblique_params[0,0,hei],dataOut.Oblique_params[0,1,hei],dataOut.Oblique_params[0,2,hei],dataOut.Oblique_params[0,3,hei],dataOut.Oblique_params[0,4,hei],dataOut.Oblique_params[0,5,hei],dataOut.Oblique_params[0,6,hei] = self.Double_Gauss_fit_weight(spc,x,A1,B1,C1,A2,B2,C2,D) dataOut.dplr_2_u[0,0,hei] = dataOut.Oblique_params[0,4,hei]/numpy.sin(numpy.arccos(102/dataOut.heightList[hei])) except: ###dataOut.Oblique_params[0,:,hei] = dataOut.Oblique_params[0,:,hei]*numpy.NAN pass #exit(1) dataOut.paramInterval = dataOut.nProfiles*dataOut.nCohInt*dataOut.ippSeconds dataOut.lat=-11.95 dataOut.lon=-76.87 ''' dataOut.Oblique_params = numpy.where(dataOut.Oblique_params<-700, numpy.nan, dop_t1) dataOut.Oblique_params = numpy.where(dataOut.Oblique_params<+700, numpy.nan, dop_t1) Aquí debo exceptuar las amplitudes ''' if mode == 9: #Double Skew Gaussian #dataOut.Dop_EEJ_T1 = dataOut.Oblique_params[:,-2,:] #Pos[Max_value] #dataOut.Dop_EEJ_T1 = dataOut.Oblique_params[:,1,:] #Shift dataOut.Spec_W_T1 = dataOut.Oblique_params[:,2,:] #dataOut.Dop_EEJ_T2 = dataOut.Oblique_params[:,-1,:] #Pos[Max_value] #dataOut.Dop_EEJ_T2 = dataOut.Oblique_params[:,5,:] #Shift dataOut.Spec_W_T2 = dataOut.Oblique_params[:,6,:] if Dop == 'Shift': dataOut.Dop_EEJ_T1 = dataOut.Oblique_params[:,1,:] #Shift dataOut.Dop_EEJ_T2 = dataOut.Oblique_params[:,5,:] #Shift elif Dop == 'Max': dataOut.Dop_EEJ_T1 = dataOut.Oblique_params[:,-2,:] #Pos[Max_value] dataOut.Dop_EEJ_T2 = dataOut.Oblique_params[:,-1,:] #Pos[Max_value] dataOut.Err_Dop_EEJ_T1 = dataOut.Oblique_param_errors[:,1,:] #En realidad este es el error? dataOut.Err_Spec_W_T1 = dataOut.Oblique_param_errors[:,2,:] dataOut.Err_Dop_EEJ_T2 = dataOut.Oblique_param_errors[:,5,:] #En realidad este es el error? dataOut.Err_Spec_W_T2 = dataOut.Oblique_param_errors[:,6,:] elif mode == 11: #Double Gaussian dataOut.Dop_EEJ_T1 = dataOut.Oblique_params[:,1,:] dataOut.Spec_W_T1 = dataOut.Oblique_params[:,2,:] dataOut.Dop_EEJ_T2 = dataOut.Oblique_params[:,4,:] dataOut.Spec_W_T2 = dataOut.Oblique_params[:,5,:] dataOut.Err_Dop_EEJ_T1 = dataOut.Oblique_param_errors[:,1,:] dataOut.Err_Spec_W_T1 = dataOut.Oblique_param_errors[:,2,:] dataOut.Err_Dop_EEJ_T2 = dataOut.Oblique_param_errors[:,4,:] dataOut.Err_Spec_W_T2 = dataOut.Oblique_param_errors[:,5,:] #print("Before: ", dataOut.Dop_EEJ_T2) dataOut.Spec_W_T1 = self.clean_outliers(dataOut.Spec_W_T1) dataOut.Spec_W_T2 = self.clean_outliers(dataOut.Spec_W_T2) dataOut.Dop_EEJ_T1 = self.clean_outliers(dataOut.Dop_EEJ_T1) dataOut.Dop_EEJ_T2 = self.clean_outliers(dataOut.Dop_EEJ_T2) #print("After: ", dataOut.Dop_EEJ_T2) dataOut.Err_Spec_W_T1 = self.clean_outliers(dataOut.Err_Spec_W_T1) dataOut.Err_Spec_W_T2 = self.clean_outliers(dataOut.Err_Spec_W_T2) dataOut.Err_Dop_EEJ_T1 = self.clean_outliers(dataOut.Err_Dop_EEJ_T1) dataOut.Err_Dop_EEJ_T2 = self.clean_outliers(dataOut.Err_Dop_EEJ_T2) #print("Before data_snr: ", dataOut.data_snr) #dataOut.data_snr = numpy.where(numpy.isnan(dataOut.Dop_EEJ_T1), numpy.nan, dataOut.data_snr) dataOut.snl = numpy.where(numpy.isnan(dataOut.Dop_EEJ_T1), numpy.nan, dataOut.snl) #print("After data_snr: ", dataOut.data_snr) dataOut.mode = mode dataOut.flagNoData = numpy.all(numpy.isnan(dataOut.Dop_EEJ_T1)) #Si todos los valores son NaN no se prosigue ###dataOut.flagNoData = False #Descomentar solo para ploteo sino mantener comentado (para guardado) return dataOut class Gaussian_Windowed(Operation): ''' Written by R. Flores ''' def __init__(self): Operation.__init__(self) def windowing_single(self,spc,x,A,B,C,D,nFFTPoints): from scipy.optimize import curve_fit,fmin def gaussian(x, a, b, c, d): val = a * numpy.exp(-(x - b)**2 / (2*c**2)) + d return val def R_gaussian(x, a, b, c): N = int(numpy.shape(x)[0]) val = a * numpy.exp(-((x)*c*2*2*numpy.pi)**2 / (2))* numpy.exp(1.j*b*x*4*numpy.pi) return val def T(x,N): T = 1-abs(x)/N return T def R_T_spc_fun(x, a, b, c, d, nFFTPoints): N = int(numpy.shape(x)[0]) x_max = x[-1] x_pos = x[nFFTPoints:] x_neg = x[:nFFTPoints] #print([int(nFFTPoints/2)) #print("x: ", x) #print("x_neg: ", x_neg) #print("x_pos: ", x_pos) R_T_neg_1 = R_gaussian(x, a, b, c)[:nFFTPoints]*T(x_neg,-x[0]) R_T_pos_1 = R_gaussian(x, a, b, c)[nFFTPoints:]*T(x_pos,x[-1]) #print(T(x_pos,x[-1]),x_pos,x[-1]) #print(R_T_neg_1.shape,R_T_pos_1.shape) R_T_sum_1 = R_T_pos_1 + R_T_neg_1 R_T_spc_1 = numpy.fft.fft(R_T_sum_1).real R_T_spc_1 = numpy.fft.fftshift(R_T_spc_1) max_val_1 = numpy.max(R_T_spc_1) R_T_spc_1 = R_T_spc_1*a/max_val_1 R_T_d = d*numpy.fft.fftshift(signal.unit_impulse(N)) R_T_d_neg = R_T_d[:nFFTPoints]*T(x_neg,-x[0]) R_T_d_pos = R_T_d[nFFTPoints:]*T(x_pos,x[-1]) R_T_d_sum = R_T_d_pos + R_T_d_neg R_T_spc_3 = numpy.fft.fft(R_T_d_sum).real R_T_spc_3 = numpy.fft.fftshift(R_T_spc_3) R_T_final = R_T_spc_1 + R_T_spc_3 return R_T_final y = spc#gaussian(x, a, meanY, sigmaY) + a*0.1*numpy.random.normal(0, 1, size=len(x)) from scipy.stats import norm mean,std=norm.fit(spc) # estimate starting values from the data a = A b = B c = C#numpy.std(spc) d = D #''' #ippSeconds = 250*20*1.e-6/3 #x_t = ippSeconds * (numpy.arange(nFFTPoints) - nFFTPoints / 2.) #x_t = numpy.linspace(x_t[0],x_t[-1],3200) #print("x_t: ", x_t) #print("nFFTPoints: ", nFFTPoints) x_vel = numpy.linspace(x[0],x[-1],int(2*nFFTPoints)) #print("x_vel: ", x_vel) #x_freq = numpy.fft.fftfreq(1600,d=ippSeconds) #x_freq = numpy.fft.fftshift(x_freq) #''' # define a least squares function to optimize def minfunc(params): #print("y.shape: ", numpy.shape(y)) return sum((y-R_T_spc_fun(x_vel,params[0],params[1],params[2],params[3],nFFTPoints))**2/1)#y**2) # fit popt_full = fmin(minfunc,[a,b,c,d], disp=False) #print("nIter", popt_full[2]) popt = popt_full#[0] fun = gaussian(x, popt[0], popt[1], popt[2], popt[3]) #return R_T_spc_fun(x_t,popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6]), popt[0], popt[1], popt[2], popt[3], popt[4], popt[5], popt[6] return fun, popt[0], popt[1], popt[2], popt[3] def run(self, dataOut): from scipy.signal import medfilt import matplotlib.pyplot as plt dataOut.moments = numpy.ones((dataOut.nChannels,4,dataOut.nHeights))*numpy.NAN dataOut.VelRange = dataOut.getVelRange(0) for nChannel in range(dataOut.nChannels): for hei in range(dataOut.heightList.shape[0]): #print("ipp: ", dataOut.ippSeconds) spc = numpy.copy(dataOut.data_spc[nChannel,:,hei]) #print(VelRange) #print(dataOut.getFreqRange(64)) spcm = medfilt(spc,11) spc_max = numpy.max(spcm) dop1_x0 = dataOut.VelRange[numpy.argmax(spcm)] D = numpy.min(spcm) fun, A, B, C, D = self.windowing_single(spc,dataOut.VelRange,spc_max,dop1_x0,abs(dop1_x0),D,dataOut.nFFTPoints) dataOut.moments[nChannel,0,hei] = A dataOut.moments[nChannel,1,hei] = B dataOut.moments[nChannel,2,hei] = C dataOut.moments[nChannel,3,hei] = D ''' plt.figure() plt.plot(VelRange,spc,marker='*',linestyle='') plt.plot(VelRange,fun) plt.title(dataOut.heightList[hei]) plt.show() ''' return dataOut class PrecipitationProc(Operation): ''' Operator that estimates Reflectivity factor (Z), and estimates rainfall Rate (R) Input: self.dataOut.data_pre : SelfSpectra Output: self.dataOut.data_output : Reflectivity factor, rainfall Rate Parameters affected: ''' def __init__(self): Operation.__init__(self) self.i=0 def run(self, dataOut, radar=None, Pt=5000, Gt=295.1209, Gr=70.7945, Lambda=0.6741, aL=2.5118, tauW=4e-06, ThetaT=0.1656317, ThetaR=0.36774087, Km2 = 0.93, Altitude=3350, SNRdBlimit=-30, channel=None): # print ('Entering PrecepitationProc ... ') if radar == "MIRA35C" : self.spc = dataOut.data_pre[0].copy() self.Num_Hei = self.spc.shape[2] self.Num_Bin = self.spc.shape[1] self.Num_Chn = self.spc.shape[0] Ze = self.dBZeMODE2(dataOut) else: self.spc = dataOut.data_pre[0].copy() #NOTA SE DEBE REMOVER EL RANGO DEL PULSO TX self.spc[:,:,0:7]= numpy.NaN self.Num_Hei = self.spc.shape[2] self.Num_Bin = self.spc.shape[1] self.Num_Chn = self.spc.shape[0] VelRange = dataOut.spc_range[2] ''' Se obtiene la constante del RADAR ''' self.Pt = Pt self.Gt = Gt self.Gr = Gr self.Lambda = Lambda self.aL = aL self.tauW = tauW self.ThetaT = ThetaT self.ThetaR = ThetaR self.GSys = 10**(36.63/10) # Ganancia de los LNA 36.63 dB self.lt = 10**(1.67/10) # Perdida en cables Tx 1.67 dB self.lr = 10**(5.73/10) # Perdida en cables Rx 5.73 dB Numerator = ( (4*numpy.pi)**3 * aL**2 * 16 * numpy.log(2) ) Denominator = ( Pt * Gt * Gr * Lambda**2 * SPEED_OF_LIGHT * tauW * numpy.pi * ThetaT * ThetaR) RadarConstant = 10e-26 * Numerator / Denominator # ExpConstant = 10**(40/10) #Constante Experimental SignalPower = numpy.zeros([self.Num_Chn,self.Num_Bin,self.Num_Hei]) for i in range(self.Num_Chn): SignalPower[i,:,:] = self.spc[i,:,:] - dataOut.noise[i] SignalPower[numpy.where(SignalPower < 0)] = 1e-20 if channel is None: SPCmean = numpy.mean(SignalPower, 0) else: SPCmean = SignalPower[channel] Pr = SPCmean[:,:]/dataOut.normFactor # Declaring auxiliary variables Range = dataOut.heightList*1000. #Range in m # replicate the heightlist to obtain a matrix [Num_Bin,Num_Hei] rMtrx = numpy.transpose(numpy.transpose([dataOut.heightList*1000.] * self.Num_Bin)) zMtrx = rMtrx+Altitude # replicate the VelRange to obtain a matrix [Num_Bin,Num_Hei] VelMtrx = numpy.transpose(numpy.tile(VelRange[:-1], (self.Num_Hei,1))) # height dependence to air density Foote and Du Toit (1969) delv_z = 1 + 3.68e-5 * zMtrx + 1.71e-9 * zMtrx**2 VMtrx = VelMtrx / delv_z #Normalized velocity VMtrx[numpy.where(VMtrx> 9.6)] = numpy.NaN # Diameter is related to the fall speed of falling drops D_Vz = -1.667 * numpy.log( 0.9369 - 0.097087 * VMtrx ) # D in [mm] # Only valid for D>= 0.16 mm D_Vz[numpy.where(D_Vz < 0.16)] = numpy.NaN #Calculate Radar Reflectivity ETAn ETAn = (RadarConstant *ExpConstant) * Pr * rMtrx**2 #Reflectivity (ETA) ETAd = ETAn * 6.18 * exp( -0.6 * D_Vz ) * delv_z # Radar Cross Section sigmaD = Km2 * (D_Vz * 1e-3 )**6 * numpy.pi**5 / Lambda**4 # Drop Size Distribution DSD = ETAn / sigmaD # Equivalente Reflectivy Ze_eqn = numpy.nansum( DSD * D_Vz**6 ,axis=0) Ze_org = numpy.nansum(ETAn * Lambda**4, axis=0) / (1e-18*numpy.pi**5 * Km2) # [mm^6 /m^3] # RainFall Rate RR = 0.0006*numpy.pi * numpy.nansum( D_Vz**3 * DSD * VelMtrx ,0) #mm/hr # Censoring the data # Removing data with SNRth < 0dB se debe considerar el SNR por canal SNRth = 10**(SNRdBlimit/10) #-30dB novalid = numpy.where((dataOut.data_snr[0,:] = range_min and Height < range_max: # error_code will be useful in future analysis [Vzon,Vmer,Vver, error_code] = self.WindEstimation(spc[:,:,Height], cspc[:,:,Height], pairsList, ChanDist, Height, dataOut.noise, dataOut.spc_range, dbSNR[Height], SNRdBlimit, NegativeLimit, PositiveLimit,dataOut.frequency) if abs(Vzon) < 100. and abs(Vmer) < 100.: velocityX[Height] = Vzon velocityY[Height] = -Vmer velocityZ[Height] = Vver # Censoring data with SNR threshold dbSNR [dbSNR < SNRdBlimit] = numpy.NaN data_param[0] = velocityX data_param[1] = velocityY data_param[2] = velocityZ data_param[3] = dbSNR dataOut.data_param = data_param return dataOut def moving_average(self,x, N=2): """ convolution for smoothenig data. note that last N-1 values are convolution with zeroes """ return numpy.convolve(x, numpy.ones((N,))/N)[(N-1):] def gaus(self,xSamples,Amp,Mu,Sigma): return Amp * numpy.exp(-0.5*((xSamples - Mu)/Sigma)**2) def Moments(self, ySamples, xSamples): Power = numpy.nanmean(ySamples) # Power, 0th Moment yNorm = ySamples / numpy.nansum(ySamples) RadVel = numpy.nansum(xSamples * yNorm) # Radial Velocity, 1st Moment Sigma2 = numpy.nansum(yNorm * (xSamples - RadVel)**2) # Spectral Width, 2nd Moment StdDev = numpy.sqrt(numpy.abs(Sigma2)) # Desv. Estandar, Ancho espectral return numpy.array([Power,RadVel,StdDev]) def StopWindEstimation(self, error_code): Vzon = numpy.NaN Vmer = numpy.NaN Vver = numpy.NaN return Vzon, Vmer, Vver, error_code def AntiAliasing(self, interval, maxstep): """ function to prevent errors from aliased values when computing phaseslope """ antialiased = numpy.zeros(len(interval)) copyinterval = interval.copy() antialiased[0] = copyinterval[0] for i in range(1,len(antialiased)): step = interval[i] - interval[i-1] if step > maxstep: copyinterval -= 2*numpy.pi antialiased[i] = copyinterval[i] elif step < maxstep*(-1): copyinterval += 2*numpy.pi antialiased[i] = copyinterval[i] else: antialiased[i] = copyinterval[i].copy() return antialiased def WindEstimation(self, spc, cspc, pairsList, ChanDist, Height, noise, AbbsisaRange, dbSNR, SNRlimit, NegativeLimit, PositiveLimit, radfreq): """ Function that Calculates Zonal, Meridional and Vertical wind velocities. Initial Version by E. Bocanegra updated by J. Zibell until Nov. 2019. Input: spc, cspc : self spectra and cross spectra data. In Briggs notation something like S_i*(S_i)_conj, (S_j)_conj respectively. pairsList : Pairlist of channels ChanDist : array of xi_ij and eta_ij Height : height at which data is processed noise : noise in [channels] format for specific height Abbsisarange : range of the frequencies or velocities dbSNR, SNRlimit : signal to noise ratio in db, lower limit Output: Vzon, Vmer, Vver : wind velocities error_code : int that states where code is terminated 0 : no error detected 1 : Gaussian of mean spc exceeds widthlimit 2 : no Gaussian of mean spc found 3 : SNR to low or velocity to high -> prec. e.g. 4 : at least one Gaussian of cspc exceeds widthlimit 5 : zero out of three cspc Gaussian fits converged 6 : phase slope fit could not be found 7 : arrays used to fit phase have different length 8 : frequency range is either too short (len <= 5) or very long (> 30% of cspc) """ error_code = 0 nChan = spc.shape[0] nProf = spc.shape[1] nPair = cspc.shape[0] SPC_Samples = numpy.zeros([nChan, nProf]) # for normalized spc values for one height CSPC_Samples = numpy.zeros([nPair, nProf], dtype=numpy.complex_) # for normalized cspc values phase = numpy.zeros([nPair, nProf]) # phase between channels PhaseSlope = numpy.zeros(nPair) # slope of the phases, channelwise PhaseInter = numpy.zeros(nPair) # intercept to the slope of the phases, channelwise xFrec = AbbsisaRange[0][:-1] # frequency range xVel = AbbsisaRange[2][:-1] # velocity range xSamples = xFrec # the frequency range is taken delta_x = xSamples[1] - xSamples[0] # delta_f or delta_x # only consider velocities with in NegativeLimit and PositiveLimit if (NegativeLimit is None): NegativeLimit = numpy.min(xVel) if (PositiveLimit is None): PositiveLimit = numpy.max(xVel) xvalid = numpy.where((xVel > NegativeLimit) & (xVel < PositiveLimit)) xSamples_zoom = xSamples[xvalid] '''Getting Eij and Nij''' Xi01, Xi02, Xi12 = ChanDist[:,0] Eta01, Eta02, Eta12 = ChanDist[:,1] # spwd limit - updated by D. Scipión 30.03.2021 widthlimit = 10 '''************************* SPC is normalized ********************************''' spc_norm = spc.copy() # For each channel for i in range(nChan): spc_sub = spc_norm[i,:] - noise[i] # only the signal power SPC_Samples[i] = spc_sub / (numpy.nansum(spc_sub) * delta_x) '''********************** FITTING MEAN SPC GAUSSIAN **********************''' """ the gaussian of the mean: first subtract noise, then normalize. this is legal because you only fit the curve and don't need the absolute value of height for calculation, only for estimation of width. for normalization of cross spectra, you need initial, unnormalized self-spectra With noise. Technically, you don't even need to normalize the self-spectra, as you only need the width of the peak. However, it was left this way. Note that the normalization has a flaw: due to subtraction of the noise, some values are below zero. Raw "spc" values should be >= 0, as it is the modulus squared of the signals (complex * it's conjugate) """ # initial conditions popt = [1e-10,0,1e-10] # Spectra average SPCMean = numpy.average(SPC_Samples,0) # Moments in frequency SPCMoments = self.Moments(SPCMean[xvalid], xSamples_zoom) # Gauss Fit SPC in frequency domain if dbSNR > SNRlimit: # only if SNR > SNRth try: popt,pcov = curve_fit(self.gaus,xSamples_zoom,SPCMean[xvalid],p0=SPCMoments) if popt[2] <= 0 or popt[2] > widthlimit: # CONDITION return self.StopWindEstimation(error_code = 1) FitGauss = self.gaus(xSamples_zoom,*popt) except :#RuntimeError: return self.StopWindEstimation(error_code = 2) else: return self.StopWindEstimation(error_code = 3) '''***************************** CSPC Normalization ************************* The Spc spectra are used to normalize the crossspectra. Peaks from precipitation influence the norm which is not desired. First, a range is identified where the wind peak is estimated -> sum_wind is sum of those frequencies. Next, the area around it gets cut off and values replaced by mean determined by the boundary data -> sum_noise (spc is not normalized here, thats why the noise is important) The sums are then added and multiplied by range/datapoints, because you need an integral and not a sum for normalization. A norm is found according to Briggs 92. ''' # for each pair for i in range(nPair): cspc_norm = cspc[i,:].copy() chan_index0 = pairsList[i][0] chan_index1 = pairsList[i][1] CSPC_Samples[i] = cspc_norm / (numpy.sqrt(numpy.nansum(spc_norm[chan_index0])*numpy.nansum(spc_norm[chan_index1])) * delta_x) phase[i] = numpy.arctan2(CSPC_Samples[i].imag, CSPC_Samples[i].real) CSPCmoments = numpy.vstack([self.Moments(numpy.abs(CSPC_Samples[0,xvalid]), xSamples_zoom), self.Moments(numpy.abs(CSPC_Samples[1,xvalid]), xSamples_zoom), self.Moments(numpy.abs(CSPC_Samples[2,xvalid]), xSamples_zoom)]) popt01, popt02, popt12 = [1e-10,0,1e-10], [1e-10,0,1e-10] ,[1e-10,0,1e-10] FitGauss01, FitGauss02, FitGauss12 = numpy.zeros(len(xSamples)), numpy.zeros(len(xSamples)), numpy.zeros(len(xSamples)) '''*******************************FIT GAUSS CSPC************************************''' try: popt01,pcov = curve_fit(self.gaus,xSamples_zoom,numpy.abs(CSPC_Samples[0][xvalid]),p0=CSPCmoments[0]) if popt01[2] > widthlimit: # CONDITION return self.StopWindEstimation(error_code = 4) popt02,pcov = curve_fit(self.gaus,xSamples_zoom,numpy.abs(CSPC_Samples[1][xvalid]),p0=CSPCmoments[1]) if popt02[2] > widthlimit: # CONDITION return self.StopWindEstimation(error_code = 4) popt12,pcov = curve_fit(self.gaus,xSamples_zoom,numpy.abs(CSPC_Samples[2][xvalid]),p0=CSPCmoments[2]) if popt12[2] > widthlimit: # CONDITION return self.StopWindEstimation(error_code = 4) FitGauss01 = self.gaus(xSamples_zoom, *popt01) FitGauss02 = self.gaus(xSamples_zoom, *popt02) FitGauss12 = self.gaus(xSamples_zoom, *popt12) except: return self.StopWindEstimation(error_code = 5) '''************* Getting Fij ***************''' # x-axis point of the gaussian where the center is located from GaussFit of spectra GaussCenter = popt[1] ClosestCenter = xSamples_zoom[numpy.abs(xSamples_zoom-GaussCenter).argmin()] PointGauCenter = numpy.where(xSamples_zoom==ClosestCenter)[0][0] # Point where e^-1 is located in the gaussian PeMinus1 = numpy.max(FitGauss) * numpy.exp(-1) FijClosest = FitGauss[numpy.abs(FitGauss-PeMinus1).argmin()] # The closest point to"Peminus1" in "FitGauss" PointFij = numpy.where(FitGauss==FijClosest)[0][0] Fij = numpy.abs(xSamples_zoom[PointFij] - xSamples_zoom[PointGauCenter]) '''********** Taking frequency ranges from mean SPCs **********''' GauWidth = popt[2] * 3/2 # Bandwidth of Gau01 Range = numpy.empty(2) Range[0] = GaussCenter - GauWidth Range[1] = GaussCenter + GauWidth # Point in x-axis where the bandwidth is located (min:max) ClosRangeMin = xSamples_zoom[numpy.abs(xSamples_zoom-Range[0]).argmin()] ClosRangeMax = xSamples_zoom[numpy.abs(xSamples_zoom-Range[1]).argmin()] PointRangeMin = numpy.where(xSamples_zoom==ClosRangeMin)[0][0] PointRangeMax = numpy.where(xSamples_zoom==ClosRangeMax)[0][0] Range = numpy.array([ PointRangeMin, PointRangeMax ]) FrecRange = xSamples_zoom[ Range[0] : Range[1] ] '''************************** Getting Phase Slope ***************************''' for i in range(nPair): if len(FrecRange) > 5: PhaseRange = phase[i, xvalid[0][Range[0]:Range[1]]].copy() mask = ~numpy.isnan(FrecRange) & ~numpy.isnan(PhaseRange) if len(FrecRange) == len(PhaseRange): try: slope, intercept, _, _, _ = stats.linregress(FrecRange[mask], self.AntiAliasing(PhaseRange[mask], 4.5)) PhaseSlope[i] = slope PhaseInter[i] = intercept except: return self.StopWindEstimation(error_code = 6) else: return self.StopWindEstimation(error_code = 7) else: return self.StopWindEstimation(error_code = 8) '''*** Constants A-H correspond to the convention as in Briggs and Vincent 1992 ***''' '''Getting constant C''' cC=(Fij*numpy.pi)**2 '''****** Getting constants F and G ******''' MijEijNij = numpy.array([[Xi02,Eta02], [Xi12,Eta12]]) # MijEijNij = numpy.array([[Xi01,Eta01], [Xi02,Eta02], [Xi12,Eta12]]) # MijResult0 = (-PhaseSlope[0] * cC) / (2*numpy.pi) MijResult1 = (-PhaseSlope[1] * cC) / (2*numpy.pi) MijResult2 = (-PhaseSlope[2] * cC) / (2*numpy.pi) # MijResults = numpy.array([MijResult0, MijResult1, MijResult2]) MijResults = numpy.array([MijResult1, MijResult2]) (cF,cG) = numpy.linalg.solve(MijEijNij, MijResults) '''****** Getting constants A, B and H ******''' W01 = numpy.nanmax( FitGauss01 ) W02 = numpy.nanmax( FitGauss02 ) W12 = numpy.nanmax( FitGauss12 ) WijResult01 = ((cF * Xi01 + cG * Eta01)**2)/cC - numpy.log(W01 / numpy.sqrt(numpy.pi / cC)) WijResult02 = ((cF * Xi02 + cG * Eta02)**2)/cC - numpy.log(W02 / numpy.sqrt(numpy.pi / cC)) WijResult12 = ((cF * Xi12 + cG * Eta12)**2)/cC - numpy.log(W12 / numpy.sqrt(numpy.pi / cC)) WijResults = numpy.array([WijResult01, WijResult02, WijResult12]) WijEijNij = numpy.array([ [Xi01**2, Eta01**2, 2*Xi01*Eta01] , [Xi02**2, Eta02**2, 2*Xi02*Eta02] , [Xi12**2, Eta12**2, 2*Xi12*Eta12] ]) (cA,cB,cH) = numpy.linalg.solve(WijEijNij, WijResults) VxVy = numpy.array([[cA,cH],[cH,cB]]) VxVyResults = numpy.array([-cF,-cG]) (Vmer,Vzon) = numpy.linalg.solve(VxVy, VxVyResults) Vver = -SPCMoments[1]*SPEED_OF_LIGHT/(2*radfreq) error_code = 0 return Vzon, Vmer, Vver, error_code class SpectralMoments(Operation): ''' Function SpectralMoments() Calculates moments (power, mean, standard deviation) and SNR of the signal Type of dataIn: Spectra Configuration Parameters: proc_type : (0) First spectral moments routine (Default), (1) Spectral moment routine similar to JULIA. mode_fit : (0) No gaussian fit (1) One gaussian fit for 150Km processing. exp : '150EEJ' To select 128 points window 'ESF_EW' To select full window. Input: channelList : simple channel list to select e.g. [2,3,7] self.dataOut.data_pre : Spectral data self.dataOut.abscissaList : List of frequencies self.dataOut.noise : Noise level per channel Affected: self.dataOut.moments : Parameters per channel self.dataOut.data_snr : SNR per channel ''' def __calculateMoments(self, oldspec, oldfreq, n0, nicoh = None, graph = None, smooth = None, type1 = None, fwindow = None, \ snrth = None, dc = None, aliasing = None, oldfd = None, wwauto = None, \ vers= None, Hei= None, debug=False, dbg_hei=None, ymax=0.1, curr_ch=0, sel_ch=[0,1]): def __GAUSSWINFIT1(A, flagPDER=0): nonlocal truex, xvalid nparams = 4 M=truex.size mm=numpy.arange(M,dtype='f4') delta = numpy.zeros(M,dtype='f4') delta[0] = 1.0 Ts = numpy.array([1.0/(2*truex[0])],dtype='f4')[0] jj = -1j #if self.winauto is None: self.winauto = (1.0 - mm/M) winauto = (1.0 - mm/M) winauto = winauto/winauto.max() # Normalized to 1 #ON_ERROR,2 # IDL sentence: Return to caller if an error occurs A[0] = numpy.abs(A[0]) A[2] = numpy.abs(A[2]) A[3] = numpy.abs(A[3]) pi=numpy.array([numpy.pi],dtype='f4')[0] if A[2] != 0: Z = numpy.exp(-2*numpy.power((pi*A[2]*mm*Ts),2,dtype='f4')+jj*2*pi*A[1]*mm*Ts, dtype='c8') # Get Z else: Z = mm*0.0 A[0] = 0.0 junkF = numpy.roll(2*fft(winauto*(A[0]*Z+A[3]*delta)).real - \ winauto[0]*(A[0]+A[3]), M//2) # *M scale for fft not needed in python F = junkF[xvalid] if flagPDER == 0: #NEED PARTIAL? return F PDER = numpy.zeros((M,nparams)) #YES, MAKE ARRAY. PDER[:,0] = numpy.shift(2*(fft(winauto*Z)*M) - winauto[0], M/2) PDER[:,1] = numpy.shift(2*(fft(winauto*jj*2*numpy.pi*mm*Ts*A[0]*Z)*M), M/2) PDER[:,2] = numpy.shift(2*(fft(winauto*(-4*numpy.power(numpy.pi*mm*Ts,2)*A[2]*A[0]*Z))*M), M/2) PDER[:,3] = numpy.shift(2*(fft(winauto*delta)*M) - winauto[0], M/2) PDER = PDER[xvalid,:] return F, PDER def __curvefit_koki(y, a, Weights, FlagNoDerivative=1, itmax=20, tol=None): #ON_ERROR,2 IDL SENTENCE: RETURN TO THE CALLER IF ERROR if tol == None: tol = numpy.array([1.e-3],dtype='f4')[0] typ=a.dtype double = 1 if typ == numpy.float64 else 0 if typ != numpy.float32: a=a.astype(numpy.float32) #Make params floating # if we will be estimating partial derivates then compute machine precision if FlagNoDerivative == 1: res=numpy.MachAr(float_conv=numpy.float32) eps=numpy.sqrt(res.eps) nterms = a.size # Number of parameters nfree=numpy.array([numpy.size(y) - nterms],dtype='f4')[0] # Degrees of freedom if nfree <= 0: print('Curvefit - not enough data points.') flambda= numpy.array([0.001],dtype='f4')[0] # Initial lambda #diag=numpy.arange(nterms)*(nterms+1) # Subscripta of diagonal elements # Use diag method in python converge=1 #Define the partial derivative array PDER = numpy.zeros((nterms,numpy.size(y)),dtype='f8') if double == 1 else numpy.zeros((nterms,numpy.size(y)),dtype='f4') for Niter in range(itmax): #Iteration loop if FlagNoDerivative == 1: #Evaluate function and estimate partial derivatives yfit = __GAUSSWINFIT1(a) for term in range(nterms): p=a.copy() # Copy current parameters #Increment size for forward difference derivative inc = eps * abs(p[term]) if inc == 0: inc = eps p[term] = p[term] + inc yfit1 = __GAUSSWINFIT1(p) PDER[term,:] = (yfit1-yfit)/inc else: #The user's procedure will return partial derivatives yfit,PDER=__GAUSSWINFIT1(a, flagPDER=1) beta = numpy.dot(PDER,(y-yfit)*Weights) alpha = numpy.dot(PDER * numpy.tile(Weights,(nterms,1)), numpy.transpose(PDER)) # save current values of return parameters sigma1 = numpy.sqrt( 1.0 / numpy.diag(alpha) ) # Current sigma. sigma = sigma1 chisq1 = numpy.sum(Weights*numpy.power(y-yfit,2,dtype='f4'),dtype='f4')/nfree # Current chi squared. chisq = chisq1 yfit1 = yfit elev7=numpy.array([1.0e7],dtype='f4')[0] compara =numpy.sum(abs(y))/elev7/nfree done_early = chisq1 < compara if done_early: chi2 = chisq # Return chi-squared (chi2 obsolete-still works) if done_early: Niter -= 1 #save_tp(chisq,Niter,yfit) return yfit, a, converge, sigma, chisq # return result #c = numpy.dot(c, c) # this operator implemented at the next lines c_tmp = numpy.sqrt(numpy.diag(alpha)) siz=len(c_tmp) c=numpy.dot(c_tmp.reshape(siz,1),c_tmp.reshape(1,siz)) lambdaCount = 0 while True: lambdaCount += 1 # Normalize alpha to have unit diagonal. array = alpha / c # Augment the diagonal. one=numpy.array([1.],dtype='f4')[0] numpy.fill_diagonal(array,numpy.diag(array)*(one+flambda)) # Invert modified curvature matrix to find new parameters. try: array = (1.0/array) if array.size == 1 else numpy.linalg.inv(array) except Exception as e: print(e) array[:]=numpy.NaN b = a + numpy.dot(numpy.transpose(beta),array/c) # New params yfit = __GAUSSWINFIT1(b) # Evaluate function chisq = numpy.sum(Weights*numpy.power(y-yfit,2,dtype='f4'),dtype='f4')/nfree # New chisq sigma = numpy.sqrt(numpy.diag(array)/numpy.diag(alpha)) # New sigma if (numpy.isfinite(chisq) == 0) or \ (lambdaCount > 30 and chisq >= chisq1): # Reject changes made this iteration, use old values. yfit = yfit1 sigma = sigma1 chisq = chisq1 converge = 0 #print('Failed to converge.') chi2 = chisq # Return chi-squared (chi2 obsolete-still works) if done_early: Niter -= 1 return yfit, a, converge, sigma, chisq, chi2 # return result ten=numpy.array([10.0],dtype='f4')[0] flambda *= ten # Assume fit got worse if chisq <= chisq1: break hundred=numpy.array([100.0],dtype='f4')[0] flambda /= hundred a=b # Save new parameter estimate. if ((chisq1-chisq)/chisq1) <= tol: # Finished? chi2 = chisq # Return chi-squared (chi2 obsolete-still works) if done_early: Niter -= 1 return yfit, a, converge, sigma, chisq, chi2 # return result converge = 0 chi2 = chisq #print('Failed to converge.') return yfit, a, converge, sigma, chisq, chi2 def spectral_cut(Hei, ind, dbg_hei, freq, fd, snr, n1, w, ymax, spec, spec2, n0, max_spec, ss1, m, bb0, curr_ch, sel_ch): if Hei[ind] > dbg_hei[0] and Hei[ind] < dbg_hei[1] and (curr_ch in sel_ch): nsa=len(freq) aux='H=%iKm, dop: %4.1f, snr: %4.1f, noise: %4.1f, sw: %4.1f'%(Hei[ind],fd, 10*numpy.log10(snr),10*numpy.log10(n1), w) plt.subplots() plt.ylim(0,ymax) plt.plot(freq,spec,'b-',freq,spec2,'b--', freq,numpy.repeat(n1, nsa),'k--', freq,numpy.repeat(n0, nsa),'k-', freq,numpy.repeat(max_spec, nsa),'y.-', numpy.repeat(fd, nsa),numpy.linspace(0,ymax,nsa),'r--', numpy.repeat(freq[ss1], nsa),numpy.linspace(0,ymax,nsa),'g-.', numpy.repeat(freq[m + bb0], nsa),numpy.linspace(0,ymax,nsa),'g-.') plt.title(aux) plt.show() if (nicoh is None): nicoh = 1 if (smooth is None): smooth = 0 if (type1 is None): type1 = 0 if (vers is None): vers = 0 if (fwindow is None): fwindow = numpy.zeros(oldfreq.size) + 1 if (snrth is None): snrth = -20.0 if (dc is None): dc = 0 if (aliasing is None): aliasing = 0 if (oldfd is None): oldfd = 0 if (wwauto is None): wwauto = 0 if (n0 < 1.e-20): n0 = 1.e-20 xvalid = numpy.where(fwindow == 1)[0] freq = oldfreq truex = oldfreq vec_power = numpy.zeros(oldspec.shape[1]) vec_fd = numpy.zeros(oldspec.shape[1]) vec_w = numpy.zeros(oldspec.shape[1]) vec_snr = numpy.zeros(oldspec.shape[1]) vec_n1 = numpy.empty(oldspec.shape[1]) vec_fp = numpy.empty(oldspec.shape[1]) vec_sigma_fd = numpy.empty(oldspec.shape[1]) for ind in range(oldspec.shape[1]): spec = oldspec[:,ind] if (smooth == 0): spec2 = spec else: spec2 = scipy.ndimage.filters.uniform_filter1d(spec,size=smooth) aux = spec2*fwindow max_spec = aux.max() m = aux.tolist().index(max_spec) if m > 2 and m < oldfreq.size - 3: newindex = m + numpy.array([-2,-1,0,1,2]) newfreq = numpy.arange(20)/20.0*(numpy.max(freq[newindex])-numpy.min(freq[newindex]))+numpy.min(freq[newindex]) tck = interpolate.splrep(freq[newindex], spec2[newindex]) peakspec = interpolate.splev(newfreq, tck) max_spec = numpy.max(peakspec) mnew = numpy.argmax(peakspec) fp = newfreq[mnew] else: fp = freq[m] if vers ==0: # Moments Estimation bb = spec2[numpy.arange(m,spec2.size)] bb = (bb m): ss1 = m valid = numpy.arange(int(m + bb0 - ss1 + 1)) + ss1 signal_power = ((spec2[valid] - n0) * fwindow[valid]).mean() # D. Scipión added with correct definition total_power = (spec2[valid] * fwindow[valid]).mean() # D. Scipión added with correct definition power = ((spec2[valid] - n0) * fwindow[valid]).sum() fd = ((spec2[valid]- n0)*freq[valid] * fwindow[valid]).sum() / power w = numpy.sqrt(((spec2[valid] - n0)*fwindow[valid]*(freq[valid]- fd)**2).sum() / power) snr = (spec2.mean()-n0)/n0 if (snr < 1.e-20): snr = 1.e-20 vec_power[ind] = total_power vec_fd[ind] = fd vec_w[ind] = w vec_snr[ind] = snr else: # Noise by heights n1, stdv = self.__get_noise2(spec, nicoh) # Moments Estimation bb = spec2[numpy.arange(m,spec2.size)] bb = (bb m): ss1 = m valid = numpy.arange(int(m + bb0 - ss1 + 1)) + ss1 power = ((spec[valid] - n1)*fwindow[valid]).sum() fd = ((spec[valid]- n1)*freq[valid]*fwindow[valid]).sum()/power try: w = numpy.sqrt(((spec[valid] - n1)*fwindow[valid]*(freq[valid]- fd)**2).sum()/power) except: w = float("NaN") snr = power/(n0*fwindow.sum()) if debug: spectral_cut(Hei, ind, dbg_hei, freq, fd, snr, n1, w, ymax, spec, spec2, n0, max_spec, ss1, m, bb0, curr_ch, sel_ch) if snr < 1.e-20: snr = 1.e-20 # Here start gaussean adjustment if type1 == 1 and snr > numpy.power(10,0.1*snrth): a = numpy.zeros(4,dtype='f4') a[0] = snr * n0 a[1] = fd a[2] = w a[3] = n0 np = spec.size aold = a.copy() spec2 = spec.copy() oldxvalid = xvalid.copy() for i in range(2): ww = 1.0/(numpy.power(spec2,2)/nicoh) ww[np//2] = 0.0 a = aold.copy() xvalid = oldxvalid.copy() #self.show_var(xvalid) gaussfn = __curvefit_koki(spec[xvalid], a, ww[xvalid]) a = gaussfn[1] converge = gaussfn[2] xvalid = numpy.arange(np) spec2 = __GAUSSWINFIT1(a) xvalid = oldxvalid.copy() power = a[0] * np fd = a[1] sigma_fd = gaussfn[3][1] snr = max(power/ (max(a[3],n0) * len(oldxvalid)) * converge, 1e-20) w = numpy.abs(a[2]) n1 = max(a[3], n0) #gauss_adj=[fd,w,snr,n1,fp,sigma_fd] else: sigma_fd=numpy.nan # to avoid UnboundLocalError: local variable 'sigma_fd' referenced before assignment vec_fd[ind] = fd vec_w[ind] = w vec_snr[ind] = snr vec_n1[ind] = n1 vec_fp[ind] = fp vec_sigma_fd[ind] = sigma_fd vec_power[ind] = power # to compare with type 0 proccessing if vers==1: return numpy.vstack((vec_snr, vec_w, vec_fd, vec_n1, vec_fp, vec_sigma_fd, vec_power)) else: return numpy.vstack((vec_snr, vec_power, vec_fd, vec_w)) def __get_noise2(self,POWER, fft_avg, TALK=0): ''' Rutina para cálculo de ruido por alturas(n1). Similar a IDL ''' SPECT_PTS = len(POWER) fft_avg = fft_avg*1.0 NOMIT = 0 NN = SPECT_PTS - NOMIT N = NN//2 ARR = numpy.concatenate((POWER[0:N+1],POWER[N+NOMIT+1:SPECT_PTS])) ARR = numpy.sort(ARR) NUMS_MIN = (SPECT_PTS+7)//8 RTEST = (1.0+1.0/fft_avg) SUM = 0.0 SUMSQ = 0.0 J = 0 for I in range(NN): J = J + 1 SUM = SUM + ARR[I] SUMSQ = SUMSQ + ARR[I]*ARR[I] AVE = SUM*1.0/J if J > NUMS_MIN: if (SUMSQ*J <= RTEST*SUM*SUM): RNOISE = AVE else: if J == NUMS_MIN: RNOISE = AVE if TALK == 1: print('Noise Power (2):%4.4f' %RNOISE) stdv = numpy.sqrt(SUMSQ/J - numpy.power(SUM/J,2)) return RNOISE, stdv def __get_noise1(self, power, fft_avg, TALK=0): ''' Rutina para cálculo de ruido por alturas(n0). Similar a IDL ''' num_pts = numpy.size(power) fft_avg = fft_avg*1.0 ind = numpy.argsort(power, axis=None, kind='stable') ARR = numpy.reshape(power,-1)[ind] NUMS_MIN = num_pts//10 RTEST = (1.0+1.0/fft_avg) SUM = 0.0 SUMSQ = 0.0 J = 0 cont = 1 while cont == 1 and J < num_pts: SUM = SUM + ARR[J] SUMSQ = SUMSQ + ARR[J]*ARR[J] J = J + 1 if J > NUMS_MIN: if (SUMSQ*J <= RTEST*SUM*SUM): LNOISE = SUM*1.0/J else: J = J - 1 SUM = SUM - ARR[J] SUMSQ = SUMSQ - ARR[J]*ARR[J] cont = 0 else: if J == NUMS_MIN: LNOISE = SUM*1.0/J if TALK == 1: print('Noise Power (1):%8.8f' %LNOISE) stdv = numpy.sqrt(SUMSQ/J - numpy.power(SUM/J,2)) return LNOISE, stdv def __NoiseByChannel(self, num_prof, num_incoh, spectra,talk=0): val_frq = numpy.arange(num_prof-2)+1 val_frq[(num_prof-2)//2:] = val_frq[(num_prof-2)//2:] + 1 junkspc = numpy.sum(spectra[val_frq,:], axis=1) junkid = numpy.argsort(junkspc) noisezone = val_frq[junkid[0:num_prof//2]] specnoise = spectra[noisezone,:] noise, stdvnoise = self.__get_noise1(specnoise,num_incoh) if talk: print('noise =', noise) return noise, stdvnoise def run(self, dataOut, proc_type=0, mode_fit=0, exp='150EEJ', debug=False, dbg_hei=None, ymax=1, sel_ch=[0,1]): absc = dataOut.abscissaList[:-1] nChannel = dataOut.data_pre[0].shape[0] nHei = dataOut.data_pre[0].shape[2] Hei=dataOut.heightList data_param = numpy.zeros((nChannel, 4 + proc_type*3, nHei)) nProfiles = dataOut.nProfiles nCohInt = dataOut.nCohInt nIncohInt = dataOut.nIncohInt M = numpy.power(numpy.array(1/(nProfiles * nCohInt) ,dtype='float32'),2) N = numpy.array(M / nIncohInt,dtype='float32') if proc_type == 1: type1 = mode_fit fwindow = numpy.zeros(absc.size) + 1 if exp == '150EEJ': b=64 fwindow[0:absc.size//2 - b] = 0 fwindow[absc.size//2 + b:] = 0 vers = 1 # new data = dataOut.data_pre[0] * N noise = numpy.zeros(nChannel) stdvnoise = numpy.zeros(nChannel) for ind in range(nChannel): noise[ind], stdvnoise[ind] = self.__NoiseByChannel(nProfiles, nIncohInt, data[ind,:,:]) smooth=3 else: data = dataOut.data_pre[0] noise = dataOut.noise fwindow = None type1 = None vers = 0 # old nIncohInt = None smooth=None for ind in range(nChannel): data_param[ind,:,:] = self.__calculateMoments(data[ind,:,:] , absc , noise[ind], nicoh=nIncohInt, smooth=smooth, type1=type1, fwindow=fwindow, vers=vers, Hei=Hei, debug=debug, dbg_hei=dbg_hei, ymax=ymax, curr_ch=ind, sel_ch=sel_ch) #data_param[ind,:,:] = self.__calculateMoments(data[ind,:,:] , absc , noise[ind], nicoh=nIncohInt, smooth=smooth, type1=type1, fwindow=fwindow, vers=vers, Hei=Hei, debug=debug) if exp == 'ESF_EW': data_param[ind,0,:]*=(noise[ind]/stdvnoise[ind]) data_param[ind,3,:]*=(1.0/M) if proc_type == 1: dataOut.moments = data_param[:,1:,:] dataOut.data_dop = data_param[:,2] dataOut.data_width = data_param[:,1] dataOut.data_snr = data_param[:,0] dataOut.data_pow = data_param[:,6] # to compare with type0 proccessing dataOut.spcpar=numpy.stack((dataOut.data_dop,dataOut.data_width,dataOut.data_snr, data_param[:,3], data_param[:,4],data_param[:,5]),axis=2) if exp == 'ESF_EW': spc=dataOut.data_pre[0]* N cspc=dataOut.data_pre[1]* N nHei=dataOut.data_pre[1].shape[2] cross_pairs=dataOut.pairsList nDiffIncohInt = dataOut.nDiffIncohInt N2=numpy.array(1 / nDiffIncohInt,dtype='float32') diffcspectra=dataOut.data_diffcspc.copy()* N2 * M * M num_pairs=len(dataOut.pairsList) if num_pairs >= 0: fbinv=numpy.where(absc != 0)[0] ccf=numpy.sum(cspc[:,fbinv,:], axis=1) jvpower=numpy.sum(spc[:,fbinv,:], axis=1) coh=ccf/numpy.sqrt(jvpower[cross_pairs[0][0],:]*jvpower[cross_pairs[0][1],:]) dccf=numpy.sum(diffcspectra[:,fbinv,:], axis=1) dataOut.ccfpar = numpy.zeros((num_pairs,nHei,3)) dataOut.ccfpar[:,:,0]=numpy.abs(coh) dataOut.ccfpar[:,:,1]=numpy.arctan(numpy.imag(coh)/numpy.real(coh)) dataOut.ccfpar[:,:,2]=numpy.arctan(numpy.imag(dccf)/numpy.real(dccf)) else: dataOut.moments = data_param[:,1:,:] dataOut.data_snr = data_param[:,0] dataOut.data_pow = data_param[:,1] dataOut.data_dop = data_param[:,2] dataOut.data_width = data_param[:,3] dataOut.spcpar=numpy.stack((dataOut.data_dop,dataOut.data_width,dataOut.data_snr, dataOut.data_pow),axis=2) return dataOut class JULIA_DayVelocities(Operation): ''' Function SpectralMoments() From espectral parameters calculates: 1. Signal to noise level (SNL) 2. Vertical velocity 3. Zonal velocity 4. Vertical velocity error 5. Zonal velocity error. Type of dataIn: SpectralMoments Configuration Parameters: zenith : Pairs of angles corresponding to the two beams related to the perpendicular to B from the center of the antenna. zenithCorrection : Adjustment angle for the zenith. Default 0. heights : Range to process 150kM echoes. By default [125,185]. nchan : To process 2 or 1 channel. 2 by default. chan : If nchan = 1, chan indicates which of the 2 channels to process. clean : 2nd cleaning processing (Graphical). Default False driftstdv_th : Diferencia máxima entre valores promedio consecutivos de vertical. zonalstdv_th : Diferencia máxima entre valores promedio consecutivos de zonal. Input: Affected: ''' def __init__(self): Operation.__init__(self) self.old_drift=None self.old_zonal=None self.count_drift=0 self.count_zonal=0 self.oldTime_drift=None self.oldTime_zonal=None def newtotal(self, data): return numpy.nansum(data) def data_filter(self, parm, snrth=-20, swth=20, wErrth=500): Sz0 = parm.shape # Sz0: h,p drift = parm[:,0] sw = 2*parm[:,1] snr = 10*numpy.log10(parm[:,2]) Sz = drift.shape # Sz: h mask = numpy.ones((Sz[0])) th=0 valid=numpy.where(numpy.isfinite(snr)) cvalid = len(valid[0]) if cvalid >= 1: # Cálculo del ruido promedio de snr para el i-ésimo grupo de alturas nbins = int(numpy.max(snr)-numpy.min(snr))+1 # bin size = 1, similar to IDL h = numpy.histogram(snr,bins=nbins) hist = h[0] values = numpy.round_(h[1]) moda = values[numpy.where(hist == numpy.max(hist))] indNoise = numpy.where(numpy.abs(snr - numpy.min(moda)) < 3)[0] noise = snr[indNoise] noise_mean = numpy.sum(noise)/len(noise) # Cálculo de media de snr med = numpy.median(snr) # Establece el umbral de snr if noise_mean > med + 3: th = med else: th = noise_mean + 3 # Establece máscara novalid = numpy.where(snr <= th)[0] mask[novalid] = numpy.nan # Elimina datos que no sobrepasen el umbral: PARAMETRO novalid = numpy.where(snr <= snrth) cnovalid = len(novalid[0]) if cnovalid > 0: mask[novalid] = numpy.nan novalid = numpy.where(numpy.isnan(snr)) cnovalid = len(novalid[0]) if cnovalid > 0: mask[novalid] = numpy.nan new_parm = numpy.zeros((Sz0[0],Sz0[1])) for i in range(Sz0[1]): new_parm[:,i] = parm[:,i] * mask return new_parm, th def statistics150km(self, veloc , sigma , threshold , old_veloc=None, count=0, \ currTime=None, oldTime=None, amountdata=2, clearAll = None, timeFactor=1800, debug = False): if oldTime == None: oldTime = currTime step = (threshold/2)*(numpy.abs(currTime - oldTime)//timeFactor + 1) factor = 2 avg_threshold = 100 # Calcula la mediana en todas las alturas por tiempo val1=numpy.nanmedian(veloc) # Calcula la media ponderada en todas las alturas por tiempo val2 = self.newtotal(veloc/numpy.power(sigma,2))/self.newtotal(1/numpy.power(sigma,2)) # Verifica la cercanía de los valores calculados de mediana y media, si son cercanos escoge la media ponderada op1=numpy.abs(val2-val1) op2=threshold/factor cond = op1 < op2 veloc_prof = val2 if cond else val1 sigma_prof = numpy.nan sets=numpy.array([-1]) if op1 > avg_threshold: #Si son muy lejanos no toma en cuenta estos datos veloc_prof = numpy.nan # Se calcula nuevamente media ponderada, en base a estimado inicial de la media # a fin de eliminar valores que están muy lejanos a dicho valor if debug: print('veloc_prof:', veloc_prof) print('veloc:',veloc) print('threshold:',threshold) print('factor:',factor) print('threshold/factor:',threshold/factor) print('numpy.abs(veloc-veloc_prof):', numpy.abs(veloc-veloc_prof)) print('numpy.where(numpy.abs(veloc-veloc_prof) < threshold/factor)[0]:', numpy.where(numpy.abs(veloc-veloc_prof) < threshold/factor)[0]) junk = numpy.where(numpy.abs(veloc-veloc_prof) < threshold/factor)[0] if junk.size > 2: veloc_prof = self.newtotal(veloc[junk]/numpy.power(sigma[junk],2))/self.newtotal(1/numpy.power(sigma[junk],2)) sigma_prof1 = numpy.sqrt(1/self.newtotal(1/numpy.power(sigma[junk],2))) sigma_prof2 = numpy.sqrt(self.newtotal(numpy.power(veloc[junk]-veloc_prof,2)/numpy.power(sigma[junk],2)))*sigma_prof1 sigma_prof = numpy.sqrt(numpy.power(sigma_prof1,2)+numpy.power(sigma_prof2,2)) sets = junk # Compara con valor anterior para evitar presencia de "outliers" if debug: print('old_veloc:',old_veloc) print('step:', step) if old_veloc == None: valid=numpy.isfinite(veloc_prof) else: valid=numpy.abs(veloc_prof-old_veloc) < step if debug: print('valid:', valid) if not valid: aver_veloc=numpy.nan aver_sigma=numpy.nan sets=numpy.array([-1]) else: aver_veloc=veloc_prof aver_sigma=sigma_prof clearAll=0 if old_veloc != None and count < 5: if numpy.abs(veloc_prof-old_veloc) > step: clearAll=1 count=0 old_veloc=None if numpy.isfinite(aver_veloc): count+=1 if old_veloc != None: old_veloc = (old_veloc + aver_veloc) * 0.5 else: old_veloc=aver_veloc oldTime=currTime if debug: print('count:',count) print('sets:',sets) return sets, old_veloc, count, oldTime, aver_veloc, aver_sigma, clearAll def run(self, dataOut, zenith, zenithCorrection=0.0, heights=[125, 185], nchan=2, chan=0, clean=False, driftstdv_th=100, zonalstdv_th=200): dataOut.lat=-11.95 dataOut.lon=-76.87 nCh=dataOut.spcpar.shape[0] nHei=dataOut.spcpar.shape[1] nParam=dataOut.spcpar.shape[2] # Selección de alturas hei=dataOut.heightList hvalid=numpy.where([hei >= heights[0]][0] & [hei <= heights[1]][0])[0] nhvalid=len(hvalid) dataOut.heightList = hei[hvalid] parm=numpy.empty((nCh,nhvalid,nParam)); parm[:]=numpy.nan parm[:] = dataOut.spcpar[:,hvalid,:] # Primer filtrado: Umbral de SNR for i in range(nCh): parm[i,:,:] = self.data_filter(parm[i,:,:])[0] zenith = numpy.array(zenith) zenith -= zenithCorrection zenith *= numpy.pi/180 alpha = zenith[0] beta = zenith[1] dopplerCH0 = parm[0,:,0] dopplerCH1 = parm[1,:,0] swCH0 = parm[0,:,1] swCH1 = parm[1,:,1] snrCH0 = 10*numpy.log10(parm[0,:,2]) snrCH1 = 10*numpy.log10(parm[1,:,2]) noiseCH0 = parm[0,:,3] noiseCH1 = parm[1,:,3] wErrCH0 = parm[0,:,5] wErrCH1 = parm[1,:,5] # Vertical and zonal calculation: nchan=2 by default # Only vertical calculation, for offline processing with only one channel with good signal if nchan == 1: if chan == 1: drift = - dopplerCH1 snr = snrCH1 noise = noiseCH1 sw = swCH1 w_w_err = wErrCH1 elif chan == 0: drift = - dopplerCH0 snr = snrCH0 noise = noiseCH0 sw = swCH0 w_w_err = wErrCH0 elif nchan == 2: sinB_A = numpy.sin(beta)*numpy.cos(alpha) - numpy.sin(alpha)* numpy.cos(beta) drift = -(dopplerCH0 * numpy.sin(beta) - dopplerCH1 * numpy.sin(alpha))/ sinB_A zonal = (dopplerCH0 * numpy.cos(beta) - dopplerCH1 * numpy.cos(alpha))/ sinB_A snr = (snrCH0 + snrCH1)/2 noise = (noiseCH0 + noiseCH1)/2 sw = (swCH0 + swCH1)/2 w_w_err= numpy.sqrt(numpy.power(wErrCH0 * numpy.sin(beta)/numpy.abs(sinB_A),2) + numpy.power(wErrCH1 * numpy.sin(alpha)/numpy.abs(sinB_A),2)) w_e_err= numpy.sqrt(numpy.power(wErrCH0 * numpy.cos(beta)/numpy.abs(-1*sinB_A),2) + numpy.power(wErrCH1 * numpy.cos(alpha)/numpy.abs(-1*sinB_A),2)) # 150Km statistics to clean data clean_drift = drift.copy() clean_drift[:] = numpy.nan if nchan == 2: clean_zonal = zonal.copy() clean_zonal[:] = numpy.nan # Vertical sets1, self.old_drift, self.count_drift, self.oldTime_drift, aver_veloc, aver_sigma, clearAll = self.statistics150km(drift, w_w_err, driftstdv_th, \ old_veloc=self.old_drift, count=self.count_drift, currTime=dataOut.utctime, \ oldTime=self.oldTime_drift, timeFactor=120) if clearAll == 1: mean_zonal = numpy.nan sigma_zonal = numpy.nan mean_drift = aver_veloc sigma_drift = aver_sigma if sets1.size != 1: clean_drift[sets1] = drift[sets1] novalid=numpy.where(numpy.isnan(clean_drift))[0]; cnovalid=novalid.size if cnovalid > 0: drift[novalid] = numpy.nan if cnovalid > 0: snr[novalid] = numpy.nan # Zonal if nchan == 2: sets2, self.old_zonal, self.count_zonal, self.oldTime_zonal, aver_veloc, aver_sigma, clearAll = self.statistics150km(zonal, w_e_err, zonalstdv_th, \ old_veloc=self.old_zonal, count=self.count_zonal, currTime=dataOut.utctime, \ oldTime=self.oldTime_zonal, timeFactor=600) if clearAll == 1: mean_zonal = numpy.nan sigma_zonal = numpy.nan mean_zonal = aver_veloc sigma_zonal = aver_sigma if sets2.size != 1: clean_zonal[sets2] = zonal[sets2] novalid=numpy.where(numpy.isnan(clean_zonal))[0]; cnovalid=novalid.size if cnovalid > 0: zonal[novalid] = numpy.nan if cnovalid > 0: snr[novalid] = numpy.nan n_avg_par=4 avg_par=numpy.empty((n_avg_par,)); avg_par[:] = numpy.nan avg_par[0,]=mean_drift avg_par[1,]=mean_zonal avg_par[2,]=sigma_drift avg_par[3,]=sigma_zonal set1 = 1.0 navg = set1 nci = dataOut.nCohInt # ---------------------------------- ipp = 252.0 nincoh = dataOut.nIncohInt nptsfft = dataOut.nProfiles hardcoded=False # if True, similar to IDL processing if hardcoded: ipp=200.1 nincoh=22 nptsfft=128 # ---------------------------------- nipp = ipp * nci height = dataOut.heightList nHei = len(height) kd = 213.6 nint = nptsfft * nincoh drift1D = drift.copy() if nchan == 2: zonal1D=zonal.copy() snr1D = snr.copy() snr1D = 10*numpy.power(10, 0.1*snr1D) noise1D = noise.copy() noise0 = numpy.nanmedian(noise1D) noise = noise0 + noise0 sw1D = sw.copy() pow0 = snr1D * noise0 + noise0 acf0 = snr1D * noise0 * numpy.exp((-drift1D*nipp*numpy.pi/(1.5e5*1.5))*1j) * (1-0.5*numpy.power(sw1D*nipp*numpy.pi/(1.5e5*1.5),2)) acf0 /= pow0 acf1 = acf0 dt= nint * nipp /1.5e5 if nchan == 2: dccf = pow0 * pow0 * numpy.exp((zonal1D*kd*dt/(height*1e3))*(1j)) else: dccf = numpy.empty(nHei); dccf[:]=numpy.nan # complex? dccf /= pow0 * pow0 sno=(pow0+pow0-noise)/noise # First parameter: Signal to noise ratio and its error sno = numpy.log10(sno) sno10 = 10 * sno dsno = 1.0/numpy.sqrt(nint*navg)*(1+1/sno10) # Second parameter: Vertical Drifts s=numpy.sqrt(numpy.abs(acf0)*numpy.abs(acf1)) sp = s*(1.0 + 1.0/sno10) vzo = -numpy.arctan2(numpy.imag(acf0+acf1),numpy.real(acf0+acf1))* \ 1.5e5*1.5/(nipp*numpy.pi) dvzo = numpy.sqrt(1-sp*sp)*0.338*1.5e5/(numpy.sqrt(nint*navg)*sp*nipp) # Third parameter: Zonal Drifts dt = nint*nipp/1.5e5 ss = numpy.sqrt(numpy.abs(dccf)) vxo = numpy.arctan2(numpy.imag(dccf),numpy.real(dccf))*height*1e3/(kd*dt) dvxo = numpy.sqrt(1.0-ss*ss)*height*1e3/(numpy.sqrt(nint*navg)*ss*kd*dt) npar = 5 par = numpy.empty((npar, nHei)); par[:] = numpy.nan par[0,:] = sno par[1,:] = vzo par[2,:] = vxo par[3,:] = dvzo par[4,:] = dvxo # Segundo filtrado: # Remoción por altura: Menos de dos datos finitos no son considerados como eco 150Km. clean_par=numpy.empty((npar,nHei)); clean_par[:]=numpy.nan if clean: for p in range(npar): ih=0 while ih < nHei-1: j=ih if numpy.isfinite(snr1D[ih]): while numpy.isfinite(snr1D[j]): j+=1 if j >= nHei: break if j > ih + 1: for k in range(ih,j): clean_par[p][k] = par[p][k] ih = j - 1 ih+=1 else: clean_par[:] = par[:] mad_output = numpy.vstack((clean_par[0,:], clean_par[1,:], clean_par[2,:], clean_par[3,:], clean_par[4,:])) graph = numpy.vstack((clean_par[0,:], clean_par[1,:], clean_par[2,:])) dataOut.data_output = mad_output dataOut.data_graph = graph dataOut.avg_output = avg_par dataOut.utctimeInit = dataOut.utctime dataOut.outputInterval = dataOut.timeInterval dataOut.flagNoData = numpy.all(numpy.isnan(dataOut.data_output[0])) # NAN vectors are not written return dataOut class JULIA_NightVelocities(Operation): ''' Function SpreadFVelocities() Calculates SNL and drifts Type of dataIn: Parameters Configuration Parameters: mymode : (0) Interferometry, (1) Doppler beam swinging. myproc : (0) JULIA_V, (1) JULIA_EW. myantenna : (0) 1/4 antenna, (1) 1/2 antenna. jset : Number of Incoherent integrations. Input: channelList : simple channel list to select e.g. [2,3,7] self.dataOut.data_pre : Spectral data self.dataOut.abscissaList : List of frequencies self.dataOut.noise : Noise level per channel Affected: self.dataOut.moments : Parameters per channel self.dataOut.data_snr : SNR per channel ''' def __init__(self): Operation.__init__(self) def newtotal(self, data): return numpy.nansum(data) def data_filter(self, parm, snrth=-17, swth=20, dopth=500.0, debug=False): Sz0 = parm.shape # Sz0: h,p drift = parm[:,0] sw = 2*parm[:,1] snr = 10*numpy.log10(parm[:,2]) Sz = drift.shape # Sz: h mask = numpy.ones((Sz[0])) th=0 valid=numpy.where(numpy.isfinite(snr)) cvalid = len(valid[0]) if cvalid >= 1: # Cálculo del ruido promedio de snr para el i-ésimo grupo de alturas nbins = int(numpy.max(snr)-numpy.min(snr))+1 # bin size = 1, similar to IDL h = numpy.histogram(snr,bins=nbins) hist = h[0] values = numpy.round_(h[1]) moda = values[numpy.where(hist == numpy.max(hist))] indNoise = numpy.where(numpy.abs(snr - numpy.min(moda)) < 3)[0] noise = snr[indNoise] noise_mean = numpy.sum(noise)/len(noise) # Cálculo de media de snr med = numpy.median(snr) # Establece el umbral de snr if noise_mean > med + 3: th = med else: th = noise_mean + 3 # Establece máscara novalid = numpy.where(snr <= th)[0] mask[novalid] = numpy.nan # Elimina datos que no sobrepasen el umbral: PARAMETRO novalid = numpy.where(snr <= snrth) cnovalid = len(novalid[0]) if cnovalid > 0: mask[novalid] = numpy.nan novalid = numpy.where(numpy.isnan(snr)) cnovalid = len(novalid[0]) if cnovalid > 0: mask[novalid] = numpy.nan # umbral de velocidad if dopth != None: novalid = numpy.where(numpy.logical_or(drift< dopth*(-1), drift > dopth)) cnovalid = len(novalid[0]) if cnovalid > 0: mask[novalid] = numpy.nan if debug: print('Descartados:%i de %i:' %(cnovalid, len(drift))) print('Porcentaje:%3.1f' %(100.0*cnovalid/len(drift))) new_parm = numpy.zeros((Sz0[0],Sz0[1])) for i in range(Sz0[1]): new_parm[:,i] = parm[:,i] * mask return new_parm, mask def run(self, dataOut, zenith, zenithCorrection, mymode=1, dbs_sel=0, myproc=0, myantenna=0, jset=None, clean=False): dataOut.lat=-11.95 dataOut.lon=-76.87 mode=mymode proc=myproc antenna=myantenna nci=dataOut.nCohInt nptsfft=dataOut.nProfiles navg= 3 if jset is None else jset nint=dataOut.nIncohInt//navg navg1=dataOut.nProfiles * nint * navg tau1=dataOut.ippSeconds nipp=dataOut.radarControllerHeaderObj.ipp jlambda=6 kd=213.6 hei=dataOut.heightList.copy() nCh=dataOut.spcpar.shape[0] nHei=dataOut.spcpar.shape[1] nParam=dataOut.spcpar.shape[2] parm = numpy.zeros((nCh,nHei,nParam)) parm[:] = dataOut.spcpar[:] mask=numpy.ones(nHei) mask0=mask.copy() # Primer filtrado: Umbral de SNR for i in range(nCh): parm[i,:,:], mask = self.data_filter(parm[i,:,:], snrth = 0.1) # umbral 0.1 filtra señal que no corresponde a ESF, para interferometría usar -17dB mask0 *= mask ccf_results=numpy.transpose(dataOut.ccfpar,(2,1,0)) for i in range(3): ccf_results[i,:,0] *= mask0 zenith = numpy.array(zenith) zenith -= zenithCorrection zenith *= numpy.pi/180 alpha = zenith[0] beta = zenith[1] w_w = parm[0,:,0] w_e = parm[1,:,0] if mode==1: # Vertical and zonal calculation sinB_A = numpy.sin(beta)*numpy.cos(alpha) - numpy.sin(alpha)* numpy.cos(beta) w = -(w_w * numpy.sin(beta) - w_e * numpy.sin(alpha))/ sinB_A u = (w_w * numpy.cos(beta) - w_e * numpy.cos(alpha))/ sinB_A #Noise n0 = parm[0,:,3] n1 = parm[1,:,3] jn0_1 = numpy.nanmedian(n0) jn0_2 = numpy.nanmean(n0) jn1_1 = numpy.nanmedian(n1) jn1_2 = numpy.nanmean(n1) noise0 = jn0_2 if numpy.abs(jn0_1-jn0_2)/(jn0_1+jn0_2) <= 0.1 else jn0_1 noise1 = jn1_2 if numpy.abs(jn1_1-jn1_2)/(jn1_1+jn1_2) <= 0.1 else jn1_1 noise = noise0 + noise0 if mode == 1 else noise0 + noise1 #Power apow1 = (parm[0,:,2]/numpy.sqrt(nint))*noise0 + n0 apow2 = (parm[1,:,2]/numpy.sqrt(nint))*noise1 + n1 #SNR SNR=Detectability/ SQRT(nint) or (Pow-Noise)/Noise s_n0 = (apow1 - noise0)/noise0 s_n1 = (apow2 - noise1)/noise1 swCH0 = parm[0,:,1] swCH1 = parm[1,:,1] if mode == 1: aacf1=(1-numpy.square(tau1)*numpy.square(4*numpy.pi/jlambda*swCH0)/2)* \ numpy.exp(-4*numpy.pi/jlambda*w*tau1*1j)* \ apow1 aacf2=(1-numpy.square(tau1)*numpy.square(4*numpy.pi/jlambda*swCH1)/2)* \ numpy.exp(-4*numpy.pi/jlambda*w*tau1*1j)* \ apow2 dccf_0=numpy.zeros(nHei, dtype=complex) else: aacf1=(1-numpy.square(tau1)*numpy.square(4*numpy.pi/jlambda*swCH0)/2)* \ numpy.exp(4*numpy.pi/jlambda*w_w*tau1*1j)* \ apow1 aacf2=(1-numpy.square(tau1)*numpy.square(4*numpy.pi/jlambda*swCH1)/2)* \ numpy.exp(4*numpy.pi/jlambda*w_e*tau1*1j)* \ apow2 dccf_0=numpy.power(ccf_results[0,:,0],2)*apow1*apow2* \ numpy.exp( \ ( \ (1+1*(antenna==1))* \ (-1+2*(proc == 1))* \ ccf_results[2,:,0] \ )*1j) nsamp=len(hei) pow0 = numpy.empty(nsamp); pow0[:] = numpy.nan pow1 = numpy.empty(nsamp); pow1[:] = numpy.nan acf0 = numpy.empty(nsamp, dtype=complex); acf0[:] = numpy.nan acf1 = numpy.empty(nsamp, dtype=complex); acf1[:] = numpy.nan dccf = numpy.empty(nsamp, dtype=complex); dccf[:] = numpy.nan dop0 = numpy.empty(nsamp); dop0[:] = numpy.nan dop1 = numpy.empty(nsamp); dop1[:] = numpy.nan p_w = numpy.empty(nsamp); p_w[:] = numpy.nan p_u = numpy.empty(nsamp); p_u[:] = numpy.nan if mode == 0 or (mode == 1 and dbs_sel == 0): ih=0 while ih < nsamp-10: j=ih if numpy.isfinite(s_n0[ih]) and numpy.isfinite(s_n1[ih]): while numpy.isfinite(s_n0[j]) and numpy.isfinite(s_n1[j]): j+=1 if j > ih + 2: for k in range(ih,j): pow0[k] = apow1[k] pow1[k] = apow2[k] acf0[k] = aacf1[k] acf1[k] = aacf2[k] dccf[k] = dccf_0[k] ih = j - 1 ih+=1 else: ih=0 while ih < nsamp-10: j=ih if numpy.isfinite(s_n0[ih]): while numpy.isfinite(s_n0[j]) and j < nsamp-10: j+=1 #if j > ih + 6: if j > ih + 2: #if j > ih + 3: for k in range(ih,j): pow0[k] = apow1[k] #acf0[k] = aacf1[k] #dccf[k] = dccf_0[k] p_w[k] = w[k] dop0[k] = w_w[k] ih = j - 1 ih+=1 ih=0 while ih < nsamp-10: j=ih if numpy.isfinite(s_n1[ih]): while numpy.isfinite(s_n1[j]) and j < nsamp-10: j+=1 #if j > ih + 6: if j > ih + 2: #if j > ih + 3: for k in range(ih,j): pow1[k] = apow2[k] #acf1[k] = aacf2[k] p_u[k] = u[k] dop1[k] = w_e[k] ih = j - 1 ih+=1 acf0 = numpy.zeros(nsamp, dtype=complex) acf1 = numpy.zeros(nsamp, dtype=complex) dccf = numpy.zeros(nsamp, dtype=complex) acf0 /= pow0 acf1 /= pow1 dccf /= pow0 * pow1 if mode == 0 or (mode == 1 and dbs_sel == 0): sno=(pow0+pow1-noise)/noise # First parameter: Signal to noise ratio and its error sno=numpy.log10(sno) dsno=1.0/numpy.sqrt(nint*navg)*(1+1/sno) # Second parameter: Vertical Drifts s=numpy.sqrt(numpy.abs(acf0)*numpy.abs(acf1)) ind=numpy.where(numpy.abs(s)>=1.0) if numpy.size(ind)>0: s[ind]=numpy.sqrt(0.9999) sp=s*(1.0 + 1.0/sno) vzo=-numpy.arctan2(numpy.imag(acf0+acf1),numpy.real(acf0+acf1))* \ 1.5e5*1.5/(nipp*numpy.pi) dvzo=numpy.sqrt(1-sp*sp)*0.338*1.5e5/(numpy.sqrt(nint*navg)*sp*nipp) ind=numpy.where(dvzo<=0.1) if numpy.size(ind)>0: dvzo[ind]=0.1 # Third parameter: Zonal Drifts dt=nint*nipp/1.5e5 ss=numpy.sqrt(numpy.abs(dccf)) ind=numpy.where(ss>=1.0) if numpy.size(ind)>0: ss[ind]=numpy.sqrt(0.99999) ind=numpy.where(ss<=0.1) if numpy.size(ind)>0: ss[ind]=numpy.sqrt(0.1) vxo=numpy.arctan2(numpy.imag(dccf),numpy.real(dccf))*hei*1e3/(kd*dt) dvxo=numpy.sqrt(1.0-ss*ss)*hei*1e3/(numpy.sqrt(nint*navg)*ss*kd*dt) ind=numpy.where(dvxo<=0.1) if numpy.size(ind)>0: dvxo[ind]=0.1 else: sno0=(pow0-noise0)/noise0 sno1=(pow1-noise1)/noise1 # First parameter: Signal to noise ratio and its error sno0=numpy.log10(sno0) dsno0=1.0/numpy.sqrt(nint*navg)*(1+1/sno0) sno1=numpy.log10(sno1) dsno1=1.0/numpy.sqrt(nint*navg)*(1+1/sno1) npar=6 par = numpy.empty((npar, nHei)); par[:] = numpy.nan if mode == 0: par[0,:] = sno par[1,:] = vxo par[2,:] = dvxo par[3,:] = vzo par[4,:] = dvzo elif mode == 1 and dbs_sel == 0: par[0,:] = sno par[1,:] = vzo else: par[0,:] = sno0 par[1,:] = sno1 par[2,:] = dop0 par[3,:] = dop1 #par[4,:] = p_w #par[5,:] = p_u if mode == 0: winds = numpy.vstack((par[0,:], par[1,:], par[2,:], par[3,:], par[4,:])) elif mode == 1 and dbs_sel == 0: winds = numpy.vstack((par[0,:], par[1,:])) else: winds = numpy.vstack((par[0,:], par[1,:], par[2,:], par[3,:])) dataOut.data_output = winds dataOut.data_snr = par[0,:] dataOut.utctimeInit = dataOut.utctime dataOut.outputInterval = dataOut.timeInterval aux1= numpy.all(numpy.isnan(dataOut.data_output[0])) # NAN vectors are not written aux2= numpy.all(numpy.isnan(dataOut.data_output[1])) # NAN vectors are not written dataOut.flagNoData = aux1 or aux2 return dataOut class SALags(Operation): ''' Function GetMoments() Input: self.dataOut.data_pre self.dataOut.abscissaList self.dataOut.noise self.dataOut.normFactor self.dataOut.data_snr self.dataOut.groupList self.dataOut.nChannels Affected: self.dataOut.data_param ''' def run(self, dataOut): data_acf = dataOut.data_pre[0] data_ccf = dataOut.data_pre[1] normFactor_acf = dataOut.normFactor[0] normFactor_ccf = dataOut.normFactor[1] pairs_acf = dataOut.groupList[0] pairs_ccf = dataOut.groupList[1] nHeights = dataOut.nHeights absc = dataOut.abscissaList noise = dataOut.noise SNR = dataOut.data_snr nChannels = dataOut.nChannels # pairsList = dataOut.groupList # pairsAutoCorr, pairsCrossCorr = self.__getPairsAutoCorr(pairsList, nChannels) for l in range(len(pairs_acf)): data_acf[l,:,:] = data_acf[l,:,:]/normFactor_acf[l,:] for l in range(len(pairs_ccf)): data_ccf[l,:,:] = data_ccf[l,:,:]/normFactor_ccf[l,:] dataOut.data_param = numpy.zeros((len(pairs_ccf)*2 + 1, nHeights)) dataOut.data_param[:-1,:] = self.__calculateTaus(data_acf, data_ccf, absc) dataOut.data_param[-1,:] = self.__calculateLag1Phase(data_acf, absc) return # def __getPairsAutoCorr(self, pairsList, nChannels): # # pairsAutoCorr = numpy.zeros(nChannels, dtype = 'int')*numpy.nan # # for l in range(len(pairsList)): # firstChannel = pairsList[l][0] # secondChannel = pairsList[l][1] # # #Obteniendo pares de Autocorrelacion # if firstChannel == secondChannel: # pairsAutoCorr[firstChannel] = int(l) # # pairsAutoCorr = pairsAutoCorr.astype(int) # # pairsCrossCorr = range(len(pairsList)) # pairsCrossCorr = numpy.delete(pairsCrossCorr,pairsAutoCorr) # # return pairsAutoCorr, pairsCrossCorr def __calculateTaus(self, data_acf, data_ccf, lagRange): lag0 = data_acf.shape[1]/2 #Funcion de Autocorrelacion mean_acf = stats.nanmean(data_acf, axis = 0) #Obtencion Indice de TauCross ind_ccf = data_ccf.argmax(axis = 1) #Obtencion Indice de TauAuto ind_acf = numpy.zeros(ind_ccf.shape,dtype = 'int') ccf_lag0 = data_ccf[:,lag0,:] for i in range(ccf_lag0.shape[0]): ind_acf[i,:] = numpy.abs(mean_acf - ccf_lag0[i,:]).argmin(axis = 0) #Obtencion de TauCross y TauAuto tau_ccf = lagRange[ind_ccf] tau_acf = lagRange[ind_acf] Nan1, Nan2 = numpy.where(tau_ccf == lagRange[0]) tau_ccf[Nan1,Nan2] = numpy.nan tau_acf[Nan1,Nan2] = numpy.nan tau = numpy.vstack((tau_ccf,tau_acf)) return tau def __calculateLag1Phase(self, data, lagTRange): data1 = stats.nanmean(data, axis = 0) lag1 = numpy.where(lagTRange == 0)[0][0] + 1 phase = numpy.angle(data1[lag1,:]) return phase def fit_func( x, a0, a1, a2): #, a3, a4, a5): z = (x - a1) / a2 y = a0 * numpy.exp(-z**2 / a2) #+ a3 + a4 * x + a5 * x**2 return y class SpectralFitting(Operation): ''' Function GetMoments() Input: Output: Variables modified: ''' def __calculateMoments(self, oldspec, oldfreq, n0, nicoh = None, graph = None, smooth = None, type1 = None, fwindow = None, snrth = None, dc = None, aliasing = None, oldfd = None, wwauto = None): if (nicoh is None): nicoh = 1 if (graph is None): graph = 0 if (smooth is None): smooth = 0 elif (self.smooth < 3): smooth = 0 if (type1 is None): type1 = 0 if (fwindow is None): fwindow = numpy.zeros(oldfreq.size) + 1 if (snrth is None): snrth = -3 if (dc is None): dc = 0 if (aliasing is None): aliasing = 0 if (oldfd is None): oldfd = 0 if (wwauto is None): wwauto = 0 if (n0 < 1.e-20): n0 = 1.e-20 freq = oldfreq vec_power = numpy.zeros(oldspec.shape[1]) vec_fd = numpy.zeros(oldspec.shape[1]) vec_w = numpy.zeros(oldspec.shape[1]) vec_snr = numpy.zeros(oldspec.shape[1]) oldspec = numpy.ma.masked_invalid(oldspec) for ind in range(oldspec.shape[1]): spec = oldspec[:,ind] aux = spec*fwindow max_spec = aux.max() m = list(aux).index(max_spec) #Smooth if (smooth == 0): spec2 = spec else: spec2 = scipy.ndimage.filters.uniform_filter1d(spec,size=smooth) # Calculo de Momentos bb = spec2[list(range(m,spec2.size))] bb = (bb m): ss1 = m valid = numpy.asarray(list(range(int(m + bb0 - ss1 + 1)))) + ss1 power = ((spec2[valid] - n0)*fwindow[valid]).sum() fd = ((spec2[valid]- n0)*freq[valid]*fwindow[valid]).sum()/power w = math.sqrt(((spec2[valid] - n0)*fwindow[valid]*(freq[valid]- fd)**2).sum()/power) snr = (spec2.mean()-n0)/n0 if (snr < 1.e-20) : snr = 1.e-20 vec_power[ind] = power vec_fd[ind] = fd vec_w[ind] = w vec_snr[ind] = snr moments = numpy.vstack((vec_snr, vec_power, vec_fd, vec_w)) return moments #def __DiffCoherent(self,snrth, spectra, cspectra, nProf, heights,nChan, nHei, nPairs, channels, noise, crosspairs): def __DiffCoherent(self, spectra, cspectra, dataOut, noise, snrth, coh_th, hei_th): import matplotlib.pyplot as plt nProf = dataOut.nProfiles heights = dataOut.heightList nHei = len(heights) channels = dataOut.channelList nChan = len(channels) crosspairs = dataOut.groupList nPairs = len(crosspairs) #Separar espectros incoherentes de coherentes snr > 20 dB' snr_th = 10**(snrth/10.0) my_incoh_spectra = numpy.zeros([nChan, nProf,nHei], dtype='float') my_incoh_cspectra = numpy.zeros([nPairs,nProf, nHei], dtype='complex') my_incoh_aver = numpy.zeros([nChan, nHei]) my_coh_aver = numpy.zeros([nChan, nHei]) coh_spectra = numpy.zeros([nChan, nProf, nHei], dtype='float') coh_cspectra = numpy.zeros([nPairs, nProf, nHei], dtype='complex') coh_aver = numpy.zeros([nChan, nHei]) incoh_spectra = numpy.zeros([nChan, nProf, nHei], dtype='float') incoh_cspectra = numpy.zeros([nPairs, nProf, nHei], dtype='complex') incoh_aver = numpy.zeros([nChan, nHei]) power = numpy.sum(spectra, axis=1) if coh_th == None : coh_th = numpy.array([0.75,0.65,0.15]) # 0.65 if hei_th == None : hei_th = numpy.array([60,300,650]) for ic in range(2): pair = crosspairs[ic] #si el SNR es mayor que el SNR threshold los datos se toman coherentes s_n0 = power[pair[0],:]/noise[pair[0]] s_n1 = power[pair[1],:]/noise[pair[1]] valid1 =(s_n0>=snr_th).nonzero() valid2 = (s_n1>=snr_th).nonzero() #valid = valid2 + valid1 #numpy.concatenate((valid1,valid2), axis=None) valid1 = numpy.array(valid1[0]) valid2 = numpy.array(valid2[0]) valid = valid1 for iv in range(len(valid2)): #for ivv in range(len(valid1)) : indv = numpy.array((valid1 == valid2[iv]).nonzero()) if len(indv[0]) == 0 : valid = numpy.concatenate((valid,valid2[iv]), axis=None) if len(valid)>0: my_coh_aver[pair[0],valid]=1 my_coh_aver[pair[1],valid]=1 # si la coherencia es mayor a la coherencia threshold los datos se toman #print my_coh_aver[0,:] coh = numpy.squeeze(numpy.nansum(cspectra[ic,:,:], axis=0)/numpy.sqrt(numpy.nansum(spectra[pair[0],:,:], axis=0)*numpy.nansum(spectra[pair[1],:,:], axis=0))) #print('coh',numpy.absolute(coh)) for ih in range(len(hei_th)): hvalid = (heights>hei_th[ih]).nonzero() hvalid = hvalid[0] if len(hvalid)>0: valid = (numpy.absolute(coh[hvalid])>coh_th[ih]).nonzero() valid = valid[0] #print('hvalid:',hvalid) #print('valid', valid) if len(valid)>0: my_coh_aver[pair[0],hvalid[valid]] =1 my_coh_aver[pair[1],hvalid[valid]] =1 coh_echoes = (my_coh_aver[pair[0],:] == 1).nonzero() incoh_echoes = (my_coh_aver[pair[0],:] != 1).nonzero() incoh_echoes = incoh_echoes[0] if len(incoh_echoes) > 0: my_incoh_spectra[pair[0],:,incoh_echoes] = spectra[pair[0],:,incoh_echoes] my_incoh_spectra[pair[1],:,incoh_echoes] = spectra[pair[1],:,incoh_echoes] my_incoh_cspectra[ic,:,incoh_echoes] = cspectra[ic,:,incoh_echoes] my_incoh_aver[pair[0],incoh_echoes] = 1 my_incoh_aver[pair[1],incoh_echoes] = 1 for ic in range(2): pair = crosspairs[ic] valid1 =(my_coh_aver[pair[0],:]==1 ).nonzero() valid2 = (my_coh_aver[pair[1],:]==1).nonzero() valid1 = numpy.array(valid1[0]) valid2 = numpy.array(valid2[0]) valid = valid1 #print valid1 , valid2 for iv in range(len(valid2)): #for ivv in range(len(valid1)) : indv = numpy.array((valid1 == valid2[iv]).nonzero()) if len(indv[0]) == 0 : valid = numpy.concatenate((valid,valid2[iv]), axis=None) #print valid #valid = numpy.concatenate((valid1,valid2), axis=None) valid1 =(my_coh_aver[pair[0],:] !=1 ).nonzero() valid2 = (my_coh_aver[pair[1],:] !=1).nonzero() valid1 = numpy.array(valid1[0]) valid2 = numpy.array(valid2[0]) incoh_echoes = valid1 #print valid1, valid2 #incoh_echoes= numpy.concatenate((valid1,valid2), axis=None) for iv in range(len(valid2)): #for ivv in range(len(valid1)) : indv = numpy.array((valid1 == valid2[iv]).nonzero()) if len(indv[0]) == 0 : incoh_echoes = numpy.concatenate(( incoh_echoes,valid2[iv]), axis=None) #print incoh_echoes if len(valid)>0: #print pair coh_spectra[pair[0],:,valid] = spectra[pair[0],:,valid] coh_spectra[pair[1],:,valid] = spectra[pair[1],:,valid] coh_cspectra[ic,:,valid] = cspectra[ic,:,valid] coh_aver[pair[0],valid]=1 coh_aver[pair[1],valid]=1 if len(incoh_echoes)>0: incoh_spectra[pair[0],:,incoh_echoes] = spectra[pair[0],:,incoh_echoes] incoh_spectra[pair[1],:,incoh_echoes] = spectra[pair[1],:,incoh_echoes] incoh_cspectra[ic,:,incoh_echoes] = cspectra[ic,:,incoh_echoes] incoh_aver[pair[0],incoh_echoes]=1 incoh_aver[pair[1],incoh_echoes]=1 #plt.imshow(spectra[0,:,:],vmin=20000000) #plt.show() #my_incoh_aver = my_incoh_aver+1 #spec = my_incoh_spectra.copy() #cspec = my_incoh_cspectra.copy() #print('######################', spec) #print(self.numpy) #return spec, cspec,coh_aver return my_incoh_spectra ,my_incoh_cspectra,my_incoh_aver,my_coh_aver, incoh_spectra, coh_spectra, incoh_cspectra, coh_cspectra, incoh_aver, coh_aver def __CleanCoherent(self,snrth, spectra, cspectra, coh_aver,dataOut, noise,clean_coh_echoes,index): import matplotlib.pyplot as plt nProf = dataOut.nProfiles heights = dataOut.heightList nHei = len(heights) channels = dataOut.channelList nChan = len(channels) crosspairs = dataOut.groupList nPairs = len(crosspairs) #data = dataOut.data_pre[0] absc = dataOut.abscissaList[:-1] #noise = dataOut.noise #nChannel = data.shape[0] data_param = numpy.zeros((nChan, 4, spectra.shape[2])) #plt.plot(absc) #plt.show() clean_coh_spectra = spectra.copy() clean_coh_cspectra = cspectra.copy() clean_coh_aver = coh_aver.copy() spwd_th=[10,6] #spwd_th[0] --> For satellites ; spwd_th[1] --> For special events like SUN. coh_th = 0.75 rtime0 = [6,18] # periodo sin ESF rtime1 = [10.5,13.5] # periodo con alta coherencia y alto ancho espectral (esperado): SOL. time = index*5./60 if clean_coh_echoes == 1 : for ind in range(nChan): data_param[ind,:,:] = self.__calculateMoments( spectra[ind,:,:] , absc , noise[ind] ) #print data_param[:,3] spwd = data_param[:,3] #print spwd.shape # SPECB_JULIA,header=anal_header,jspectra=spectra,vel=velocities,hei=heights, num_aver=1, mode_fit=0,smoothing=smoothing,jvelr=velr,jspwd=spwd,jsnr=snr,jnoise=noise,jstdvnoise=stdvnoise #spwd1=[ 1.65607, 1.43416, 0.500373, 0.208361, 0.000000, 26.7767, 22.5936, 26.7530, 20.6962, 29.1098, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 28.0300, 27.0511, 27.8810, 26.3126, 27.8445, 24.6181, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000, 0.000000] #spwd=numpy.array([spwd1,spwd1,spwd1,spwd1]) #print spwd.shape, heights.shape,coh_aver.shape # para obtener spwd for ic in range(nPairs): pair = crosspairs[ic] coh = numpy.squeeze(numpy.sum(cspectra[ic,:,:], axis=1)/numpy.sqrt(numpy.sum(spectra[pair[0],:,:], axis=1)*numpy.sum(spectra[pair[1],:,:], axis=1))) for ih in range(nHei) : # Considering heights higher than 200km in order to avoid removing phenomena like EEJ. if heights[ih] >= 200 and coh_aver[pair[0],ih] == 1 and coh_aver[pair[1],ih] == 1 : # Checking coherence if (numpy.abs(coh[ih]) <= coh_th) or (time >= rtime0[0] and time <= rtime0[1]) : # Checking spectral widths if (spwd[pair[0],ih] > spwd_th[0]) or (spwd[pair[1],ih] > spwd_th[0]) : # satelite clean_coh_spectra[pair,ih,:] = 0.0 clean_coh_cspectra[ic,ih,:] = 0.0 clean_coh_aver[pair,ih] = 0 else : if ((spwd[pair[0],ih] < spwd_th[1]) or (spwd[pair[1],ih] < spwd_th[1])) : # Especial event like sun. clean_coh_spectra[pair,ih,:] = 0.0 clean_coh_cspectra[ic,ih,:] = 0.0 clean_coh_aver[pair,ih] = 0 return clean_coh_spectra, clean_coh_cspectra, clean_coh_aver isConfig = False __dataReady = False bloques = None bloque0 = None def __init__(self): Operation.__init__(self) self.i=0 self.isConfig = False def setup(self,nChan,nProf,nHei,nBlocks): self.__dataReady = False self.bloques = numpy.zeros([2, nProf, nHei,nBlocks], dtype= complex) self.bloque0 = numpy.zeros([nChan, nProf, nHei, nBlocks]) #def CleanRayleigh(self,dataOut,spectra,cspectra,out_spectra,out_cspectra,sat_spectra,sat_cspectra,crosspairs,heights, channels, nProf,nHei,nChan,nPairs,nIncohInt,nBlocks): def CleanRayleigh(self,dataOut,spectra,cspectra,save_drifts): #import matplotlib.pyplot as plt #for k in range(149): # self.bloque0[:,:,:,k] = spectra[:,:,0:nHei] # self.bloques[:,:,:,k] = cspectra[:,:,0:nHei] #if self.i==nBlocks: # self.i==0 rfunc = cspectra.copy() #self.bloques n_funct = len(rfunc[0,:,0,0]) val_spc = spectra*0.0 #self.bloque0*0.0 val_cspc = cspectra*0.0 #self.bloques*0.0 in_sat_spectra = spectra.copy() #self.bloque0 in_sat_cspectra = cspectra.copy() #self.bloques #print( rfunc.shape) min_hei = 200 nProf = dataOut.nProfiles heights = dataOut.heightList nHei = len(heights) channels = dataOut.channelList nChan = len(channels) crosspairs = dataOut.groupList nPairs = len(crosspairs) hval=(heights >= min_hei).nonzero() ih=hval[0] #print numpy.absolute(rfunc[:,0,0,14]) for ih in range(hval[0][0],nHei): for ifreq in range(nProf): for ii in range(n_funct): func2clean = 10*numpy.log10(numpy.absolute(rfunc[:,ii,ifreq,ih])) #print numpy.amin(func2clean) val = (numpy.isfinite(func2clean)==True).nonzero() if len(val)>0: min_val = numpy.around(numpy.amin(func2clean)-2) #> (-40) if min_val <= -40 : min_val = -40 max_val = numpy.around(numpy.amax(func2clean)+2) #< 200 if max_val >= 200 : max_val = 200 #print min_val, max_val step = 1 #Getting bins and the histogram x_dist = min_val + numpy.arange(1 + ((max_val-(min_val))/step))*step y_dist,binstep = numpy.histogram(func2clean,bins=range(int(min_val),int(max_val+2),step)) mean = numpy.sum(x_dist * y_dist) / numpy.sum(y_dist) sigma = numpy.sqrt(numpy.sum(y_dist * (x_dist - mean)**2) / numpy.sum(y_dist)) parg = [numpy.amax(y_dist),mean,sigma] try : gauss_fit, covariance = curve_fit(fit_func, x_dist, y_dist,p0=parg) mode = gauss_fit[1] stdv = gauss_fit[2] except: mode = mean stdv = sigma # if ih == 14 and ii == 0 and ifreq ==0 : # print x_dist.shape, y_dist.shape # print x_dist, y_dist # print min_val, max_val, binstep # print func2clean # print mean,sigma # mean1,std = norm.fit(y_dist) # print mean1, std, gauss_fit # print fit_func(x_dist,gauss_fit[0],gauss_fit[1],gauss_fit[2]) # 7.84616 53.9307 3.61863 #stdv = 3.61863 # 2.99089 #mode = 53.9307 #7.79008 #Removing echoes greater than mode + 3*stdv factor_stdv = 2.5 noval = (abs(func2clean - mode)>=(factor_stdv*stdv)).nonzero() if len(noval[0]) > 0: novall = ((func2clean - mode) >= (factor_stdv*stdv)).nonzero() cross_pairs = crosspairs[ii] #Getting coherent echoes which are removed. if len(novall[0]) > 0: #val_spc[(0,1),novall[a],ih] = 1 #val_spc[,(2,3),novall[a],ih] = 1 val_spc[novall[0],cross_pairs[0],ifreq,ih] = 1 val_spc[novall[0],cross_pairs[1],ifreq,ih] = 1 val_cspc[novall[0],ii,ifreq,ih] = 1 #print("OUT NOVALL 1") #Removing coherent from ISR data # if ih == 17 and ii == 0 and ifreq ==0 : # print spectra[:,cross_pairs[0],ifreq,ih] spectra[noval,cross_pairs[0],ifreq,ih] = numpy.nan spectra[noval,cross_pairs[1],ifreq,ih] = numpy.nan cspectra[noval,ii,ifreq,ih] = numpy.nan # if ih == 17 and ii == 0 and ifreq ==0 : # print spectra[:,cross_pairs[0],ifreq,ih] # print noval, len(noval[0]) # print novall, len(novall[0]) # print factor_stdv*stdv # print func2clean-mode # print val_spc[:,cross_pairs[0],ifreq,ih] # print spectra[:,cross_pairs[0],ifreq,ih] #no sale es para savedrifts >2 ''' channels = channels cross_pairs = cross_pairs #print("OUT NOVALL 2") vcross0 = (cross_pairs[0] == channels[ii]).nonzero() vcross1 = (cross_pairs[1] == channels[ii]).nonzero() vcross = numpy.concatenate((vcross0,vcross1),axis=None) #print('vcros =', vcross) #Getting coherent echoes which are removed. if len(novall) > 0: #val_spc[novall,ii,ifreq,ih] = 1 val_spc[ii,ifreq,ih,novall] = 1 if len(vcross) > 0: val_cspc[vcross,ifreq,ih,novall] = 1 #Removing coherent from ISR data. self.bloque0[ii,ifreq,ih,noval] = numpy.nan if len(vcross) > 0: self.bloques[vcross,ifreq,ih,noval] = numpy.nan ''' #Getting average of the spectra and cross-spectra from incoherent echoes. out_spectra = numpy.zeros([nChan,nProf,nHei], dtype=float) #+numpy.nan out_cspectra = numpy.zeros([nPairs,nProf,nHei], dtype=complex) #+numpy.nan for ih in range(nHei): for ifreq in range(nProf): for ich in range(nChan): tmp = spectra[:,ich,ifreq,ih] valid = (numpy.isfinite(tmp[:])==True).nonzero() # if ich == 0 and ifreq == 0 and ih == 17 : # print tmp # print valid # print len(valid[0]) #print('TMP',tmp) if len(valid[0]) >0 : out_spectra[ich,ifreq,ih] = numpy.nansum(tmp)/len(valid[0]) #for icr in range(nPairs): for icr in range(nPairs): tmp = numpy.squeeze(cspectra[:,icr,ifreq,ih]) valid = (numpy.isfinite(tmp)==True).nonzero() if len(valid[0]) > 0: out_cspectra[icr,ifreq,ih] = numpy.nansum(tmp)/len(valid[0]) # print('##########################################################') #Removing fake coherent echoes (at least 4 points around the point) val_spectra = numpy.sum(val_spc,0) val_cspectra = numpy.sum(val_cspc,0) val_spectra = self.REM_ISOLATED_POINTS(val_spectra,4) val_cspectra = self.REM_ISOLATED_POINTS(val_cspectra,4) for i in range(nChan): for j in range(nProf): for k in range(nHei): if numpy.isfinite(val_spectra[i,j,k]) and val_spectra[i,j,k] < 1 : val_spc[:,i,j,k] = 0.0 for i in range(nPairs): for j in range(nProf): for k in range(nHei): if numpy.isfinite(val_cspectra[i,j,k]) and val_cspectra[i,j,k] < 1 : val_cspc[:,i,j,k] = 0.0 # val_spc = numpy.reshape(val_spc, (len(spectra[:,0,0,0]),nProf*nHei*nChan)) # if numpy.isfinite(val_spectra)==str(True): # noval = (val_spectra<1).nonzero() # if len(noval) > 0: # val_spc[:,noval] = 0.0 # val_spc = numpy.reshape(val_spc, (149,nChan,nProf,nHei)) #val_cspc = numpy.reshape(val_spc, (149,nChan*nHei*nProf)) #if numpy.isfinite(val_cspectra)==str(True): # noval = (val_cspectra<1).nonzero() # if len(noval) > 0: # val_cspc[:,noval] = 0.0 # val_cspc = numpy.reshape(val_cspc, (149,nChan,nProf,nHei)) tmp_sat_spectra = spectra.copy() tmp_sat_spectra = tmp_sat_spectra*numpy.nan tmp_sat_cspectra = cspectra.copy() tmp_sat_cspectra = tmp_sat_cspectra*numpy.nan # fig = plt.figure(figsize=(6,5)) # left, bottom, width, height = 0.1, 0.1, 0.8, 0.8 # ax = fig.add_axes([left, bottom, width, height]) # cp = ax.contour(10*numpy.log10(numpy.absolute(spectra[0,0,:,:]))) # ax.clabel(cp, inline=True,fontsize=10) # plt.show() val = (val_spc > 0).nonzero() if len(val[0]) > 0: tmp_sat_spectra[val] = in_sat_spectra[val] val = (val_cspc > 0).nonzero() if len(val[0]) > 0: tmp_sat_cspectra[val] = in_sat_cspectra[val] #Getting average of the spectra and cross-spectra from incoherent echoes. sat_spectra = numpy.zeros((nChan,nProf,nHei), dtype=float) sat_cspectra = numpy.zeros((nPairs,nProf,nHei), dtype=complex) for ih in range(nHei): for ifreq in range(nProf): for ich in range(nChan): tmp = numpy.squeeze(tmp_sat_spectra[:,ich,ifreq,ih]) valid = (numpy.isfinite(tmp)).nonzero() if len(valid[0]) > 0: sat_spectra[ich,ifreq,ih] = numpy.nansum(tmp)/len(valid[0]) for icr in range(nPairs): tmp = numpy.squeeze(tmp_sat_cspectra[:,icr,ifreq,ih]) valid = (numpy.isfinite(tmp)).nonzero() if len(valid[0]) > 0: sat_cspectra[icr,ifreq,ih] = numpy.nansum(tmp)/len(valid[0]) #self.__dataReady= True #sat_spectra, sat_cspectra= sat_spectra, sat_cspectra #if not self.__dataReady: #return None, None return out_spectra, out_cspectra,sat_spectra,sat_cspectra def REM_ISOLATED_POINTS(self,array,rth): # import matplotlib.pyplot as plt if rth == None : rth = 4 num_prof = len(array[0,:,0]) num_hei = len(array[0,0,:]) n2d = len(array[:,0,0]) for ii in range(n2d) : #print ii,n2d tmp = array[ii,:,:] #print tmp.shape, array[ii,101,:],array[ii,102,:] # fig = plt.figure(figsize=(6,5)) # left, bottom, width, height = 0.1, 0.1, 0.8, 0.8 # ax = fig.add_axes([left, bottom, width, height]) # x = range(num_prof) # y = range(num_hei) # cp = ax.contour(y,x,tmp) # ax.clabel(cp, inline=True,fontsize=10) # plt.show() #indxs = WHERE(FINITE(tmp) AND tmp GT 0,cindxs) tmp = numpy.reshape(tmp,num_prof*num_hei) indxs1 = (numpy.isfinite(tmp)==True).nonzero() indxs2 = (tmp > 0).nonzero() indxs1 = (indxs1[0]) indxs2 = indxs2[0] #indxs1 = numpy.array(indxs1[0]) #indxs2 = numpy.array(indxs2[0]) indxs = None #print indxs1 , indxs2 for iv in range(len(indxs2)): indv = numpy.array((indxs1 == indxs2[iv]).nonzero()) #print len(indxs2), indv if len(indv[0]) > 0 : indxs = numpy.concatenate((indxs,indxs2[iv]), axis=None) # print indxs indxs = indxs[1:] #print indxs, len(indxs) if len(indxs) < 4 : array[ii,:,:] = 0. return xpos = numpy.mod(indxs ,num_hei) ypos = (indxs / num_hei) sx = numpy.argsort(xpos) # Ordering respect to "x" (time) #print sx xpos = xpos[sx] ypos = ypos[sx] # *********************************** Cleaning isolated points ********************************** ic = 0 while True : r = numpy.sqrt(list(numpy.power((xpos[ic]-xpos),2)+ numpy.power((ypos[ic]-ypos),2))) #no_coh = WHERE(FINITE(r) AND (r LE rth),cno_coh) #plt.plot(r) #plt.show() no_coh1 = (numpy.isfinite(r)==True).nonzero() no_coh2 = (r <= rth).nonzero() #print r, no_coh1, no_coh2 no_coh1 = numpy.array(no_coh1[0]) no_coh2 = numpy.array(no_coh2[0]) no_coh = None #print valid1 , valid2 for iv in range(len(no_coh2)): indv = numpy.array((no_coh1 == no_coh2[iv]).nonzero()) if len(indv[0]) > 0 : no_coh = numpy.concatenate((no_coh,no_coh2[iv]), axis=None) no_coh = no_coh[1:] #print len(no_coh), no_coh if len(no_coh) < 4 : #print xpos[ic], ypos[ic], ic # plt.plot(r) # plt.show() xpos[ic] = numpy.nan ypos[ic] = numpy.nan ic = ic + 1 if (ic == len(indxs)) : break #print( xpos, ypos) indxs = (numpy.isfinite(list(xpos))==True).nonzero() #print indxs[0] if len(indxs[0]) < 4 : array[ii,:,:] = 0. return xpos = xpos[indxs[0]] ypos = ypos[indxs[0]] for i in range(0,len(ypos)): ypos[i]=int(ypos[i]) junk = tmp tmp = junk*0.0 tmp[list(xpos + (ypos*num_hei))] = junk[list(xpos + (ypos*num_hei))] array[ii,:,:] = numpy.reshape(tmp,(num_prof,num_hei)) #print array.shape #tmp = numpy.reshape(tmp,(num_prof,num_hei)) #print tmp.shape # fig = plt.figure(figsize=(6,5)) # left, bottom, width, height = 0.1, 0.1, 0.8, 0.8 # ax = fig.add_axes([left, bottom, width, height]) # x = range(num_prof) # y = range(num_hei) # cp = ax.contour(y,x,array[ii,:,:]) # ax.clabel(cp, inline=True,fontsize=10) # plt.show() return array def moments(self,doppler,yarray,npoints): ytemp = yarray #val = WHERE(ytemp GT 0,cval) #if cval == 0 : val = range(npoints-1) val = (ytemp > 0).nonzero() val = val[0] #print('hvalid:',hvalid) #print('valid', valid) if len(val) == 0 : val = range(npoints-1) ynew = 0.5*(ytemp[val[0]]+ytemp[val[len(val)-1]]) ytemp[len(ytemp):] = [ynew] index = 0 index = numpy.argmax(ytemp) ytemp = numpy.roll(ytemp,int(npoints/2)-1-index) ytemp = ytemp[0:npoints-1] fmom = numpy.sum(doppler*ytemp)/numpy.sum(ytemp)+(index-(npoints/2-1))*numpy.abs(doppler[1]-doppler[0]) smom = numpy.sum(doppler*doppler*ytemp)/numpy.sum(ytemp) return [fmom,numpy.sqrt(smom)] # ********************************************************************************************** index = 0 fint = 0 buffer = 0 buffer2 = 0 buffer3 = 0 def run(self, dataOut, getSNR = True, path=None, file=None, groupList=None): nChannels = dataOut.nChannels nHeights= dataOut.heightList.size nProf = dataOut.nProfiles tini=time.localtime(dataOut.utctime) if (tini.tm_min % 5) == 0 and (tini.tm_sec < 5 and self.fint==0): # print tini.tm_min self.index = 0 jspc = self.buffer jcspc = self.buffer2 jnoise = self.buffer3 self.buffer = dataOut.data_spc self.buffer2 = dataOut.data_cspc self.buffer3 = dataOut.noise self.fint = 1 if numpy.any(jspc) : jspc= numpy.reshape(jspc,(int(len(jspc)/4),nChannels,nProf,nHeights)) jcspc= numpy.reshape(jcspc,(int(len(jcspc)/2),2,nProf,nHeights)) jnoise= numpy.reshape(jnoise,(int(len(jnoise)/4),nChannels)) else: dataOut.flagNoData = True return dataOut else : if (tini.tm_min % 5) == 0 : self.fint = 1 else : self.fint = 0 self.index += 1 if numpy.any(self.buffer): self.buffer = numpy.concatenate((self.buffer,dataOut.data_spc), axis=0) self.buffer2 = numpy.concatenate((self.buffer2,dataOut.data_cspc), axis=0) self.buffer3 = numpy.concatenate((self.buffer3,dataOut.noise), axis=0) else: self.buffer = dataOut.data_spc self.buffer2 = dataOut.data_cspc self.buffer3 = dataOut.noise dataOut.flagNoData = True return dataOut if path != None: sys.path.append(path) self.library = importlib.import_module(file) #To be inserted as a parameter groupArray = numpy.array(groupList) #groupArray = numpy.array([[0,1],[2,3]]) dataOut.groupList = groupArray nGroups = groupArray.shape[0] nChannels = dataOut.nChannels nHeights = dataOut.heightList.size #Parameters Array dataOut.data_param = None dataOut.data_paramC = None #Set constants constants = self.library.setConstants(dataOut) dataOut.constants = constants M = dataOut.normFactor N = dataOut.nFFTPoints ippSeconds = dataOut.ippSeconds K = dataOut.nIncohInt pairsArray = numpy.array(dataOut.pairsList) snrth= 20 spectra = dataOut.data_spc cspectra = dataOut.data_cspc nProf = dataOut.nProfiles heights = dataOut.heightList nHei = len(heights) channels = dataOut.channelList nChan = len(channels) nIncohInt = dataOut.nIncohInt crosspairs = dataOut.groupList noise = dataOut.noise jnoise = jnoise/N noise = numpy.nansum(jnoise,axis=0)#/len(jnoise) power = numpy.sum(spectra, axis=1) nPairs = len(crosspairs) absc = dataOut.abscissaList[:-1] if not self.isConfig: self.isConfig = True index = tini.tm_hour*12+tini.tm_min/5 jspc = jspc/N/N jcspc = jcspc/N/N tmp_spectra,tmp_cspectra,sat_spectra,sat_cspectra = self.CleanRayleigh(dataOut,jspc,jcspc,2) jspectra = tmp_spectra*len(jspc[:,0,0,0]) jcspectra = tmp_cspectra*len(jspc[:,0,0,0]) my_incoh_spectra ,my_incoh_cspectra,my_incoh_aver,my_coh_aver, incoh_spectra, coh_spectra, incoh_cspectra, coh_cspectra, incoh_aver, coh_aver = self.__DiffCoherent(jspectra, jcspectra, dataOut, noise, snrth, None, None) clean_coh_spectra, clean_coh_cspectra, clean_coh_aver = self.__CleanCoherent(snrth, coh_spectra, coh_cspectra, coh_aver, dataOut, noise,1,index) dataOut.data_spc = incoh_spectra dataOut.data_cspc = incoh_cspectra clean_num_aver = incoh_aver*len(jspc[:,0,0,0]) coh_num_aver = clean_coh_aver*len(jspc[:,0,0,0]) #List of possible combinations listComb = itertools.combinations(numpy.arange(groupArray.shape[1]),2) indCross = numpy.zeros(len(list(listComb)), dtype = 'int') if getSNR: listChannels = groupArray.reshape((groupArray.size)) listChannels.sort() dataOut.data_SNR = self.__getSNR(dataOut.data_spc[listChannels,:,:], noise[listChannels]) if dataOut.data_paramC is None: dataOut.data_paramC = numpy.zeros((nGroups*4, nHeights,2))*numpy.nan for i in range(nGroups): coord = groupArray[i,:] #Input data array data = dataOut.data_spc[coord,:,:]/(M*N) data = data.reshape((data.shape[0]*data.shape[1],data.shape[2])) #Cross Spectra data array for Covariance Matrixes ind = 0 for pairs in listComb: pairsSel = numpy.array([coord[x],coord[y]]) indCross[ind] = int(numpy.where(numpy.all(pairsArray == pairsSel, axis = 1))[0][0]) ind += 1 dataCross = dataOut.data_cspc[indCross,:,:]/(M*N) dataCross = dataCross**2 nhei = nHeights poweri = numpy.sum(dataOut.data_spc[:,1:nProf-0,:],axis=1)/clean_num_aver[:,:] if i == 0 : my_noises = numpy.zeros(4,dtype=float) #FLTARR(4) n0i = numpy.nanmin(poweri[0+i*2,0:nhei-0])/(nProf-1) n1i = numpy.nanmin(poweri[1+i*2,0:nhei-0])/(nProf-1) n0 = n0i n1= n1i my_noises[2*i+0] = n0 my_noises[2*i+1] = n1 snrth = -16.0 snrth = 10**(snrth/10.0) for h in range(nHeights): d = data[:,h] smooth = clean_num_aver[i+1,h] #dataOut.data_spc[:,1:nProf-0,:] signalpn0 = (dataOut.data_spc[i*2,1:(nProf-0),h])/smooth signalpn1 = (dataOut.data_spc[i*2+1,1:(nProf-0),h])/smooth signal0 = signalpn0-n0 signal1 = signalpn1-n1 snr0 = numpy.sum(signal0/n0)/(nProf-1) snr1 = numpy.sum(signal1/n1)/(nProf-1) if snr0 > snrth and snr1 > snrth and clean_num_aver[i+1,h] > 0 : #Covariance Matrix D = numpy.diag(d**2) ind = 0 for pairs in listComb: #Coordinates in Covariance Matrix x = pairs[0] y = pairs[1] #Channel Index S12 = dataCross[ind,:,h] D12 = numpy.diag(S12) #Completing Covariance Matrix with Cross Spectras D[x*N:(x+1)*N,y*N:(y+1)*N] = D12 D[y*N:(y+1)*N,x*N:(x+1)*N] = D12 ind += 1 diagD = numpy.zeros(256) if h == 17 : for ii in range(256): diagD[ii] = D[ii,ii] #Dinv=numpy.linalg.inv(D) #L=numpy.linalg.cholesky(Dinv) try: Dinv=numpy.linalg.inv(D) L=numpy.linalg.cholesky(Dinv) except: Dinv = D*numpy.nan L= D*numpy.nan LT=L.T dp = numpy.dot(LT,d) #Initial values data_spc = dataOut.data_spc[coord,:,h] if (h>0)and(error1[3]<5): p0 = dataOut.data_param[i,:,h-1] else: p0 = numpy.array(self.library.initialValuesFunction(data_spc, constants))# sin el i(data_spc, constants, i) try: #Least Squares #print (dp,LT,constants) #value =self.__residFunction(p0,dp,LT,constants) #print ("valueREADY",value.shape, type(value)) #optimize.leastsq(value) minp,covp,infodict,mesg,ier = optimize.leastsq(self.__residFunction,p0,args=(dp,LT,constants),full_output=True) #minp,covp = optimize.leastsq(self.__residFunction,p0,args=(dp,LT,constants)) #Chi square error #print(minp,covp.infodict,mesg,ier) #print("REALIZA OPTIMIZ") error0 = numpy.sum(infodict['fvec']**2)/(2*N) #Error with Jacobian error1 = self.library.errorFunction(minp,constants,LT) # print self.__residFunction(p0,dp,LT, constants) # print infodict['fvec'] # print self.__residFunction(minp,dp,LT,constants) except: minp = p0*numpy.nan error0 = numpy.nan error1 = p0*numpy.nan #print ("EXCEPT 0000000000") # s_sq = (self.__residFunction(minp,dp,LT,constants)).sum()/(len(dp)-len(p0)) # covp = covp*s_sq # #print("TRY___________________________________________1") # error = [] # for ip in range(len(minp)): # try: # error.append(numpy.absolute(covp[ip][ip])**0.5) # except: # error.append( 0.00 ) else : data_spc = dataOut.data_spc[coord,:,h] p0 = numpy.array(self.library.initialValuesFunction(data_spc, constants)) minp = p0*numpy.nan error0 = numpy.nan error1 = p0*numpy.nan #Save if dataOut.data_param is None: dataOut.data_param = numpy.zeros((nGroups, p0.size, nHeights))*numpy.nan dataOut.data_error = numpy.zeros((nGroups, p0.size + 1, nHeights))*numpy.nan dataOut.data_error[i,:,h] = numpy.hstack((error0,error1)) dataOut.data_param[i,:,h] = minp for ht in range(nHeights-1) : smooth = coh_num_aver[i+1,ht] #datc[0,ht,0,beam] dataOut.data_paramC[4*i,ht,1] = smooth signalpn0 = (coh_spectra[i*2 ,1:(nProf-0),ht])/smooth #coh_spectra signalpn1 = (coh_spectra[i*2+1,1:(nProf-0),ht])/smooth #val0 = WHERE(signalpn0 > 0,cval0) val0 = (signalpn0 > 0).nonzero() val0 = val0[0] #print('hvalid:',hvalid) #print('valid', valid) if len(val0) == 0 : val0_npoints = nProf else : val0_npoints = len(val0) #val1 = WHERE(signalpn1 > 0,cval1) val1 = (signalpn1 > 0).nonzero() val1 = val1[0] if len(val1) == 0 : val1_npoints = nProf else : val1_npoints = len(val1) dataOut.data_paramC[0+4*i,ht,0] = numpy.sum((signalpn0/val0_npoints))/n0 dataOut.data_paramC[1+4*i,ht,0] = numpy.sum((signalpn1/val1_npoints))/n1 signal0 = (signalpn0-n0) # > 0 vali = (signal0 < 0).nonzero() vali = vali[0] if len(vali) > 0 : signal0[vali] = 0 signal1 = (signalpn1-n1) #> 0 vali = (signal1 < 0).nonzero() vali = vali[0] if len(vali) > 0 : signal1[vali] = 0 snr0 = numpy.sum(signal0/n0)/(nProf-1) snr1 = numpy.sum(signal1/n1)/(nProf-1) doppler = absc[1:] if snr0 >= snrth and snr1 >= snrth and smooth : signalpn0_n0 = signalpn0 signalpn0_n0[val0] = signalpn0[val0] - n0 mom0 = self.moments(doppler,signalpn0-n0,nProf) # sigtmp= numpy.transpose(numpy.tile(signalpn0, [4,1])) # momt= self.__calculateMoments( sigtmp, doppler , n0 ) signalpn1_n1 = signalpn1 signalpn1_n1[val1] = signalpn1[val1] - n1 mom1 = self.moments(doppler,signalpn1_n1,nProf) dataOut.data_paramC[2+4*i,ht,0] = (mom0[0]+mom1[0])/2. dataOut.data_paramC[3+4*i,ht,0] = (mom0[1]+mom1[1])/2. # if graph == 1 : # window, 13 # plot,doppler,signalpn0 # oplot,doppler,signalpn1,linest=1 # oplot,mom0(0)*doppler/doppler,signalpn0 # oplot,mom1(0)*doppler/doppler,signalpn1 # print,interval/12.,beam,45+ht*15,snr0,snr1,mom0(0),mom1(0),mom0(1),mom1(1) #ENDIF #ENDIF #ENDFOR End height dataOut.data_spc = jspectra if getSNR: listChannels = groupArray.reshape((groupArray.size)) listChannels.sort() dataOut.data_snr = self.__getSNR(dataOut.data_spc[listChannels,:,:], my_noises[listChannels]) return dataOut def __residFunction(self, p, dp, LT, constants): fm = self.library.modelFunction(p, constants) fmp=numpy.dot(LT,fm) return dp-fmp def __getSNR(self, z, noise): avg = numpy.average(z, axis=1) SNR = (avg.T-noise)/noise SNR = SNR.T return SNR def __chisq(self, p, chindex, hindex): #similar to Resid but calculates CHI**2 [LT,d,fm]=setupLTdfm(p,chindex,hindex) dp=numpy.dot(LT,d) fmp=numpy.dot(LT,fm) chisq=numpy.dot((dp-fmp).T,(dp-fmp)) return chisq class WindProfiler(Operation): __isConfig = False __initime = None __lastdatatime = None __integrationtime = None __buffer = None __dataReady = False __firstdata = None n = None def __init__(self): Operation.__init__(self) def __calculateCosDir(self, elev, azim): zen = (90 - elev)*numpy.pi/180 azim = azim*numpy.pi/180 cosDirX = numpy.sqrt((1-numpy.cos(zen)**2)/((1+numpy.tan(azim)**2))) cosDirY = numpy.sqrt(1-numpy.cos(zen)**2-cosDirX**2) signX = numpy.sign(numpy.cos(azim)) signY = numpy.sign(numpy.sin(azim)) cosDirX = numpy.copysign(cosDirX, signX) cosDirY = numpy.copysign(cosDirY, signY) return cosDirX, cosDirY def __calculateAngles(self, theta_x, theta_y, azimuth): dir_cosw = numpy.sqrt(1-theta_x**2-theta_y**2) zenith_arr = numpy.arccos(dir_cosw) azimuth_arr = numpy.arctan2(theta_x,theta_y) + azimuth*math.pi/180 dir_cosu = numpy.sin(azimuth_arr)*numpy.sin(zenith_arr) dir_cosv = numpy.cos(azimuth_arr)*numpy.sin(zenith_arr) return azimuth_arr, zenith_arr, dir_cosu, dir_cosv, dir_cosw def __calculateMatA(self, dir_cosu, dir_cosv, dir_cosw, horOnly): if horOnly: A = numpy.c_[dir_cosu,dir_cosv] else: A = numpy.c_[dir_cosu,dir_cosv,dir_cosw] A = numpy.asmatrix(A) A1 = numpy.linalg.inv(A.transpose()*A)*A.transpose() return A1 def __correctValues(self, heiRang, phi, velRadial, SNR): listPhi = phi.tolist() maxid = listPhi.index(max(listPhi)) minid = listPhi.index(min(listPhi)) rango = list(range(len(phi))) # rango = numpy.delete(rango,maxid) heiRang1 = heiRang*math.cos(phi[maxid]) heiRangAux = heiRang*math.cos(phi[minid]) indOut = (heiRang1 < heiRangAux[0]).nonzero() heiRang1 = numpy.delete(heiRang1,indOut) velRadial1 = numpy.zeros([len(phi),len(heiRang1)]) SNR1 = numpy.zeros([len(phi),len(heiRang1)]) for i in rango: x = heiRang*math.cos(phi[i]) y1 = velRadial[i,:] f1 = interpolate.interp1d(x,y1,kind = 'cubic') x1 = heiRang1 y11 = f1(x1) y2 = SNR[i,:] f2 = interpolate.interp1d(x,y2,kind = 'cubic') y21 = f2(x1) velRadial1[i,:] = y11 SNR1[i,:] = y21 return heiRang1, velRadial1, SNR1 def __calculateVelUVW(self, A, velRadial): #Operacion Matricial # velUVW = numpy.zeros((velRadial.shape[1],3)) # for ind in range(velRadial.shape[1]): # velUVW[ind,:] = numpy.dot(A,velRadial[:,ind]) # velUVW = velUVW.transpose() velUVW = numpy.zeros((A.shape[0],velRadial.shape[1])) velUVW[:,:] = numpy.dot(A,velRadial) return velUVW # def techniqueDBS(self, velRadial0, dirCosx, disrCosy, azimuth, correct, horizontalOnly, heiRang, SNR0): def techniqueDBS(self, kwargs): """ Function that implements Doppler Beam Swinging (DBS) technique. Input: Radial velocities, Direction cosines (x and y) of the Beam, Antenna azimuth, Direction correction (if necessary), Ranges and SNR Output: Winds estimation (Zonal, Meridional and Vertical) Parameters affected: Winds, height range, SNR """ velRadial0 = kwargs['velRadial'] heiRang = kwargs['heightList'] SNR0 = kwargs['SNR'] if 'dirCosx' in kwargs and 'dirCosy' in kwargs: theta_x = numpy.array(kwargs['dirCosx']) theta_y = numpy.array(kwargs['dirCosy']) else: elev = numpy.array(kwargs['elevation']) azim = numpy.array(kwargs['azimuth']) theta_x, theta_y = self.__calculateCosDir(elev, azim) azimuth = kwargs['correctAzimuth'] if 'horizontalOnly' in kwargs: horizontalOnly = kwargs['horizontalOnly'] else: horizontalOnly = False if 'correctFactor' in kwargs: correctFactor = kwargs['correctFactor'] else: correctFactor = 1 if 'channelList' in kwargs: channelList = kwargs['channelList'] if len(channelList) == 2: horizontalOnly = True arrayChannel = numpy.array(channelList) param = param[arrayChannel,:,:] theta_x = theta_x[arrayChannel] theta_y = theta_y[arrayChannel] azimuth_arr, zenith_arr, dir_cosu, dir_cosv, dir_cosw = self.__calculateAngles(theta_x, theta_y, azimuth) heiRang1, velRadial1, SNR1 = self.__correctValues(heiRang, zenith_arr, correctFactor*velRadial0, SNR0) A = self.__calculateMatA(dir_cosu, dir_cosv, dir_cosw, horizontalOnly) #Calculo de Componentes de la velocidad con DBS winds = self.__calculateVelUVW(A,velRadial1) return winds, heiRang1, SNR1 def __calculateDistance(self, posx, posy, pairs_ccf, azimuth = None): nPairs = len(pairs_ccf) posx = numpy.asarray(posx) posy = numpy.asarray(posy) #Rotacion Inversa para alinear con el azimuth if azimuth!= None: azimuth = azimuth*math.pi/180 posx1 = posx*math.cos(azimuth) + posy*math.sin(azimuth) posy1 = -posx*math.sin(azimuth) + posy*math.cos(azimuth) else: posx1 = posx posy1 = posy #Calculo de Distancias distx = numpy.zeros(nPairs) disty = numpy.zeros(nPairs) dist = numpy.zeros(nPairs) ang = numpy.zeros(nPairs) for i in range(nPairs): distx[i] = posx1[pairs_ccf[i][1]] - posx1[pairs_ccf[i][0]] disty[i] = posy1[pairs_ccf[i][1]] - posy1[pairs_ccf[i][0]] dist[i] = numpy.sqrt(distx[i]**2 + disty[i]**2) ang[i] = numpy.arctan2(disty[i],distx[i]) return distx, disty, dist, ang #Calculo de Matrices # nPairs = len(pairs) # ang1 = numpy.zeros((nPairs, 2, 1)) # dist1 = numpy.zeros((nPairs, 2, 1)) # # for j in range(nPairs): # dist1[j,0,0] = dist[pairs[j][0]] # dist1[j,1,0] = dist[pairs[j][1]] # ang1[j,0,0] = ang[pairs[j][0]] # ang1[j,1,0] = ang[pairs[j][1]] # # return distx,disty, dist1,ang1 def __calculateVelVer(self, phase, lagTRange, _lambda): Ts = lagTRange[1] - lagTRange[0] velW = -_lambda*phase/(4*math.pi*Ts) return velW def __calculateVelHorDir(self, dist, tau1, tau2, ang): nPairs = tau1.shape[0] nHeights = tau1.shape[1] vel = numpy.zeros((nPairs,3,nHeights)) dist1 = numpy.reshape(dist, (dist.size,1)) angCos = numpy.cos(ang) angSin = numpy.sin(ang) vel0 = dist1*tau1/(2*tau2**2) vel[:,0,:] = (vel0*angCos).sum(axis = 1) vel[:,1,:] = (vel0*angSin).sum(axis = 1) ind = numpy.where(numpy.isinf(vel)) vel[ind] = numpy.nan return vel # def __getPairsAutoCorr(self, pairsList, nChannels): # # pairsAutoCorr = numpy.zeros(nChannels, dtype = 'int')*numpy.nan # # for l in range(len(pairsList)): # firstChannel = pairsList[l][0] # secondChannel = pairsList[l][1] # # #Obteniendo pares de Autocorrelacion # if firstChannel == secondChannel: # pairsAutoCorr[firstChannel] = int(l) # # pairsAutoCorr = pairsAutoCorr.astype(int) # # pairsCrossCorr = range(len(pairsList)) # pairsCrossCorr = numpy.delete(pairsCrossCorr,pairsAutoCorr) # # return pairsAutoCorr, pairsCrossCorr # def techniqueSA(self, pairsSelected, pairsList, nChannels, tau, azimuth, _lambda, position_x, position_y, lagTRange, correctFactor): def techniqueSA(self, kwargs): """ Function that implements Spaced Antenna (SA) technique. Input: Radial velocities, Direction cosines (x and y) of the Beam, Antenna azimuth, Direction correction (if necessary), Ranges and SNR Output: Winds estimation (Zonal, Meridional and Vertical) Parameters affected: Winds """ position_x = kwargs['positionX'] position_y = kwargs['positionY'] azimuth = kwargs['azimuth'] if 'correctFactor' in kwargs: correctFactor = kwargs['correctFactor'] else: correctFactor = 1 groupList = kwargs['groupList'] pairs_ccf = groupList[1] tau = kwargs['tau'] _lambda = kwargs['_lambda'] #Cross Correlation pairs obtained # pairsAutoCorr, pairsCrossCorr = self.__getPairsAutoCorr(pairssList, nChannels) # pairsArray = numpy.array(pairsList)[pairsCrossCorr] # pairsSelArray = numpy.array(pairsSelected) # pairs = [] # # #Wind estimation pairs obtained # for i in range(pairsSelArray.shape[0]/2): # ind1 = numpy.where(numpy.all(pairsArray == pairsSelArray[2*i], axis = 1))[0][0] # ind2 = numpy.where(numpy.all(pairsArray == pairsSelArray[2*i + 1], axis = 1))[0][0] # pairs.append((ind1,ind2)) indtau = tau.shape[0]/2 tau1 = tau[:indtau,:] tau2 = tau[indtau:-1,:] # tau1 = tau1[pairs,:] # tau2 = tau2[pairs,:] phase1 = tau[-1,:] #--------------------------------------------------------------------- #Metodo Directo distx, disty, dist, ang = self.__calculateDistance(position_x, position_y, pairs_ccf,azimuth) winds = self.__calculateVelHorDir(dist, tau1, tau2, ang) winds = stats.nanmean(winds, axis=0) #--------------------------------------------------------------------- #Metodo General # distx, disty, dist = self.calculateDistance(position_x,position_y,pairsCrossCorr, pairsList, azimuth) # #Calculo Coeficientes de Funcion de Correlacion # F,G,A,B,H = self.calculateCoef(tau1,tau2,distx,disty,n) # #Calculo de Velocidades # winds = self.calculateVelUV(F,G,A,B,H) #--------------------------------------------------------------------- winds[2,:] = self.__calculateVelVer(phase1, lagTRange, _lambda) winds = correctFactor*winds return winds def __checkTime(self, currentTime, paramInterval, outputInterval): dataTime = currentTime + paramInterval deltaTime = dataTime - self.__initime if deltaTime >= outputInterval or deltaTime < 0: self.__dataReady = True return def techniqueMeteors(self, arrayMeteor, meteorThresh, heightMin, heightMax): ''' Function that implements winds estimation technique with detected meteors. Input: Detected meteors, Minimum meteor quantity to wind estimation Output: Winds estimation (Zonal and Meridional) Parameters affected: Winds ''' #Settings nInt = (heightMax - heightMin)/2 nInt = int(nInt) winds = numpy.zeros((2,nInt))*numpy.nan #Filter errors error = numpy.where(arrayMeteor[:,-1] == 0)[0] finalMeteor = arrayMeteor[error,:] #Meteor Histogram finalHeights = finalMeteor[:,2] hist = numpy.histogram(finalHeights, bins = nInt, range = (heightMin,heightMax)) nMeteorsPerI = hist[0] heightPerI = hist[1] #Sort of meteors indSort = finalHeights.argsort() finalMeteor2 = finalMeteor[indSort,:] # Calculating winds ind1 = 0 ind2 = 0 for i in range(nInt): nMet = nMeteorsPerI[i] ind1 = ind2 ind2 = ind1 + nMet meteorAux = finalMeteor2[ind1:ind2,:] if meteorAux.shape[0] >= meteorThresh: vel = meteorAux[:, 6] zen = meteorAux[:, 4]*numpy.pi/180 azim = meteorAux[:, 3]*numpy.pi/180 n = numpy.cos(zen) # m = (1 - n**2)/(1 - numpy.tan(azim)**2) # l = m*numpy.tan(azim) l = numpy.sin(zen)*numpy.sin(azim) m = numpy.sin(zen)*numpy.cos(azim) A = numpy.vstack((l, m)).transpose() A1 = numpy.dot(numpy.linalg.inv( numpy.dot(A.transpose(),A) ),A.transpose()) windsAux = numpy.dot(A1, vel) winds[0,i] = windsAux[0] winds[1,i] = windsAux[1] return winds, heightPerI[:-1] def techniqueNSM_SA(self, **kwargs): metArray = kwargs['metArray'] heightList = kwargs['heightList'] timeList = kwargs['timeList'] rx_location = kwargs['rx_location'] groupList = kwargs['groupList'] azimuth = kwargs['azimuth'] dfactor = kwargs['dfactor'] k = kwargs['k'] azimuth1, dist = self.__calculateAzimuth1(rx_location, groupList, azimuth) d = dist*dfactor #Phase calculation metArray1 = self.__getPhaseSlope(metArray, heightList, timeList) metArray1[:,-2] = metArray1[:,-2]*metArray1[:,2]*1000/(k*d[metArray1[:,1].astype(int)]) #angles into velocities velEst = numpy.zeros((heightList.size,2))*numpy.nan azimuth1 = azimuth1*numpy.pi/180 for i in range(heightList.size): h = heightList[i] indH = numpy.where((metArray1[:,2] == h)&(numpy.abs(metArray1[:,-2]) < 100))[0] metHeight = metArray1[indH,:] if metHeight.shape[0] >= 2: velAux = numpy.asmatrix(metHeight[:,-2]).T #Radial Velocities iazim = metHeight[:,1].astype(int) azimAux = numpy.asmatrix(azimuth1[iazim]).T #Azimuths A = numpy.hstack((numpy.cos(azimAux),numpy.sin(azimAux))) A = numpy.asmatrix(A) A1 = numpy.linalg.pinv(A.transpose()*A)*A.transpose() velHor = numpy.dot(A1,velAux) velEst[i,:] = numpy.squeeze(velHor) return velEst def __getPhaseSlope(self, metArray, heightList, timeList): meteorList = [] #utctime sec1 height SNR velRad ph0 ph1 ph2 coh0 coh1 coh2 #Putting back together the meteor matrix utctime = metArray[:,0] uniqueTime = numpy.unique(utctime) phaseDerThresh = 0.5 ippSeconds = timeList[1] - timeList[0] sec = numpy.where(timeList>1)[0][0] nPairs = metArray.shape[1] - 6 nHeights = len(heightList) for t in uniqueTime: metArray1 = metArray[utctime==t,:] # phaseDerThresh = numpy.pi/4 #reducir Phase thresh tmet = metArray1[:,1].astype(int) hmet = metArray1[:,2].astype(int) metPhase = numpy.zeros((nPairs, heightList.size, timeList.size - 1)) metPhase[:,:] = numpy.nan metPhase[:,hmet,tmet] = metArray1[:,6:].T #Delete short trails metBool = ~numpy.isnan(metPhase[0,:,:]) heightVect = numpy.sum(metBool, axis = 1) metBool[heightVect phaseDerThresh)) metPhase[phDerAux] = numpy.nan #--------------------------METEOR DETECTION ----------------------------------------- indMet = numpy.where(numpy.any(metBool,axis=1))[0] for p in numpy.arange(nPairs): phase = metPhase[p,:,:] phDer = metDer[p,:,:] for h in indMet: height = heightList[h] phase1 = phase[h,:] #82 phDer1 = phDer[h,:] phase1[~numpy.isnan(phase1)] = numpy.unwrap(phase1[~numpy.isnan(phase1)]) #Unwrap indValid = numpy.where(~numpy.isnan(phase1))[0] initMet = indValid[0] endMet = 0 for i in range(len(indValid)-1): #Time difference inow = indValid[i] inext = indValid[i+1] idiff = inext - inow #Phase difference phDiff = numpy.abs(phase1[inext] - phase1[inow]) if idiff>sec or phDiff>numpy.pi/4 or inext==indValid[-1]: #End of Meteor sizeTrail = inow - initMet + 1 if sizeTrail>3*sec: #Too short meteors x = numpy.arange(initMet,inow+1)*ippSeconds y = phase1[initMet:inow+1] ynnan = ~numpy.isnan(y) x = x[ynnan] y = y[ynnan] slope, intercept, r_value, p_value, std_err = stats.linregress(x,y) ylin = x*slope + intercept rsq = r_value**2 if rsq > 0.5: vel = slope#*height*1000/(k*d) estAux = numpy.array([utctime,p,height, vel, rsq]) meteorList.append(estAux) initMet = inext metArray2 = numpy.array(meteorList) return metArray2 def __calculateAzimuth1(self, rx_location, pairslist, azimuth0): azimuth1 = numpy.zeros(len(pairslist)) dist = numpy.zeros(len(pairslist)) for i in range(len(rx_location)): ch0 = pairslist[i][0] ch1 = pairslist[i][1] diffX = rx_location[ch0][0] - rx_location[ch1][0] diffY = rx_location[ch0][1] - rx_location[ch1][1] azimuth1[i] = numpy.arctan2(diffY,diffX)*180/numpy.pi dist[i] = numpy.sqrt(diffX**2 + diffY**2) azimuth1 -= azimuth0 return azimuth1, dist def techniqueNSM_DBS(self, **kwargs): metArray = kwargs['metArray'] heightList = kwargs['heightList'] timeList = kwargs['timeList'] azimuth = kwargs['azimuth'] theta_x = numpy.array(kwargs['theta_x']) theta_y = numpy.array(kwargs['theta_y']) utctime = metArray[:,0] cmet = metArray[:,1].astype(int) hmet = metArray[:,3].astype(int) SNRmet = metArray[:,4] vmet = metArray[:,5] spcmet = metArray[:,6] nChan = numpy.max(cmet) + 1 nHeights = len(heightList) azimuth_arr, zenith_arr, dir_cosu, dir_cosv, dir_cosw = self.__calculateAngles(theta_x, theta_y, azimuth) hmet = heightList[hmet] h1met = hmet*numpy.cos(zenith_arr[cmet]) #Corrected heights velEst = numpy.zeros((heightList.size,2))*numpy.nan for i in range(nHeights - 1): hmin = heightList[i] hmax = heightList[i + 1] thisH = (h1met>=hmin) & (h1met8) & (vmet<50) & (spcmet<10) indthisH = numpy.where(thisH) if numpy.size(indthisH) > 3: vel_aux = vmet[thisH] chan_aux = cmet[thisH] cosu_aux = dir_cosu[chan_aux] cosv_aux = dir_cosv[chan_aux] cosw_aux = dir_cosw[chan_aux] nch = numpy.size(numpy.unique(chan_aux)) if nch > 1: A = self.__calculateMatA(cosu_aux, cosv_aux, cosw_aux, True) velEst[i,:] = numpy.dot(A,vel_aux) return velEst def run(self, dataOut, technique, nHours=1, hmin=70, hmax=110, **kwargs): param = dataOut.data_param if dataOut.abscissaList != None: absc = dataOut.abscissaList[:-1] # noise = dataOut.noise heightList = dataOut.heightList SNR = dataOut.data_snr if technique == 'DBS': kwargs['velRadial'] = param[:,1,:] #Radial velocity kwargs['heightList'] = heightList kwargs['SNR'] = SNR dataOut.data_output, dataOut.heightList, dataOut.data_snr = self.techniqueDBS(kwargs) #DBS Function dataOut.utctimeInit = dataOut.utctime dataOut.outputInterval = dataOut.paramInterval elif technique == 'SA': #Parameters # position_x = kwargs['positionX'] # position_y = kwargs['positionY'] # azimuth = kwargs['azimuth'] # # if kwargs.has_key('crosspairsList'): # pairs = kwargs['crosspairsList'] # else: # pairs = None # # if kwargs.has_key('correctFactor'): # correctFactor = kwargs['correctFactor'] # else: # correctFactor = 1 # tau = dataOut.data_param # _lambda = dataOut.C/dataOut.frequency # pairsList = dataOut.groupList # nChannels = dataOut.nChannels kwargs['groupList'] = dataOut.groupList kwargs['tau'] = dataOut.data_param kwargs['_lambda'] = dataOut.C/dataOut.frequency # dataOut.data_output = self.techniqueSA(pairs, pairsList, nChannels, tau, azimuth, _lambda, position_x, position_y, absc, correctFactor) dataOut.data_output = self.techniqueSA(kwargs) dataOut.utctimeInit = dataOut.utctime dataOut.outputInterval = dataOut.timeInterval elif technique == 'Meteors': dataOut.flagNoData = True self.__dataReady = False if 'nHours' in kwargs: nHours = kwargs['nHours'] else: nHours = 1 if 'meteorsPerBin' in kwargs: meteorThresh = kwargs['meteorsPerBin'] else: meteorThresh = 6 if 'hmin' in kwargs: hmin = kwargs['hmin'] else: hmin = 70 if 'hmax' in kwargs: hmax = kwargs['hmax'] else: hmax = 110 dataOut.outputInterval = nHours*3600 if self.__isConfig == False: # self.__initime = dataOut.datatime.replace(minute = 0, second = 0, microsecond = 03) #Get Initial LTC time self.__initime = datetime.datetime.utcfromtimestamp(dataOut.utctime) self.__initime = (self.__initime.replace(minute = 0, second = 0, microsecond = 0) - datetime.datetime(1970, 1, 1)).total_seconds() self.__isConfig = True if self.__buffer is None: self.__buffer = dataOut.data_param self.__firstdata = copy.copy(dataOut) else: self.__buffer = numpy.vstack((self.__buffer, dataOut.data_param)) self.__checkTime(dataOut.utctime, dataOut.paramInterval, dataOut.outputInterval) #Check if the buffer is ready if self.__dataReady: dataOut.utctimeInit = self.__initime self.__initime += dataOut.outputInterval #to erase time offset dataOut.data_output, dataOut.heightList = self.techniqueMeteors(self.__buffer, meteorThresh, hmin, hmax) dataOut.flagNoData = False self.__buffer = None elif technique == 'Meteors1': dataOut.flagNoData = True self.__dataReady = False if 'nMins' in kwargs: nMins = kwargs['nMins'] else: nMins = 20 if 'rx_location' in kwargs: rx_location = kwargs['rx_location'] else: rx_location = [(0,1),(1,1),(1,0)] if 'azimuth' in kwargs: azimuth = kwargs['azimuth'] else: azimuth = 51.06 if 'dfactor' in kwargs: dfactor = kwargs['dfactor'] if 'mode' in kwargs: mode = kwargs['mode'] if 'theta_x' in kwargs: theta_x = kwargs['theta_x'] if 'theta_y' in kwargs: theta_y = kwargs['theta_y'] else: mode = 'SA' #Borrar luego esto if dataOut.groupList is None: dataOut.groupList = [(0,1),(0,2),(1,2)] groupList = dataOut.groupList C = 3e8 freq = 50e6 lamb = C/freq k = 2*numpy.pi/lamb timeList = dataOut.abscissaList heightList = dataOut.heightList if self.__isConfig == False: dataOut.outputInterval = nMins*60 # self.__initime = dataOut.datatime.replace(minute = 0, second = 0, microsecond = 03) #Get Initial LTC time initime = datetime.datetime.utcfromtimestamp(dataOut.utctime) minuteAux = initime.minute minuteNew = int(numpy.floor(minuteAux/nMins)*nMins) self.__initime = (initime.replace(minute = minuteNew, second = 0, microsecond = 0) - datetime.datetime(1970, 1, 1)).total_seconds() self.__isConfig = True if self.__buffer is None: self.__buffer = dataOut.data_param self.__firstdata = copy.copy(dataOut) else: self.__buffer = numpy.vstack((self.__buffer, dataOut.data_param)) self.__checkTime(dataOut.utctime, dataOut.paramInterval, dataOut.outputInterval) #Check if the buffer is ready if self.__dataReady: dataOut.utctimeInit = self.__initime self.__initime += dataOut.outputInterval #to erase time offset metArray = self.__buffer if mode == 'SA': dataOut.data_output = self.techniqueNSM_SA(rx_location=rx_location, groupList=groupList, azimuth=azimuth, dfactor=dfactor, k=k,metArray=metArray, heightList=heightList,timeList=timeList) elif mode == 'DBS': dataOut.data_output = self.techniqueNSM_DBS(metArray=metArray,heightList=heightList,timeList=timeList, azimuth=azimuth, theta_x=theta_x, theta_y=theta_y) dataOut.data_output = dataOut.data_output.T dataOut.flagNoData = False self.__buffer = None return class EWDriftsEstimation(Operation): def __init__(self): Operation.__init__(self) def __correctValues(self, heiRang, phi, velRadial, SNR): listPhi = phi.tolist() maxid = listPhi.index(max(listPhi)) minid = listPhi.index(min(listPhi)) rango = list(range(len(phi))) # rango = numpy.delete(rango,maxid) heiRang1 = heiRang*math.cos(phi[maxid]) heiRangAux = heiRang*math.cos(phi[minid]) indOut = (heiRang1 < heiRangAux[0]).nonzero() heiRang1 = numpy.delete(heiRang1,indOut) velRadial1 = numpy.zeros([len(phi),len(heiRang1)]) SNR1 = numpy.zeros([len(phi),len(heiRang1)]) for i in rango: x = heiRang*math.cos(phi[i]) y1 = velRadial[i,:] vali= (numpy.isfinite(y1)==True).nonzero() y1=y1[vali] x = x[vali] f1 = interpolate.interp1d(x,y1,kind = 'cubic',bounds_error=False) #heiRang1 = x*math.cos(phi[maxid]) x1 = heiRang1 y11 = f1(x1) y2 = SNR[i,:] #print 'snr ', y2 x = heiRang*math.cos(phi[i]) vali= (y2 != -1).nonzero() y2 = y2[vali] x = x[vali] #print 'snr ',y2 f2 = interpolate.interp1d(x,y2,kind = 'cubic',bounds_error=False) y21 = f2(x1) velRadial1[i,:] = y11 SNR1[i,:] = y21 return heiRang1, velRadial1, SNR1 def run(self, dataOut, zenith, zenithCorrection): heiRang = dataOut.heightList velRadial = dataOut.data_param[:,3,:] velRadialm = dataOut.data_param[:,2:4,:]*-1 rbufc=dataOut.data_paramC[:,:,0] ebufc=dataOut.data_paramC[:,:,1] SNR = dataOut.data_snr velRerr = dataOut.data_error[:,4,:] moments=numpy.vstack(([velRadialm[0,:]],[velRadialm[0,:]],[velRadialm[1,:]],[velRadialm[1,:]])) dataOut.moments=moments # Coherent smooth_wC = ebufc[0,:] p_w0C = rbufc[0,:] p_w1C = rbufc[1,:] w_wC = rbufc[2,:]*-1 #*radial_sign(radial EQ 1) t_wC = rbufc[3,:] my_nbeams = 2 zenith = numpy.array(zenith) zenith -= zenithCorrection zenith *= numpy.pi/180 if zenithCorrection != 0 : heiRang1, velRadial1, SNR1 = self.__correctValues(heiRang, numpy.abs(zenith), velRadial, SNR) else : heiRang1 = heiRang velRadial1 = velRadial SNR1 = SNR alp = zenith[0] bet = zenith[1] w_w = velRadial1[0,:] w_e = velRadial1[1,:] w_w_err = velRerr[0,:] w_e_err = velRerr[1,:] val = (numpy.isfinite(w_w)==False).nonzero() val = val[0] bad = val if len(bad) > 0 : w_w[bad] = w_wC[bad] w_w_err[bad]= numpy.nan if my_nbeams == 2: smooth_eC=ebufc[4,:] p_e0C = rbufc[4,:] p_e1C = rbufc[5,:] w_eC = rbufc[6,:]*-1 t_eC = rbufc[7,:] val = (numpy.isfinite(w_e)==False).nonzero() val = val[0] bad = val if len(bad) > 0 : w_e[bad] = w_eC[bad] w_e_err[bad]= numpy.nan w = (w_w*numpy.sin(bet) - w_e*numpy.sin(alp))/(numpy.cos(alp)*numpy.sin(bet) - numpy.cos(bet)*numpy.sin(alp)) u = (w_w*numpy.cos(bet) - w_e*numpy.cos(alp))/(numpy.sin(alp)*numpy.cos(bet) - numpy.sin(bet)*numpy.cos(alp)) w_err = numpy.sqrt((w_w_err*numpy.sin(bet))**2.+(w_e_err*numpy.sin(alp))**2.)/ numpy.absolute(numpy.cos(alp)*numpy.sin(bet)-numpy.cos(bet)*numpy.sin(alp)) u_err = numpy.sqrt((w_w_err*numpy.cos(bet))**2.+(w_e_err*numpy.cos(alp))**2.)/ numpy.absolute(numpy.cos(alp)*numpy.sin(bet)-numpy.cos(bet)*numpy.sin(alp)) winds = numpy.vstack((w,u)) dataOut.heightList = heiRang1 dataOut.data_output = winds snr1 = 10*numpy.log10(SNR1[0]) dataOut.data_snr1 = numpy.reshape(snr1,(1,snr1.shape[0])) dataOut.utctimeInit = dataOut.utctime dataOut.outputInterval = dataOut.timeInterval hei_aver0 = 218 jrange = 450 #900 para HA drifts deltah = 15.0 #dataOut.spacing(0) h0 = 0.0 #dataOut.first_height(0) heights = dataOut.heightList nhei = len(heights) range1 = numpy.arange(nhei) * deltah + h0 #jhei = WHERE(range1 GE hei_aver0 , jcount) jhei = (range1 >= hei_aver0).nonzero() if len(jhei[0]) > 0 : h0_index = jhei[0][0] # Initial height for getting averages 218km mynhei = 7 nhei_avg = int(jrange/deltah) h_avgs = int(nhei_avg/mynhei) nhei_avg = h_avgs*(mynhei-1)+mynhei navgs = numpy.zeros(mynhei,dtype='float') delta_h = numpy.zeros(mynhei,dtype='float') range_aver = numpy.zeros(mynhei,dtype='float') for ih in range( mynhei-1 ): range_aver[ih] = numpy.sum(range1[h0_index+h_avgs*ih:h0_index+h_avgs*(ih+1)-0])/h_avgs navgs[ih] = h_avgs delta_h[ih] = deltah*h_avgs range_aver[mynhei-1] = numpy.sum(range1[h0_index:h0_index+6*h_avgs-0])/(6*h_avgs) navgs[mynhei-1] = 6*h_avgs delta_h[mynhei-1] = deltah*6*h_avgs wA = w[h0_index:h0_index+nhei_avg-0] wA_err = w_err[h0_index:h0_index+nhei_avg-0] for i in range(5) : vals = wA[i*h_avgs:(i+1)*h_avgs-0] errs = wA_err[i*h_avgs:(i+1)*h_avgs-0] avg = numpy.nansum(vals/errs**2.)/numpy.nansum(1./errs**2.) sigma = numpy.sqrt(1./numpy.nansum(1./errs**2.)) wA[6*h_avgs+i] = avg wA_err[6*h_avgs+i] = sigma vals = wA[0:6*h_avgs-0] errs=wA_err[0:6*h_avgs-0] avg = numpy.nansum(vals/errs**2.)/numpy.nansum(1./errs**2) sigma = numpy.sqrt(1./numpy.nansum(1./errs**2.)) wA[nhei_avg-1] = avg wA_err[nhei_avg-1] = sigma wA = wA[6*h_avgs:nhei_avg-0] wA_err=wA_err[6*h_avgs:nhei_avg-0] if my_nbeams == 2 : uA = u[h0_index:h0_index+nhei_avg] uA_err=u_err[h0_index:h0_index+nhei_avg] for i in range(5) : vals = uA[i*h_avgs:(i+1)*h_avgs-0] errs=uA_err[i*h_avgs:(i+1)*h_avgs-0] avg = numpy.nansum(vals/errs**2.)/numpy.nansum(1./errs**2.) sigma = numpy.sqrt(1./numpy.nansum(1./errs**2.)) uA[6*h_avgs+i] = avg uA_err[6*h_avgs+i]=sigma vals = uA[0:6*h_avgs-0] errs = uA_err[0:6*h_avgs-0] avg = numpy.nansum(vals/errs**2.)/numpy.nansum(1./errs**2.) sigma = numpy.sqrt(1./numpy.nansum(1./errs**2.)) uA[nhei_avg-1] = avg uA_err[nhei_avg-1] = sigma uA = uA[6*h_avgs:nhei_avg-0] uA_err = uA_err[6*h_avgs:nhei_avg-0] dataOut.drifts_avg = numpy.vstack((wA,uA)) tini=time.localtime(dataOut.utctime) datefile= str(tini[0]).zfill(4)+str(tini[1]).zfill(2)+str(tini[2]).zfill(2) nfile = '/home/pcondor/Database/ewdriftsschain2019/jro'+datefile+'drifts_sch3.txt' f1 = open(nfile,'a') datedriftavg=str(tini[0])+' '+str(tini[1])+' '+str(tini[2])+' '+str(tini[3])+' '+str(tini[4]) driftavgstr=str(dataOut.drifts_avg) numpy.savetxt(f1,numpy.column_stack([tini[0],tini[1],tini[2],tini[3],tini[4]]),fmt='%4i') numpy.savetxt(f1,dataOut.drifts_avg,fmt='%10.2f') f1.close() return dataOut #--------------- Non Specular Meteor ---------------- class NonSpecularMeteorDetection(Operation): def run(self, dataOut, mode, SNRthresh=8, phaseDerThresh=0.5, cohThresh=0.8, allData = False): data_acf = dataOut.data_pre[0] data_ccf = dataOut.data_pre[1] pairsList = dataOut.groupList[1] lamb = dataOut.C/dataOut.frequency tSamp = dataOut.ippSeconds*dataOut.nCohInt paramInterval = dataOut.paramInterval nChannels = data_acf.shape[0] nLags = data_acf.shape[1] nProfiles = data_acf.shape[2] nHeights = dataOut.nHeights nCohInt = dataOut.nCohInt sec = numpy.round(nProfiles/dataOut.paramInterval) heightList = dataOut.heightList ippSeconds = dataOut.ippSeconds*dataOut.nCohInt*dataOut.nAvg utctime = dataOut.utctime dataOut.abscissaList = numpy.arange(0,paramInterval+ippSeconds,ippSeconds) #------------------------ SNR -------------------------------------- power = data_acf[:,0,:,:].real noise = numpy.zeros(nChannels) SNR = numpy.zeros(power.shape) for i in range(nChannels): noise[i] = hildebrand_sekhon(power[i,:], nCohInt) SNR[i] = (power[i]-noise[i])/noise[i] SNRm = numpy.nanmean(SNR, axis = 0) SNRdB = 10*numpy.log10(SNR) if mode == 'SA': dataOut.groupList = dataOut.groupList[1] nPairs = data_ccf.shape[0] #---------------------- Coherence and Phase -------------------------- phase = numpy.zeros(data_ccf[:,0,:,:].shape) # phase1 = numpy.copy(phase) coh1 = numpy.zeros(data_ccf[:,0,:,:].shape) for p in range(nPairs): ch0 = pairsList[p][0] ch1 = pairsList[p][1] ccf = data_ccf[p,0,:,:]/numpy.sqrt(data_acf[ch0,0,:,:]*data_acf[ch1,0,:,:]) phase[p,:,:] = ndimage.median_filter(numpy.angle(ccf), size = (5,1)) #median filter # phase1[p,:,:] = numpy.angle(ccf) #median filter coh1[p,:,:] = ndimage.median_filter(numpy.abs(ccf), 5) #median filter # coh1[p,:,:] = numpy.abs(ccf) #median filter coh = numpy.nanmax(coh1, axis = 0) # struc = numpy.ones((5,1)) # coh = ndimage.morphology.grey_dilation(coh, size=(10,1)) #---------------------- Radial Velocity ---------------------------- phaseAux = numpy.mean(numpy.angle(data_acf[:,1,:,:]), axis = 0) velRad = phaseAux*lamb/(4*numpy.pi*tSamp) if allData: boolMetFin = ~numpy.isnan(SNRm) # coh[:-1,:] = numpy.nanmean(numpy.abs(phase[:,1:,:] - phase[:,:-1,:]),axis=0) else: #------------------------ Meteor mask --------------------------------- # #SNR mask # boolMet = (SNRdB>SNRthresh)#|(~numpy.isnan(SNRdB)) # # #Erase small objects # boolMet1 = self.__erase_small(boolMet, 2*sec, 5) # # auxEEJ = numpy.sum(boolMet1,axis=0) # indOver = auxEEJ>nProfiles*0.8 #Use this later # indEEJ = numpy.where(indOver)[0] # indNEEJ = numpy.where(~indOver)[0] # # boolMetFin = boolMet1 # # if indEEJ.size > 0: # boolMet1[:,indEEJ] = False #Erase heights with EEJ # # boolMet2 = coh > cohThresh # boolMet2 = self.__erase_small(boolMet2, 2*sec,5) # # #Final Meteor mask # boolMetFin = boolMet1|boolMet2 #Coherence mask boolMet1 = coh > 0.75 struc = numpy.ones((30,1)) boolMet1 = ndimage.morphology.binary_dilation(boolMet1, structure=struc) #Derivative mask derPhase = numpy.nanmean(numpy.abs(phase[:,1:,:] - phase[:,:-1,:]),axis=0) boolMet2 = derPhase < 0.2 # boolMet2 = ndimage.morphology.binary_opening(boolMet2) # boolMet2 = ndimage.morphology.binary_closing(boolMet2, structure = numpy.ones((10,1))) boolMet2 = ndimage.median_filter(boolMet2,size=5) boolMet2 = numpy.vstack((boolMet2,numpy.full((1,nHeights), True, dtype=bool))) # #Final mask # boolMetFin = boolMet2 boolMetFin = boolMet1&boolMet2 # boolMetFin = ndimage.morphology.binary_dilation(boolMetFin) #Creating data_param coordMet = numpy.where(boolMetFin) tmet = coordMet[0] hmet = coordMet[1] data_param = numpy.zeros((tmet.size, 6 + nPairs)) data_param[:,0] = utctime data_param[:,1] = tmet data_param[:,2] = hmet data_param[:,3] = SNRm[tmet,hmet] data_param[:,4] = velRad[tmet,hmet] data_param[:,5] = coh[tmet,hmet] data_param[:,6:] = phase[:,tmet,hmet].T elif mode == 'DBS': dataOut.groupList = numpy.arange(nChannels) #Radial Velocities phase = numpy.angle(data_acf[:,1,:,:]) # phase = ndimage.median_filter(numpy.angle(data_acf[:,1,:,:]), size = (1,5,1)) velRad = phase*lamb/(4*numpy.pi*tSamp) #Spectral width # acf1 = ndimage.median_filter(numpy.abs(data_acf[:,1,:,:]), size = (1,5,1)) # acf2 = ndimage.median_filter(numpy.abs(data_acf[:,2,:,:]), size = (1,5,1)) acf1 = data_acf[:,1,:,:] acf2 = data_acf[:,2,:,:] spcWidth = (lamb/(2*numpy.sqrt(6)*numpy.pi*tSamp))*numpy.sqrt(numpy.log(acf1/acf2)) # velRad = ndimage.median_filter(velRad, size = (1,5,1)) if allData: boolMetFin = ~numpy.isnan(SNRdB) else: #SNR boolMet1 = (SNRdB>SNRthresh) #SNR mask boolMet1 = ndimage.median_filter(boolMet1, size=(1,5,5)) #Radial velocity boolMet2 = numpy.abs(velRad) < 20 boolMet2 = ndimage.median_filter(boolMet2, (1,5,5)) #Spectral Width boolMet3 = spcWidth < 30 boolMet3 = ndimage.median_filter(boolMet3, (1,5,5)) # boolMetFin = self.__erase_small(boolMet1, 10,5) boolMetFin = boolMet1&boolMet2&boolMet3 #Creating data_param coordMet = numpy.where(boolMetFin) cmet = coordMet[0] tmet = coordMet[1] hmet = coordMet[2] data_param = numpy.zeros((tmet.size, 7)) data_param[:,0] = utctime data_param[:,1] = cmet data_param[:,2] = tmet data_param[:,3] = hmet data_param[:,4] = SNR[cmet,tmet,hmet].T data_param[:,5] = velRad[cmet,tmet,hmet].T data_param[:,6] = spcWidth[cmet,tmet,hmet].T # self.dataOut.data_param = data_int if len(data_param) == 0: dataOut.flagNoData = True else: dataOut.data_param = data_param def __erase_small(self, binArray, threshX, threshY): labarray, numfeat = ndimage.measurements.label(binArray) binArray1 = numpy.copy(binArray) for i in range(1,numfeat + 1): auxBin = (labarray==i) auxSize = auxBin.sum() x,y = numpy.where(auxBin) widthX = x.max() - x.min() widthY = y.max() - y.min() #width X: 3 seg -> 12.5*3 #width Y: if (auxSize < 50) or (widthX < threshX) or (widthY < threshY): binArray1[auxBin] = False return binArray1 #--------------- Specular Meteor ---------------- class SMDetection(Operation): ''' Function DetectMeteors() Project developed with paper: HOLDSWORTH ET AL. 2004 Input: self.dataOut.data_pre centerReceiverIndex: From the channels, which is the center receiver hei_ref: Height reference for the Beacon signal extraction tauindex: predefinedPhaseShifts: Predefined phase offset for the voltge signals cohDetection: Whether to user Coherent detection or not cohDet_timeStep: Coherent Detection calculation time step cohDet_thresh: Coherent Detection phase threshold to correct phases noise_timeStep: Noise calculation time step noise_multiple: Noise multiple to define signal threshold multDet_timeLimit: Multiple Detection Removal time limit in seconds multDet_rangeLimit: Multiple Detection Removal range limit in km phaseThresh: Maximum phase difference between receiver to be consider a meteor SNRThresh: Minimum SNR threshold of the meteor signal to be consider a meteor hmin: Minimum Height of the meteor to use it in the further wind estimations hmax: Maximum Height of the meteor to use it in the further wind estimations azimuth: Azimuth angle correction Affected: self.dataOut.data_param Rejection Criteria (Errors): 0: No error; analysis OK 1: SNR < SNR threshold 2: angle of arrival (AOA) ambiguously determined 3: AOA estimate not feasible 4: Large difference in AOAs obtained from different antenna baselines 5: echo at start or end of time series 6: echo less than 5 examples long; too short for analysis 7: echo rise exceeds 0.3s 8: echo decay time less than twice rise time 9: large power level before echo 10: large power level after echo 11: poor fit to amplitude for estimation of decay time 12: poor fit to CCF phase variation for estimation of radial drift velocity 13: height unresolvable echo: not valid height within 70 to 110 km 14: height ambiguous echo: more then one possible height within 70 to 110 km 15: radial drift velocity or projected horizontal velocity exceeds 200 m/s 16: oscilatory echo, indicating event most likely not an underdense echo 17: phase difference in meteor Reestimation Data Storage: Meteors for Wind Estimation (8): Utc Time | Range Height Azimuth Zenith errorCosDir VelRad errorVelRad Phase0 Phase1 Phase2 Phase3 TypeError ''' def run(self, dataOut, hei_ref = None, tauindex = 0, phaseOffsets = None, cohDetection = False, cohDet_timeStep = 1, cohDet_thresh = 25, noise_timeStep = 4, noise_multiple = 4, multDet_timeLimit = 1, multDet_rangeLimit = 3, phaseThresh = 20, SNRThresh = 5, hmin = 50, hmax=150, azimuth = 0, channelPositions = None) : #Getting Pairslist if channelPositions is None: # channelPositions = [(2.5,0), (0,2.5), (0,0), (0,4.5), (-2,0)] #T channelPositions = [(4.5,2), (2,4.5), (2,2), (2,0), (0,2)] #Estrella meteorOps = SMOperations() pairslist0, distances = meteorOps.getPhasePairs(channelPositions) heiRang = dataOut.heightList #Get Beacon signal - No Beacon signal anymore # newheis = numpy.where(self.dataOut.heightList>self.dataOut.radarControllerHeaderObj.Taus[tauindex]) # # if hei_ref != None: # newheis = numpy.where(self.dataOut.heightList>hei_ref) # #****************REMOVING HARDWARE PHASE DIFFERENCES*************** # see if the user put in pre defined phase shifts voltsPShift = dataOut.data_pre.copy() # if predefinedPhaseShifts != None: # hardwarePhaseShifts = numpy.array(predefinedPhaseShifts)*numpy.pi/180 # # # elif beaconPhaseShifts: # # #get hardware phase shifts using beacon signal # # hardwarePhaseShifts = self.__getHardwarePhaseDiff(self.dataOut.data_pre, pairslist, newheis, 10) # # hardwarePhaseShifts = numpy.insert(hardwarePhaseShifts,centerReceiverIndex,0) # # else: # hardwarePhaseShifts = numpy.zeros(5) # # voltsPShift = numpy.zeros((self.dataOut.data_pre.shape[0],self.dataOut.data_pre.shape[1],self.dataOut.data_pre.shape[2]), dtype = 'complex') # for i in range(self.dataOut.data_pre.shape[0]): # voltsPShift[i,:,:] = self.__shiftPhase(self.dataOut.data_pre[i,:,:], hardwarePhaseShifts[i]) #******************END OF REMOVING HARDWARE PHASE DIFFERENCES********* #Remove DC voltsDC = numpy.mean(voltsPShift,1) voltsDC = numpy.mean(voltsDC,1) for i in range(voltsDC.shape[0]): voltsPShift[i] = voltsPShift[i] - voltsDC[i] #Don't considerate last heights, theyre used to calculate Hardware Phase Shift # voltsPShift = voltsPShift[:,:,:newheis[0][0]] #************ FIND POWER OF DATA W/COH OR NON COH DETECTION (3.4) ********** #Coherent Detection if cohDetection: #use coherent detection to get the net power cohDet_thresh = cohDet_thresh*numpy.pi/180 voltsPShift = self.__coherentDetection(voltsPShift, cohDet_timeStep, dataOut.timeInterval, pairslist0, cohDet_thresh) #Non-coherent detection! powerNet = numpy.nansum(numpy.abs(voltsPShift[:,:,:])**2,0) #********** END OF COH/NON-COH POWER CALCULATION********************** #********** FIND THE NOISE LEVEL AND POSSIBLE METEORS **************** #Get noise noise, noise1 = self.__getNoise(powerNet, noise_timeStep, dataOut.timeInterval) # noise = self.getNoise1(powerNet, noise_timeStep, self.dataOut.timeInterval) #Get signal threshold signalThresh = noise_multiple*noise #Meteor echoes detection listMeteors = self.__findMeteors(powerNet, signalThresh) #******* END OF NOISE LEVEL AND POSSIBLE METEORS CACULATION ********** #************** REMOVE MULTIPLE DETECTIONS (3.5) *************************** #Parameters heiRange = dataOut.heightList rangeInterval = heiRange[1] - heiRange[0] rangeLimit = multDet_rangeLimit/rangeInterval timeLimit = multDet_timeLimit/dataOut.timeInterval #Multiple detection removals listMeteors1 = self.__removeMultipleDetections(listMeteors, rangeLimit, timeLimit) #************ END OF REMOVE MULTIPLE DETECTIONS ********************** #********************* METEOR REESTIMATION (3.7, 3.8, 3.9, 3.10) ******************** #Parameters phaseThresh = phaseThresh*numpy.pi/180 thresh = [phaseThresh, noise_multiple, SNRThresh] #Meteor reestimation (Errors N 1, 6, 12, 17) listMeteors2, listMeteorsPower, listMeteorsVolts = self.__meteorReestimation(listMeteors1, voltsPShift, pairslist0, thresh, noise, dataOut.timeInterval, dataOut.frequency) # listMeteors2, listMeteorsPower, listMeteorsVolts = self.meteorReestimation3(listMeteors2, listMeteorsPower, listMeteorsVolts, voltsPShift, pairslist, thresh, noise) #Estimation of decay times (Errors N 7, 8, 11) listMeteors3 = self.__estimateDecayTime(listMeteors2, listMeteorsPower, dataOut.timeInterval, dataOut.frequency) #******************* END OF METEOR REESTIMATION ******************* #********************* METEOR PARAMETERS CALCULATION (3.11, 3.12, 3.13) ************************** #Calculating Radial Velocity (Error N 15) radialStdThresh = 10 listMeteors4 = self.__getRadialVelocity(listMeteors3, listMeteorsVolts, radialStdThresh, pairslist0, dataOut.timeInterval) if len(listMeteors4) > 0: #Setting New Array date = dataOut.utctime arrayParameters = self.__setNewArrays(listMeteors4, date, heiRang) #Correcting phase offset if phaseOffsets != None: phaseOffsets = numpy.array(phaseOffsets)*numpy.pi/180 arrayParameters[:,8:12] = numpy.unwrap(arrayParameters[:,8:12] + phaseOffsets) #Second Pairslist pairsList = [] pairx = (0,1) pairy = (2,3) pairsList.append(pairx) pairsList.append(pairy) jph = numpy.array([0,0,0,0]) h = (hmin,hmax) arrayParameters = meteorOps.getMeteorParams(arrayParameters, azimuth, h, pairsList, distances, jph) # #Calculate AOA (Error N 3, 4) # #JONES ET AL. 1998 # error = arrayParameters[:,-1] # AOAthresh = numpy.pi/8 # phases = -arrayParameters[:,9:13] # arrayParameters[:,4:7], arrayParameters[:,-1] = meteorOps.getAOA(phases, pairsList, error, AOAthresh, azimuth) # # #Calculate Heights (Error N 13 and 14) # error = arrayParameters[:,-1] # Ranges = arrayParameters[:,2] # zenith = arrayParameters[:,5] # arrayParameters[:,3], arrayParameters[:,-1] = meteorOps.getHeights(Ranges, zenith, error, hmin, hmax) # error = arrayParameters[:,-1] #********************* END OF PARAMETERS CALCULATION ************************** #***************************+ PASS DATA TO NEXT STEP ********************** # arrayFinal = arrayParameters.reshape((1,arrayParameters.shape[0],arrayParameters.shape[1])) dataOut.data_param = arrayParameters if arrayParameters is None: dataOut.flagNoData = True else: dataOut.flagNoData = True return def __getHardwarePhaseDiff(self, voltage0, pairslist, newheis, n): minIndex = min(newheis[0]) maxIndex = max(newheis[0]) voltage = voltage0[:,:,minIndex:maxIndex+1] nLength = voltage.shape[1]/n nMin = 0 nMax = 0 phaseOffset = numpy.zeros((len(pairslist),n)) for i in range(n): nMax += nLength phaseCCF = -numpy.angle(self.__calculateCCF(voltage[:,nMin:nMax,:], pairslist, [0])) phaseCCF = numpy.mean(phaseCCF, axis = 2) phaseOffset[:,i] = phaseCCF.transpose() nMin = nMax # phaseDiff, phaseArrival = self.estimatePhaseDifference(voltage, pairslist) #Remove Outliers factor = 2 wt = phaseOffset - signal.medfilt(phaseOffset,(1,5)) dw = numpy.std(wt,axis = 1) dw = dw.reshape((dw.size,1)) ind = numpy.where(numpy.logical_or(wt>dw*factor,wt<-dw*factor)) phaseOffset[ind] = numpy.nan phaseOffset = stats.nanmean(phaseOffset, axis=1) return phaseOffset def __shiftPhase(self, data, phaseShift): #this will shift the phase of a complex number dataShifted = numpy.abs(data) * numpy.exp((numpy.angle(data)+phaseShift)*1j) return dataShifted def __estimatePhaseDifference(self, array, pairslist): nChannel = array.shape[0] nHeights = array.shape[2] numPairs = len(pairslist) # phaseCCF = numpy.zeros((nChannel, 5, nHeights)) phaseCCF = numpy.angle(self.__calculateCCF(array, pairslist, [-2,-1,0,1,2])) #Correct phases derPhaseCCF = phaseCCF[:,1:,:] - phaseCCF[:,0:-1,:] indDer = numpy.where(numpy.abs(derPhaseCCF) > numpy.pi) if indDer[0].shape[0] > 0: for i in range(indDer[0].shape[0]): signo = -numpy.sign(derPhaseCCF[indDer[0][i],indDer[1][i],indDer[2][i]]) phaseCCF[indDer[0][i],indDer[1][i]+1:,:] += signo*2*numpy.pi # for j in range(numSides): # phaseCCFAux = self.calculateCCF(arrayCenter, arraySides[j,:,:], [-2,1,0,1,2]) # phaseCCF[j,:,:] = numpy.angle(phaseCCFAux) # #Linear phaseInt = numpy.zeros((numPairs,1)) angAllCCF = phaseCCF[:,[0,1,3,4],0] for j in range(numPairs): fit = stats.linregress([-2,-1,1,2],angAllCCF[j,:]) phaseInt[j] = fit[1] #Phase Differences phaseDiff = phaseInt - phaseCCF[:,2,:] phaseArrival = phaseInt.reshape(phaseInt.size) #Dealias phaseArrival = numpy.angle(numpy.exp(1j*phaseArrival)) # indAlias = numpy.where(phaseArrival > numpy.pi) # phaseArrival[indAlias] -= 2*numpy.pi # indAlias = numpy.where(phaseArrival < -numpy.pi) # phaseArrival[indAlias] += 2*numpy.pi return phaseDiff, phaseArrival def __coherentDetection(self, volts, timeSegment, timeInterval, pairslist, thresh): #this function will run the coherent detection used in Holdworth et al. 2004 and return the net power #find the phase shifts of each channel over 1 second intervals #only look at ranges below the beacon signal numProfPerBlock = numpy.ceil(timeSegment/timeInterval) numBlocks = int(volts.shape[1]/numProfPerBlock) numHeights = volts.shape[2] nChannel = volts.shape[0] voltsCohDet = volts.copy() pairsarray = numpy.array(pairslist) indSides = pairsarray[:,1] # indSides = numpy.array(range(nChannel)) # indSides = numpy.delete(indSides, indCenter) # # listCenter = numpy.array_split(volts[indCenter,:,:], numBlocks, 0) listBlocks = numpy.array_split(volts, numBlocks, 1) startInd = 0 endInd = 0 for i in range(numBlocks): startInd = endInd endInd = endInd + listBlocks[i].shape[1] arrayBlock = listBlocks[i] # arrayBlockCenter = listCenter[i] #Estimate the Phase Difference phaseDiff, aux = self.__estimatePhaseDifference(arrayBlock, pairslist) #Phase Difference RMS arrayPhaseRMS = numpy.abs(phaseDiff) phaseRMSaux = numpy.sum(arrayPhaseRMS < thresh,0) indPhase = numpy.where(phaseRMSaux==4) #Shifting if indPhase[0].shape[0] > 0: for j in range(indSides.size): arrayBlock[indSides[j],:,indPhase] = self.__shiftPhase(arrayBlock[indSides[j],:,indPhase], phaseDiff[j,indPhase].transpose()) voltsCohDet[:,startInd:endInd,:] = arrayBlock return voltsCohDet def __calculateCCF(self, volts, pairslist ,laglist): nHeights = volts.shape[2] nPoints = volts.shape[1] voltsCCF = numpy.zeros((len(pairslist), len(laglist), nHeights),dtype = 'complex') for i in range(len(pairslist)): volts1 = volts[pairslist[i][0]] volts2 = volts[pairslist[i][1]] for t in range(len(laglist)): idxT = laglist[t] if idxT >= 0: vStacked = numpy.vstack((volts2[idxT:,:], numpy.zeros((idxT, nHeights),dtype='complex'))) else: vStacked = numpy.vstack((numpy.zeros((-idxT, nHeights),dtype='complex'), volts2[:(nPoints + idxT),:])) voltsCCF[i,t,:] = numpy.sum((numpy.conjugate(volts1)*vStacked),axis=0) vStacked = None return voltsCCF def __getNoise(self, power, timeSegment, timeInterval): numProfPerBlock = numpy.ceil(timeSegment/timeInterval) numBlocks = int(power.shape[0]/numProfPerBlock) numHeights = power.shape[1] listPower = numpy.array_split(power, numBlocks, 0) noise = numpy.zeros((power.shape[0], power.shape[1])) noise1 = numpy.zeros((power.shape[0], power.shape[1])) startInd = 0 endInd = 0 for i in range(numBlocks): #split por canal startInd = endInd endInd = endInd + listPower[i].shape[0] arrayBlock = listPower[i] noiseAux = numpy.mean(arrayBlock, 0) # noiseAux = numpy.median(noiseAux) # noiseAux = numpy.mean(arrayBlock) noise[startInd:endInd,:] = noise[startInd:endInd,:] + noiseAux noiseAux1 = numpy.mean(arrayBlock) noise1[startInd:endInd,:] = noise1[startInd:endInd,:] + noiseAux1 return noise, noise1 def __findMeteors(self, power, thresh): nProf = power.shape[0] nHeights = power.shape[1] listMeteors = [] for i in range(nHeights): powerAux = power[:,i] threshAux = thresh[:,i] indUPthresh = numpy.where(powerAux > threshAux)[0] indDNthresh = numpy.where(powerAux <= threshAux)[0] j = 0 while (j < indUPthresh.size - 2): if (indUPthresh[j + 2] == indUPthresh[j] + 2): indDNAux = numpy.where(indDNthresh > indUPthresh[j]) indDNthresh = indDNthresh[indDNAux] if (indDNthresh.size > 0): indEnd = indDNthresh[0] - 1 indInit = indUPthresh[j] meteor = powerAux[indInit:indEnd + 1] indPeak = meteor.argmax() + indInit FLA = sum(numpy.conj(meteor)*numpy.hstack((meteor[1:],0))) listMeteors.append(numpy.array([i,indInit,indPeak,indEnd,FLA])) #CHEQUEAR!!!!! j = numpy.where(indUPthresh == indEnd)[0] + 1 else: j+=1 else: j+=1 return listMeteors def __removeMultipleDetections(self,listMeteors, rangeLimit, timeLimit): arrayMeteors = numpy.asarray(listMeteors) listMeteors1 = [] while arrayMeteors.shape[0] > 0: FLAs = arrayMeteors[:,4] maxFLA = FLAs.argmax() listMeteors1.append(arrayMeteors[maxFLA,:]) MeteorInitTime = arrayMeteors[maxFLA,1] MeteorEndTime = arrayMeteors[maxFLA,3] MeteorHeight = arrayMeteors[maxFLA,0] #Check neighborhood maxHeightIndex = MeteorHeight + rangeLimit minHeightIndex = MeteorHeight - rangeLimit minTimeIndex = MeteorInitTime - timeLimit maxTimeIndex = MeteorEndTime + timeLimit #Check Heights indHeight = numpy.logical_and(arrayMeteors[:,0] >= minHeightIndex, arrayMeteors[:,0] <= maxHeightIndex) indTime = numpy.logical_and(arrayMeteors[:,3] >= minTimeIndex, arrayMeteors[:,1] <= maxTimeIndex) indBoth = numpy.where(numpy.logical_and(indTime,indHeight)) arrayMeteors = numpy.delete(arrayMeteors, indBoth, axis = 0) return listMeteors1 def __meteorReestimation(self, listMeteors, volts, pairslist, thresh, noise, timeInterval,frequency): numHeights = volts.shape[2] nChannel = volts.shape[0] thresholdPhase = thresh[0] thresholdNoise = thresh[1] thresholdDB = float(thresh[2]) thresholdDB1 = 10**(thresholdDB/10) pairsarray = numpy.array(pairslist) indSides = pairsarray[:,1] pairslist1 = list(pairslist) pairslist1.append((0,1)) pairslist1.append((3,4)) listMeteors1 = [] listPowerSeries = [] listVoltageSeries = [] #volts has the war data if frequency == 30e6: timeLag = 45*10**-3 else: timeLag = 15*10**-3 lag = numpy.ceil(timeLag/timeInterval) for i in range(len(listMeteors)): ###################### 3.6 - 3.7 PARAMETERS REESTIMATION ######################### meteorAux = numpy.zeros(16) #Loading meteor Data (mHeight, mStart, mPeak, mEnd) mHeight = listMeteors[i][0] mStart = listMeteors[i][1] mPeak = listMeteors[i][2] mEnd = listMeteors[i][3] #get the volt data between the start and end times of the meteor meteorVolts = volts[:,mStart:mEnd+1,mHeight] meteorVolts = meteorVolts.reshape(meteorVolts.shape[0], meteorVolts.shape[1], 1) #3.6. Phase Difference estimation phaseDiff, aux = self.__estimatePhaseDifference(meteorVolts, pairslist) #3.7. Phase difference removal & meteor start, peak and end times reestimated #meteorVolts0.- all Channels, all Profiles meteorVolts0 = volts[:,:,mHeight] meteorThresh = noise[:,mHeight]*thresholdNoise meteorNoise = noise[:,mHeight] meteorVolts0[indSides,:] = self.__shiftPhase(meteorVolts0[indSides,:], phaseDiff) #Phase Shifting powerNet0 = numpy.nansum(numpy.abs(meteorVolts0)**2, axis = 0) #Power #Times reestimation mStart1 = numpy.where(powerNet0[:mPeak] < meteorThresh[:mPeak])[0] if mStart1.size > 0: mStart1 = mStart1[-1] + 1 else: mStart1 = mPeak mEnd1 = numpy.where(powerNet0[mPeak:] < meteorThresh[mPeak:])[0][0] + mPeak - 1 mEndDecayTime1 = numpy.where(powerNet0[mPeak:] < meteorNoise[mPeak:])[0] if mEndDecayTime1.size == 0: mEndDecayTime1 = powerNet0.size else: mEndDecayTime1 = mEndDecayTime1[0] + mPeak - 1 # mPeak1 = meteorVolts0[mStart1:mEnd1 + 1].argmax() #meteorVolts1.- all Channels, from start to end meteorVolts1 = meteorVolts0[:,mStart1:mEnd1 + 1] meteorVolts2 = meteorVolts0[:,mPeak + lag:mEnd1 + 1] if meteorVolts2.shape[1] == 0: meteorVolts2 = meteorVolts0[:,mPeak:mEnd1 + 1] meteorVolts1 = meteorVolts1.reshape(meteorVolts1.shape[0], meteorVolts1.shape[1], 1) meteorVolts2 = meteorVolts2.reshape(meteorVolts2.shape[0], meteorVolts2.shape[1], 1) ##################### END PARAMETERS REESTIMATION ######################### ##################### 3.8 PHASE DIFFERENCE REESTIMATION ######################## # if mEnd1 - mStart1 > 4: #Error Number 6: echo less than 5 samples long; too short for analysis if meteorVolts2.shape[1] > 0: #Phase Difference re-estimation phaseDiff1, phaseDiffint = self.__estimatePhaseDifference(meteorVolts2, pairslist1) #Phase Difference Estimation # phaseDiff1, phaseDiffint = self.estimatePhaseDifference(meteorVolts2, pairslist) meteorVolts2 = meteorVolts2.reshape(meteorVolts2.shape[0], meteorVolts2.shape[1]) phaseDiff11 = numpy.reshape(phaseDiff1, (phaseDiff1.shape[0],1)) meteorVolts2[indSides,:] = self.__shiftPhase(meteorVolts2[indSides,:], phaseDiff11[0:4]) #Phase Shifting #Phase Difference RMS phaseRMS1 = numpy.sqrt(numpy.mean(numpy.square(phaseDiff1))) powerNet1 = numpy.nansum(numpy.abs(meteorVolts1[:,:])**2,0) #Data from Meteor mPeak1 = powerNet1.argmax() + mStart1 mPeakPower1 = powerNet1.max() noiseAux = sum(noise[mStart1:mEnd1 + 1,mHeight]) mSNR1 = (sum(powerNet1)-noiseAux)/noiseAux Meteor1 = numpy.array([mHeight, mStart1, mPeak1, mEnd1, mPeakPower1, mSNR1, phaseRMS1]) Meteor1 = numpy.hstack((Meteor1,phaseDiffint)) PowerSeries = powerNet0[mStart1:mEndDecayTime1 + 1] #Vectorize meteorAux[0:7] = [mHeight, mStart1, mPeak1, mEnd1, mPeakPower1, mSNR1, phaseRMS1] meteorAux[7:11] = phaseDiffint[0:4] #Rejection Criterions if phaseRMS1 > thresholdPhase: #Error Number 17: Phase variation meteorAux[-1] = 17 elif mSNR1 < thresholdDB1: #Error Number 1: SNR < threshold dB meteorAux[-1] = 1 else: meteorAux[0:4] = [mHeight, mStart, mPeak, mEnd] meteorAux[-1] = 6 #Error Number 6: echo less than 5 samples long; too short for analysis PowerSeries = 0 listMeteors1.append(meteorAux) listPowerSeries.append(PowerSeries) listVoltageSeries.append(meteorVolts1) return listMeteors1, listPowerSeries, listVoltageSeries def __estimateDecayTime(self, listMeteors, listPower, timeInterval, frequency): threshError = 10 #Depending if it is 30 or 50 MHz if frequency == 30e6: timeLag = 45*10**-3 else: timeLag = 15*10**-3 lag = numpy.ceil(timeLag/timeInterval) listMeteors1 = [] for i in range(len(listMeteors)): meteorPower = listPower[i] meteorAux = listMeteors[i] if meteorAux[-1] == 0: try: indmax = meteorPower.argmax() indlag = indmax + lag y = meteorPower[indlag:] x = numpy.arange(0, y.size)*timeLag #first guess a = y[0] tau = timeLag #exponential fit popt, pcov = optimize.curve_fit(self.__exponential_function, x, y, p0 = [a, tau]) y1 = self.__exponential_function(x, *popt) #error estimation error = sum((y - y1)**2)/(numpy.var(y)*(y.size - popt.size)) decayTime = popt[1] riseTime = indmax*timeInterval meteorAux[11:13] = [decayTime, error] #Table items 7, 8 and 11 if (riseTime > 0.3): #Number 7: Echo rise exceeds 0.3s meteorAux[-1] = 7 elif (decayTime < 2*riseTime) : #Number 8: Echo decay time less than than twice rise time meteorAux[-1] = 8 if (error > threshError): #Number 11: Poor fit to amplitude for estimation of decay time meteorAux[-1] = 11 except: meteorAux[-1] = 11 listMeteors1.append(meteorAux) return listMeteors1 #Exponential Function def __exponential_function(self, x, a, tau): y = a*numpy.exp(-x/tau) return y def __getRadialVelocity(self, listMeteors, listVolts, radialStdThresh, pairslist, timeInterval): pairslist1 = list(pairslist) pairslist1.append((0,1)) pairslist1.append((3,4)) numPairs = len(pairslist1) #Time Lag timeLag = 45*10**-3 c = 3e8 lag = numpy.ceil(timeLag/timeInterval) freq = 30e6 listMeteors1 = [] for i in range(len(listMeteors)): meteorAux = listMeteors[i] if meteorAux[-1] == 0: mStart = listMeteors[i][1] mPeak = listMeteors[i][2] mLag = mPeak - mStart + lag #get the volt data between the start and end times of the meteor meteorVolts = listVolts[i] meteorVolts = meteorVolts.reshape(meteorVolts.shape[0], meteorVolts.shape[1], 1) #Get CCF allCCFs = self.__calculateCCF(meteorVolts, pairslist1, [-2,-1,0,1,2]) #Method 2 slopes = numpy.zeros(numPairs) time = numpy.array([-2,-1,1,2])*timeInterval angAllCCF = numpy.angle(allCCFs[:,[0,1,3,4],0]) #Correct phases derPhaseCCF = angAllCCF[:,1:] - angAllCCF[:,0:-1] indDer = numpy.where(numpy.abs(derPhaseCCF) > numpy.pi) if indDer[0].shape[0] > 0: for i in range(indDer[0].shape[0]): signo = -numpy.sign(derPhaseCCF[indDer[0][i],indDer[1][i]]) angAllCCF[indDer[0][i],indDer[1][i]+1:] += signo*2*numpy.pi # fit = scipy.stats.linregress(numpy.array([-2,-1,1,2])*timeInterval, numpy.array([phaseLagN2s[i],phaseLagN1s[i],phaseLag1s[i],phaseLag2s[i]])) for j in range(numPairs): fit = stats.linregress(time, angAllCCF[j,:]) slopes[j] = fit[0] #Remove Outlier # indOut = numpy.argmax(numpy.abs(slopes - numpy.mean(slopes))) # slopes = numpy.delete(slopes,indOut) # indOut = numpy.argmax(numpy.abs(slopes - numpy.mean(slopes))) # slopes = numpy.delete(slopes,indOut) radialVelocity = -numpy.mean(slopes)*(0.25/numpy.pi)*(c/freq) radialError = numpy.std(slopes)*(0.25/numpy.pi)*(c/freq) meteorAux[-2] = radialError meteorAux[-3] = radialVelocity #Setting Error #Number 15: Radial Drift velocity or projected horizontal velocity exceeds 200 m/s if numpy.abs(radialVelocity) > 200: meteorAux[-1] = 15 #Number 12: Poor fit to CCF variation for estimation of radial drift velocity elif radialError > radialStdThresh: meteorAux[-1] = 12 listMeteors1.append(meteorAux) return listMeteors1 def __setNewArrays(self, listMeteors, date, heiRang): #New arrays arrayMeteors = numpy.array(listMeteors) arrayParameters = numpy.zeros((len(listMeteors), 13)) #Date inclusion # date = re.findall(r'\((.*?)\)', date) # date = date[0].split(',') # date = map(int, date) # # if len(date)<6: # date.append(0) # # date = [date[0]*10000 + date[1]*100 + date[2], date[3]*10000 + date[4]*100 + date[5]] # arrayDate = numpy.tile(date, (len(listMeteors), 1)) arrayDate = numpy.tile(date, (len(listMeteors))) #Meteor array # arrayMeteors[:,0] = heiRang[arrayMeteors[:,0].astype(int)] # arrayMeteors = numpy.hstack((arrayDate, arrayMeteors)) #Parameters Array arrayParameters[:,0] = arrayDate #Date arrayParameters[:,1] = heiRang[arrayMeteors[:,0].astype(int)] #Range arrayParameters[:,6:8] = arrayMeteors[:,-3:-1] #Radial velocity and its error arrayParameters[:,8:12] = arrayMeteors[:,7:11] #Phases arrayParameters[:,-1] = arrayMeteors[:,-1] #Error return arrayParameters class CorrectSMPhases(Operation): def run(self, dataOut, phaseOffsets, hmin = 50, hmax = 150, azimuth = 45, channelPositions = None): arrayParameters = dataOut.data_param pairsList = [] pairx = (0,1) pairy = (2,3) pairsList.append(pairx) pairsList.append(pairy) jph = numpy.zeros(4) phaseOffsets = numpy.array(phaseOffsets)*numpy.pi/180 # arrayParameters[:,8:12] = numpy.unwrap(arrayParameters[:,8:12] + phaseOffsets) arrayParameters[:,8:12] = numpy.angle(numpy.exp(1j*(arrayParameters[:,8:12] + phaseOffsets))) meteorOps = SMOperations() if channelPositions is None: # channelPositions = [(2.5,0), (0,2.5), (0,0), (0,4.5), (-2,0)] #T channelPositions = [(4.5,2), (2,4.5), (2,2), (2,0), (0,2)] #Estrella pairslist0, distances = meteorOps.getPhasePairs(channelPositions) h = (hmin,hmax) arrayParameters = meteorOps.getMeteorParams(arrayParameters, azimuth, h, pairsList, distances, jph) dataOut.data_param = arrayParameters return class SMPhaseCalibration(Operation): __buffer = None __initime = None __dataReady = False __isConfig = False def __checkTime(self, currentTime, initTime, paramInterval, outputInterval): dataTime = currentTime + paramInterval deltaTime = dataTime - initTime if deltaTime >= outputInterval or deltaTime < 0: return True return False def __getGammas(self, pairs, d, phases): gammas = numpy.zeros(2) for i in range(len(pairs)): pairi = pairs[i] phip3 = phases[:,pairi[0]] d3 = d[pairi[0]] phip2 = phases[:,pairi[1]] d2 = d[pairi[1]] #Calculating gamma # jdcos = alp1/(k*d1) # jgamma = numpy.angle(numpy.exp(1j*(d0*alp1/d1 - alp0))) jgamma = -phip2*d3/d2 - phip3 jgamma = numpy.angle(numpy.exp(1j*jgamma)) # jgamma[jgamma>numpy.pi] -= 2*numpy.pi # jgamma[jgamma<-numpy.pi] += 2*numpy.pi #Revised distribution jgammaArray = numpy.hstack((jgamma,jgamma+0.5*numpy.pi,jgamma-0.5*numpy.pi)) #Histogram nBins = 64 rmin = -0.5*numpy.pi rmax = 0.5*numpy.pi phaseHisto = numpy.histogram(jgammaArray, bins=nBins, range=(rmin,rmax)) meteorsY = phaseHisto[0] phasesX = phaseHisto[1][:-1] width = phasesX[1] - phasesX[0] phasesX += width/2 #Gaussian aproximation bpeak = meteorsY.argmax() peak = meteorsY.max() jmin = bpeak - 5 jmax = bpeak + 5 + 1 if jmin<0: jmin = 0 jmax = 6 elif jmax > meteorsY.size: jmin = meteorsY.size - 6 jmax = meteorsY.size x0 = numpy.array([peak,bpeak,50]) coeff = optimize.leastsq(self.__residualFunction, x0, args=(meteorsY[jmin:jmax], phasesX[jmin:jmax])) #Gammas gammas[i] = coeff[0][1] return gammas def __residualFunction(self, coeffs, y, t): return y - self.__gauss_function(t, coeffs) def __gauss_function(self, t, coeffs): return coeffs[0]*numpy.exp(-0.5*((t - coeffs[1]) / coeffs[2])**2) def __getPhases(self, azimuth, h, pairsList, d, gammas, meteorsArray): meteorOps = SMOperations() nchan = 4 pairx = pairsList[0] #x es 0 pairy = pairsList[1] #y es 1 center_xangle = 0 center_yangle = 0 range_angle = numpy.array([10*numpy.pi,numpy.pi,numpy.pi/2,numpy.pi/4]) ntimes = len(range_angle) nstepsx = 20 nstepsy = 20 for iz in range(ntimes): min_xangle = -range_angle[iz]/2 + center_xangle max_xangle = range_angle[iz]/2 + center_xangle min_yangle = -range_angle[iz]/2 + center_yangle max_yangle = range_angle[iz]/2 + center_yangle inc_x = (max_xangle-min_xangle)/nstepsx inc_y = (max_yangle-min_yangle)/nstepsy alpha_y = numpy.arange(nstepsy)*inc_y + min_yangle alpha_x = numpy.arange(nstepsx)*inc_x + min_xangle penalty = numpy.zeros((nstepsx,nstepsy)) jph_array = numpy.zeros((nchan,nstepsx,nstepsy)) jph = numpy.zeros(nchan) # Iterations looking for the offset for iy in range(int(nstepsy)): for ix in range(int(nstepsx)): d3 = d[pairsList[1][0]] d2 = d[pairsList[1][1]] d5 = d[pairsList[0][0]] d4 = d[pairsList[0][1]] alp2 = alpha_y[iy] #gamma 1 alp4 = alpha_x[ix] #gamma 0 alp3 = -alp2*d3/d2 - gammas[1] alp5 = -alp4*d5/d4 - gammas[0] # jph[pairy[1]] = alpha_y[iy] # jph[pairy[0]] = -gammas[1] - alpha_y[iy]*d[pairy[1]]/d[pairy[0]] # jph[pairx[1]] = alpha_x[ix] # jph[pairx[0]] = -gammas[0] - alpha_x[ix]*d[pairx[1]]/d[pairx[0]] jph[pairsList[0][1]] = alp4 jph[pairsList[0][0]] = alp5 jph[pairsList[1][0]] = alp3 jph[pairsList[1][1]] = alp2 jph_array[:,ix,iy] = jph # d = [2.0,2.5,2.5,2.0] #falta chequear si va a leer bien los meteoros meteorsArray1 = meteorOps.getMeteorParams(meteorsArray, azimuth, h, pairsList, d, jph) error = meteorsArray1[:,-1] ind1 = numpy.where(error==0)[0] penalty[ix,iy] = ind1.size i,j = numpy.unravel_index(penalty.argmax(), penalty.shape) phOffset = jph_array[:,i,j] center_xangle = phOffset[pairx[1]] center_yangle = phOffset[pairy[1]] phOffset = numpy.angle(numpy.exp(1j*jph_array[:,i,j])) phOffset = phOffset*180/numpy.pi return phOffset def run(self, dataOut, hmin, hmax, channelPositions=None, nHours = 1): dataOut.flagNoData = True self.__dataReady = False dataOut.outputInterval = nHours*3600 if self.__isConfig == False: # self.__initime = dataOut.datatime.replace(minute = 0, second = 0, microsecond = 03) #Get Initial LTC time self.__initime = datetime.datetime.utcfromtimestamp(dataOut.utctime) self.__initime = (self.__initime.replace(minute = 0, second = 0, microsecond = 0) - datetime.datetime(1970, 1, 1)).total_seconds() self.__isConfig = True if self.__buffer is None: self.__buffer = dataOut.data_param.copy() else: self.__buffer = numpy.vstack((self.__buffer, dataOut.data_param)) self.__dataReady = self.__checkTime(dataOut.utctime, self.__initime, dataOut.paramInterval, dataOut.outputInterval) #Check if the buffer is ready if self.__dataReady: dataOut.utctimeInit = self.__initime self.__initime += dataOut.outputInterval #to erase time offset freq = dataOut.frequency c = dataOut.C #m/s lamb = c/freq k = 2*numpy.pi/lamb azimuth = 0 h = (hmin, hmax) # pairs = ((0,1),(2,3)) #Estrella # pairs = ((1,0),(2,3)) #T if channelPositions is None: # channelPositions = [(2.5,0), (0,2.5), (0,0), (0,4.5), (-2,0)] #T channelPositions = [(4.5,2), (2,4.5), (2,2), (2,0), (0,2)] #Estrella meteorOps = SMOperations() pairslist0, distances = meteorOps.getPhasePairs(channelPositions) #Checking correct order of pairs pairs = [] if distances[1] > distances[0]: pairs.append((1,0)) else: pairs.append((0,1)) if distances[3] > distances[2]: pairs.append((3,2)) else: pairs.append((2,3)) # distances1 = [-distances[0]*lamb, distances[1]*lamb, -distances[2]*lamb, distances[3]*lamb] meteorsArray = self.__buffer error = meteorsArray[:,-1] boolError = (error==0)|(error==3)|(error==4)|(error==13)|(error==14) ind1 = numpy.where(boolError)[0] meteorsArray = meteorsArray[ind1,:] meteorsArray[:,-1] = 0 phases = meteorsArray[:,8:12] #Calculate Gammas gammas = self.__getGammas(pairs, distances, phases) # gammas = numpy.array([-21.70409463,45.76935864])*numpy.pi/180 #Calculate Phases phasesOff = self.__getPhases(azimuth, h, pairs, distances, gammas, meteorsArray) phasesOff = phasesOff.reshape((1,phasesOff.size)) dataOut.data_output = -phasesOff dataOut.flagNoData = False self.__buffer = None return class SMOperations(): def __init__(self): return def getMeteorParams(self, arrayParameters0, azimuth, h, pairsList, distances, jph): arrayParameters = arrayParameters0.copy() hmin = h[0] hmax = h[1] #Calculate AOA (Error N 3, 4) #JONES ET AL. 1998 AOAthresh = numpy.pi/8 error = arrayParameters[:,-1] phases = -arrayParameters[:,8:12] + jph # phases = numpy.unwrap(phases) arrayParameters[:,3:6], arrayParameters[:,-1] = self.__getAOA(phases, pairsList, distances, error, AOAthresh, azimuth) #Calculate Heights (Error N 13 and 14) error = arrayParameters[:,-1] Ranges = arrayParameters[:,1] zenith = arrayParameters[:,4] arrayParameters[:,2], arrayParameters[:,-1] = self.__getHeights(Ranges, zenith, error, hmin, hmax) #----------------------- Get Final data ------------------------------------ # error = arrayParameters[:,-1] # ind1 = numpy.where(error==0)[0] # arrayParameters = arrayParameters[ind1,:] return arrayParameters def __getAOA(self, phases, pairsList, directions, error, AOAthresh, azimuth): arrayAOA = numpy.zeros((phases.shape[0],3)) cosdir0, cosdir = self.__getDirectionCosines(phases, pairsList,directions) arrayAOA[:,:2] = self.__calculateAOA(cosdir, azimuth) cosDirError = numpy.sum(numpy.abs(cosdir0 - cosdir), axis = 1) arrayAOA[:,2] = cosDirError azimuthAngle = arrayAOA[:,0] zenithAngle = arrayAOA[:,1] #Setting Error indError = numpy.where(numpy.logical_or(error == 3, error == 4))[0] error[indError] = 0 #Number 3: AOA not fesible indInvalid = numpy.where(numpy.logical_and((numpy.logical_or(numpy.isnan(zenithAngle), numpy.isnan(azimuthAngle))),error == 0))[0] error[indInvalid] = 3 #Number 4: Large difference in AOAs obtained from different antenna baselines indInvalid = numpy.where(numpy.logical_and(cosDirError > AOAthresh,error == 0))[0] error[indInvalid] = 4 return arrayAOA, error def __getDirectionCosines(self, arrayPhase, pairsList, distances): #Initializing some variables ang_aux = numpy.array([-8,-7,-6,-5,-4,-3,-2,-1,0,1,2,3,4,5,6,7,8])*2*numpy.pi ang_aux = ang_aux.reshape(1,ang_aux.size) cosdir = numpy.zeros((arrayPhase.shape[0],2)) cosdir0 = numpy.zeros((arrayPhase.shape[0],2)) for i in range(2): ph0 = arrayPhase[:,pairsList[i][0]] ph1 = arrayPhase[:,pairsList[i][1]] d0 = distances[pairsList[i][0]] d1 = distances[pairsList[i][1]] ph0_aux = ph0 + ph1 ph0_aux = numpy.angle(numpy.exp(1j*ph0_aux)) # ph0_aux[ph0_aux > numpy.pi] -= 2*numpy.pi # ph0_aux[ph0_aux < -numpy.pi] += 2*numpy.pi #First Estimation cosdir0[:,i] = (ph0_aux)/(2*numpy.pi*(d0 - d1)) #Most-Accurate Second Estimation phi1_aux = ph0 - ph1 phi1_aux = phi1_aux.reshape(phi1_aux.size,1) #Direction Cosine 1 cosdir1 = (phi1_aux + ang_aux)/(2*numpy.pi*(d0 + d1)) #Searching the correct Direction Cosine cosdir0_aux = cosdir0[:,i] cosdir0_aux = cosdir0_aux.reshape(cosdir0_aux.size,1) #Minimum Distance cosDiff = (cosdir1 - cosdir0_aux)**2 indcos = cosDiff.argmin(axis = 1) #Saving Value obtained cosdir[:,i] = cosdir1[numpy.arange(len(indcos)),indcos] return cosdir0, cosdir def __calculateAOA(self, cosdir, azimuth): cosdirX = cosdir[:,0] cosdirY = cosdir[:,1] zenithAngle = numpy.arccos(numpy.sqrt(1 - cosdirX**2 - cosdirY**2))*180/numpy.pi azimuthAngle = numpy.arctan2(cosdirX,cosdirY)*180/numpy.pi + azimuth#0 deg north, 90 deg east angles = numpy.vstack((azimuthAngle, zenithAngle)).transpose() return angles def __getHeights(self, Ranges, zenith, error, minHeight, maxHeight): Ramb = 375 #Ramb = c/(2*PRF) Re = 6371 #Earth Radius heights = numpy.zeros(Ranges.shape) R_aux = numpy.array([0,1,2])*Ramb R_aux = R_aux.reshape(1,R_aux.size) Ranges = Ranges.reshape(Ranges.size,1) Ri = Ranges + R_aux hi = numpy.sqrt(Re**2 + Ri**2 + (2*Re*numpy.cos(zenith*numpy.pi/180)*Ri.transpose()).transpose()) - Re #Check if there is a height between 70 and 110 km h_bool = numpy.sum(numpy.logical_and(hi > minHeight, hi < maxHeight), axis = 1) ind_h = numpy.where(h_bool == 1)[0] hCorr = hi[ind_h, :] ind_hCorr = numpy.where(numpy.logical_and(hi > minHeight, hi < maxHeight)) hCorr = hi[ind_hCorr][:len(ind_h)] heights[ind_h] = hCorr #Setting Error #Number 13: Height unresolvable echo: not valid height within 70 to 110 km #Number 14: Height ambiguous echo: more than one possible height within 70 to 110 km indError = numpy.where(numpy.logical_or(error == 13, error == 14))[0] error[indError] = 0 indInvalid2 = numpy.where(numpy.logical_and(h_bool > 1, error == 0))[0] error[indInvalid2] = 14 indInvalid1 = numpy.where(numpy.logical_and(h_bool == 0, error == 0))[0] error[indInvalid1] = 13 return heights, error def getPhasePairs(self, channelPositions): chanPos = numpy.array(channelPositions) listOper = list(itertools.combinations(list(range(5)),2)) distances = numpy.zeros(4) axisX = [] axisY = [] distX = numpy.zeros(3) distY = numpy.zeros(3) ix = 0 iy = 0 pairX = numpy.zeros((2,2)) pairY = numpy.zeros((2,2)) for i in range(len(listOper)): pairi = listOper[i] posDif = numpy.abs(chanPos[pairi[0],:] - chanPos[pairi[1],:]) if posDif[0] == 0: axisY.append(pairi) distY[iy] = posDif[1] iy += 1 elif posDif[1] == 0: axisX.append(pairi) distX[ix] = posDif[0] ix += 1 for i in range(2): if i==0: dist0 = distX axis0 = axisX else: dist0 = distY axis0 = axisY side = numpy.argsort(dist0)[:-1] axis0 = numpy.array(axis0)[side,:] chanC = int(numpy.intersect1d(axis0[0,:], axis0[1,:])[0]) axis1 = numpy.unique(numpy.reshape(axis0,4)) side = axis1[axis1 != chanC] diff1 = chanPos[chanC,i] - chanPos[side[0],i] diff2 = chanPos[chanC,i] - chanPos[side[1],i] if diff1<0: chan2 = side[0] d2 = numpy.abs(diff1) chan1 = side[1] d1 = numpy.abs(diff2) else: chan2 = side[1] d2 = numpy.abs(diff2) chan1 = side[0] d1 = numpy.abs(diff1) if i==0: chanCX = chanC chan1X = chan1 chan2X = chan2 distances[0:2] = numpy.array([d1,d2]) else: chanCY = chanC chan1Y = chan1 chan2Y = chan2 distances[2:4] = numpy.array([d1,d2]) # axisXsides = numpy.reshape(axisX[ix,:],4) # # channelCentX = int(numpy.intersect1d(pairX[0,:], pairX[1,:])[0]) # channelCentY = int(numpy.intersect1d(pairY[0,:], pairY[1,:])[0]) # # ind25X = numpy.where(pairX[0,:] != channelCentX)[0][0] # ind20X = numpy.where(pairX[1,:] != channelCentX)[0][0] # channel25X = int(pairX[0,ind25X]) # channel20X = int(pairX[1,ind20X]) # ind25Y = numpy.where(pairY[0,:] != channelCentY)[0][0] # ind20Y = numpy.where(pairY[1,:] != channelCentY)[0][0] # channel25Y = int(pairY[0,ind25Y]) # channel20Y = int(pairY[1,ind20Y]) # pairslist = [(channelCentX, channel25X),(channelCentX, channel20X),(channelCentY,channel25Y),(channelCentY, channel20Y)] pairslist = [(chanCX, chan1X),(chanCX, chan2X),(chanCY,chan1Y),(chanCY, chan2Y)] return pairslist, distances # def __getAOA(self, phases, pairsList, error, AOAthresh, azimuth): # # arrayAOA = numpy.zeros((phases.shape[0],3)) # cosdir0, cosdir = self.__getDirectionCosines(phases, pairsList) # # arrayAOA[:,:2] = self.__calculateAOA(cosdir, azimuth) # cosDirError = numpy.sum(numpy.abs(cosdir0 - cosdir), axis = 1) # arrayAOA[:,2] = cosDirError # # azimuthAngle = arrayAOA[:,0] # zenithAngle = arrayAOA[:,1] # # #Setting Error # #Number 3: AOA not fesible # indInvalid = numpy.where(numpy.logical_and((numpy.logical_or(numpy.isnan(zenithAngle), numpy.isnan(azimuthAngle))),error == 0))[0] # error[indInvalid] = 3 # #Number 4: Large difference in AOAs obtained from different antenna baselines # indInvalid = numpy.where(numpy.logical_and(cosDirError > AOAthresh,error == 0))[0] # error[indInvalid] = 4 # return arrayAOA, error # # def __getDirectionCosines(self, arrayPhase, pairsList): # # #Initializing some variables # ang_aux = numpy.array([-8,-7,-6,-5,-4,-3,-2,-1,0,1,2,3,4,5,6,7,8])*2*numpy.pi # ang_aux = ang_aux.reshape(1,ang_aux.size) # # cosdir = numpy.zeros((arrayPhase.shape[0],2)) # cosdir0 = numpy.zeros((arrayPhase.shape[0],2)) # # # for i in range(2): # #First Estimation # phi0_aux = arrayPhase[:,pairsList[i][0]] + arrayPhase[:,pairsList[i][1]] # #Dealias # indcsi = numpy.where(phi0_aux > numpy.pi) # phi0_aux[indcsi] -= 2*numpy.pi # indcsi = numpy.where(phi0_aux < -numpy.pi) # phi0_aux[indcsi] += 2*numpy.pi # #Direction Cosine 0 # cosdir0[:,i] = -(phi0_aux)/(2*numpy.pi*0.5) # # #Most-Accurate Second Estimation # phi1_aux = arrayPhase[:,pairsList[i][0]] - arrayPhase[:,pairsList[i][1]] # phi1_aux = phi1_aux.reshape(phi1_aux.size,1) # #Direction Cosine 1 # cosdir1 = -(phi1_aux + ang_aux)/(2*numpy.pi*4.5) # # #Searching the correct Direction Cosine # cosdir0_aux = cosdir0[:,i] # cosdir0_aux = cosdir0_aux.reshape(cosdir0_aux.size,1) # #Minimum Distance # cosDiff = (cosdir1 - cosdir0_aux)**2 # indcos = cosDiff.argmin(axis = 1) # #Saving Value obtained # cosdir[:,i] = cosdir1[numpy.arange(len(indcos)),indcos] # # return cosdir0, cosdir # # def __calculateAOA(self, cosdir, azimuth): # cosdirX = cosdir[:,0] # cosdirY = cosdir[:,1] # # zenithAngle = numpy.arccos(numpy.sqrt(1 - cosdirX**2 - cosdirY**2))*180/numpy.pi # azimuthAngle = numpy.arctan2(cosdirX,cosdirY)*180/numpy.pi + azimuth #0 deg north, 90 deg east # angles = numpy.vstack((azimuthAngle, zenithAngle)).transpose() # # return angles # # def __getHeights(self, Ranges, zenith, error, minHeight, maxHeight): # # Ramb = 375 #Ramb = c/(2*PRF) # Re = 6371 #Earth Radius # heights = numpy.zeros(Ranges.shape) # # R_aux = numpy.array([0,1,2])*Ramb # R_aux = R_aux.reshape(1,R_aux.size) # # Ranges = Ranges.reshape(Ranges.size,1) # # Ri = Ranges + R_aux # hi = numpy.sqrt(Re**2 + Ri**2 + (2*Re*numpy.cos(zenith*numpy.pi/180)*Ri.transpose()).transpose()) - Re # # #Check if there is a height between 70 and 110 km # h_bool = numpy.sum(numpy.logical_and(hi > minHeight, hi < maxHeight), axis = 1) # ind_h = numpy.where(h_bool == 1)[0] # # hCorr = hi[ind_h, :] # ind_hCorr = numpy.where(numpy.logical_and(hi > minHeight, hi < maxHeight)) # # hCorr = hi[ind_hCorr] # heights[ind_h] = hCorr # # #Setting Error # #Number 13: Height unresolvable echo: not valid height within 70 to 110 km # #Number 14: Height ambiguous echo: more than one possible height within 70 to 110 km # # indInvalid2 = numpy.where(numpy.logical_and(h_bool > 1, error == 0))[0] # error[indInvalid2] = 14 # indInvalid1 = numpy.where(numpy.logical_and(h_bool == 0, error == 0))[0] # error[indInvalid1] = 13 # # return heights, error class IGRFModel(Operation): ''' Written by R. Flores ''' """Operation to calculate Geomagnetic parameters. Parameters: ----------- None Example -------- op = proc_unit.addOperation(name='IGRFModel', optype='other') """ def __init__(self, **kwargs): Operation.__init__(self, **kwargs) self.aux=1 def run(self,dataOut): try: from schainpy.model.proc import mkfact_short_2020_2 except: log.warning('You should install "mkfact_short_2020" module to process IGRF Model') if self.aux==1: #dataOut.TimeBlockSeconds_First_Time=time.mktime(time.strptime(dataOut.TimeBlockDate)) #### we do not use dataOut.datatime.ctime() because it's the time of the second (next) block dataOut.TimeBlockSeconds_First_Time=dataOut.TimeBlockSeconds dataOut.bd_time=time.gmtime(dataOut.TimeBlockSeconds_First_Time) dataOut.year=dataOut.bd_time.tm_year+(dataOut.bd_time.tm_yday-1)/364.0 dataOut.ut=dataOut.bd_time.tm_hour+dataOut.bd_time.tm_min/60.0+dataOut.bd_time.tm_sec/3600.0 self.aux=0 dh = dataOut.heightList[1]-dataOut.heightList[0] dataOut.h=numpy.arange(0.0,dh*dataOut.MAXNRANGENDT,dh,dtype='float32') dataOut.bfm=numpy.zeros(dataOut.MAXNRANGENDT,dtype='float32') dataOut.bfm=numpy.array(dataOut.bfm,order='F') dataOut.thb=numpy.zeros(dataOut.MAXNRANGENDT,dtype='float32') dataOut.thb=numpy.array(dataOut.thb,order='F') dataOut.bki=numpy.zeros(dataOut.MAXNRANGENDT,dtype='float32') dataOut.bki=numpy.array(dataOut.bki,order='F') mkfact_short_2020_2.mkfact(dataOut.year,dataOut.h,dataOut.bfm,dataOut.thb,dataOut.bki,dataOut.MAXNRANGENDT) return dataOut class MergeProc(ProcessingUnit): def __init__(self): ProcessingUnit.__init__(self) def run(self, attr_data, attr_data_2 = None, attr_data_3 = None, attr_data_4 = None, attr_data_5 = None, mode=0): #print("*****************************Merge***************") self.dataOut = getattr(self, self.inputs[0]) data_inputs = [getattr(self, attr) for attr in self.inputs] #print(data_inputs) #print("Run: ",self.dataOut.runNextUnit) #exit(1) #print(self.dataOut.nHeights) #exit(1) #print("a:", [getattr(data, attr_data) for data in data_inputs][1]) #exit(1) if mode==0: data = numpy.concatenate([getattr(data, attr_data) for data in data_inputs]) setattr(self.dataOut, attr_data, data) if mode==1: #Hybrid #data = numpy.concatenate([getattr(data, attr_data) for data in data_inputs],axis=1) #setattr(self.dataOut, attr_data, data) setattr(self.dataOut, 'dataLag_spc', [getattr(data, attr_data) for data in data_inputs][0]) setattr(self.dataOut, 'dataLag_spc_LP', [getattr(data, attr_data) for data in data_inputs][1]) setattr(self.dataOut, 'dataLag_cspc', [getattr(data, attr_data_2) for data in data_inputs][0]) setattr(self.dataOut, 'dataLag_cspc_LP', [getattr(data, attr_data_2) for data in data_inputs][1]) #setattr(self.dataOut, 'nIncohInt', [getattr(data, attr_data_3) for data in data_inputs][0]) #setattr(self.dataOut, 'nIncohInt_LP', [getattr(data, attr_data_3) for data in data_inputs][1]) ''' print(self.dataOut.dataLag_spc_LP.shape) print(self.dataOut.dataLag_cspc_LP.shape) exit(1) ''' #self.dataOut.dataLag_spc_LP = numpy.transpose(self.dataOut.dataLag_spc_LP[0],(2,0,1)) #self.dataOut.dataLag_cspc_LP = numpy.transpose(self.dataOut.dataLag_cspc_LP,(3,1,2,0)) ''' print("Merge") print(numpy.shape(self.dataOut.dataLag_spc)) print(numpy.shape(self.dataOut.dataLag_spc_LP)) print(numpy.shape(self.dataOut.dataLag_cspc)) print(numpy.shape(self.dataOut.dataLag_cspc_LP)) exit(1) ''' #print(numpy.sum(self.dataOut.dataLag_spc_LP[2,:,164])/128) #print(numpy.sum(self.dataOut.dataLag_cspc_LP[0,:,30,1])/128) #exit(1) #print(self.dataOut.NDP) #print(self.dataOut.nNoiseProfiles) #self.dataOut.nIncohInt_LP = 128 self.dataOut.nProfiles_LP = 128#self.dataOut.nIncohInt_LP self.dataOut.nIncohInt_LP = self.dataOut.nIncohInt self.dataOut.NLAG = 16 self.dataOut.NRANGE = 200 self.dataOut.NSCAN = 128 #print(numpy.shape(self.dataOut.data_spc)) #exit(1) if mode==2: #HAE 2022 data = numpy.sum([getattr(data, attr_data) for data in data_inputs],axis=0) setattr(self.dataOut, attr_data, data) self.dataOut.nIncohInt *= 2 #meta = self.dataOut.getFreqRange(1)/1000. self.dataOut.freqRange = self.dataOut.getFreqRange(1)/1000. #exit(1) if mode==4: #Hybrid LP-SSheightProfiles #data = numpy.concatenate([getattr(data, attr_data) for data in data_inputs],axis=1) #setattr(self.dataOut, attr_data, data) setattr(self.dataOut, 'dataLag_spc', getattr(data_inputs[0], attr_data)) #DP setattr(self.dataOut, 'dataLag_cspc', getattr(data_inputs[0], attr_data_2)) #DP setattr(self.dataOut, 'dataLag_spc_LP', getattr(data_inputs[1], attr_data_3)) #LP #setattr(self.dataOut, 'dataLag_cspc_LP', getattr(data_inputs[1], attr_data_4)) #LP #setattr(self.dataOut, 'data_acf', getattr(data_inputs[1], attr_data_5)) #LP setattr(self.dataOut, 'data_acf', getattr(data_inputs[1], attr_data_5)) #LP #print("Merge data_acf: ",self.dataOut.data_acf.shape) #self.dataOut.nIncohInt_LP = 128 #self.dataOut.nProfiles_LP = 128#self.dataOut.nIncohInt_LP self.dataOut.nProfiles_LP = 16#28#self.dataOut.nIncohInt_LP self.dataOut.nProfiles_LP = self.dataOut.data_acf.shape[1]#28#self.dataOut.nIncohInt_LP self.dataOut.NSCAN = 128 self.dataOut.nIncohInt_LP = self.dataOut.nIncohInt*self.dataOut.NSCAN #print("sahpi",self.dataOut.nIncohInt_LP) #exit(1) self.dataOut.NLAG = 16 self.dataOut.NLAG = self.dataOut.data_acf.shape[1] self.dataOut.NRANGE = self.dataOut.data_acf.shape[-1] #print(numpy.shape(self.dataOut.data_spc)) #exit(1) if mode==5: data = numpy.concatenate([getattr(data, attr_data) for data in data_inputs]) setattr(self.dataOut, attr_data, data) data = numpy.concatenate([getattr(data, attr_data_2) for data in data_inputs]) setattr(self.dataOut, attr_data_2, data) if mode==6: #Hybrid Spectra-Voltage #data = numpy.concatenate([getattr(data, attr_data) for data in data_inputs],axis=1) #setattr(self.dataOut, attr_data, data) setattr(self.dataOut, 'dataLag_spc', getattr(data_inputs[1], attr_data)) #DP setattr(self.dataOut, 'dataLag_cspc', getattr(data_inputs[1], attr_data_2)) #DP setattr(self.dataOut, 'output_LP_integrated', getattr(data_inputs[0], attr_data_3)) #LP #setattr(self.dataOut, 'dataLag_cspc_LP', getattr(data_inputs[1], attr_data_4)) #LP #setattr(self.dataOut, 'data_acf', getattr(data_inputs[1], attr_data_5)) #LP #setattr(self.dataOut, 'data_acf', getattr(data_inputs[1], attr_data_5)) #LP #print("Merge data_acf: ",self.dataOut.data_acf.shape) #print(self.dataOut.NSCAN) self.dataOut.nIncohInt = int(self.dataOut.NAVG * self.dataOut.nint) #print(self.dataOut.dataLag_spc.shape) self.dataOut.nProfiles = self.dataOut.nProfiles_DP = self.dataOut.dataLag_spc.shape[1] ''' #self.dataOut.nIncohInt_LP = 128 #self.dataOut.nProfiles_LP = 128#self.dataOut.nIncohInt_LP self.dataOut.nProfiles_LP = 16#28#self.dataOut.nIncohInt_LP self.dataOut.nProfiles_LP = self.dataOut.data_acf.shape[1]#28#self.dataOut.nIncohInt_LP self.dataOut.NSCAN = 128 self.dataOut.nIncohInt_LP = self.dataOut.nIncohInt*self.dataOut.NSCAN #print("sahpi",self.dataOut.nIncohInt_LP) #exit(1) self.dataOut.NLAG = 16 self.dataOut.NLAG = self.dataOut.data_acf.shape[1] self.dataOut.NRANGE = self.dataOut.data_acf.shape[-1] ''' #print(numpy.shape(self.dataOut.data_spc)) #print("*************************GOOD*************************") #exit(1) if mode==11: #MST ISR #data = numpy.concatenate([getattr(data, attr_data) for data in data_inputs],axis=1) #setattr(self.dataOut, attr_data, data) #setattr(self.dataOut, 'ph2', [getattr(data, attr_data) for data in data_inputs][1]) #setattr(self.dataOut, 'dphi', [getattr(data, attr_data_2) for data in data_inputs][1]) #setattr(self.dataOut, 'sdp2', [getattr(data, attr_data_3) for data in data_inputs][1]) setattr(self.dataOut, 'ph2', getattr(data_inputs[1], attr_data)) #DP setattr(self.dataOut, 'dphi', getattr(data_inputs[1], attr_data_2)) #DP setattr(self.dataOut, 'sdp2', getattr(data_inputs[1], attr_data_3)) #DP print("MST Density", numpy.shape(self.dataOut.ph2)) print("cf MST: ", self.dataOut.cf) #exit(1) #print("MST Density", self.dataOut.ph2[116:283]) print("MST Density", self.dataOut.ph2[80:120]) print("MST dPhi", self.dataOut.dphi[80:120]) self.dataOut.ph2 *= self.dataOut.cf#0.0008136899 #print("MST Density", self.dataOut.ph2[116:283]) self.dataOut.sdp2 *= 0#self.dataOut.cf#0.0008136899 #print("MST Density", self.dataOut.ph2[116:283]) print("MST Density", self.dataOut.ph2[80:120]) self.dataOut.NSHTS = int(numpy.shape(self.dataOut.ph2)[0]) dH = self.dataOut.heightList[1]-self.dataOut.heightList[0] dH /= self.dataOut.windowOfFilter self.dataOut.heightList = numpy.arange(0,self.dataOut.NSHTS)*dH + dH #print("heightList: ", self.dataOut.heightList) self.dataOut.NDP = self.dataOut.NSHTS #exit(1) #print(self.dataOut.heightList) class MST_Den_Conv(Operation): ''' Written by R. Flores ''' """Operation to calculate Geomagnetic parameters. Parameters: ----------- None Example -------- op = proc_unit.addOperation(name='MST_Den_Conv', optype='other') """ def __init__(self, **kwargs): Operation.__init__(self, **kwargs) def run(self,dataOut): dataOut.PowDen = numpy.zeros((1,dataOut.NDP)) dataOut.PowDen[0] = numpy.copy(dataOut.ph2[:dataOut.NDP]) dataOut.FarDen = numpy.zeros((1,dataOut.NDP)) dataOut.FarDen[0] = numpy.copy(dataOut.dphi[:dataOut.NDP]) print("pow den shape", numpy.shape(dataOut.PowDen)) print("far den shape", numpy.shape(dataOut.FarDen)) return dataOut